Relevant Regulations and Standards
Resmethrin(F04043)
| Common Name | Resmethrin(F04043) |
| FRCD ID | F04043 |
| Formula | C22H26O3 |
| InChI Key | VEMKTZHHVJILDY-UHFFFAOYSA-N |
| InChI | InChI=1S/C22H26O3/c1-15(2)10-19-20(22(19,3)4)21(23)25-14-17-12-18(24-13-17)11-16-8-6-5-7-9-16/h5-10,12-13,19-20H,11,14H2,1-4H3 |
| Canonical SMILES | CC(=CC1C(C1(C)C)C(=O)OCC2=COC(=C2)CC3=CC=CC=C3)C |
| Isomeric SMILES | CC(=CC1C(C1(C)C)C(=O)OCC2=COC(=C2)CC3=CC=CC=C3)C |
| Classifies | Pesticide |
| Update Date | Nov 13, 2018 17:07 |
MRLs
| Food | Product Code | Country | MRLs | Application Date | Notes |
|---|---|---|---|---|---|
| Chervil | Britain | 0.1mg/kg | |||
| Witloof | Britain | 0.1mg/kg | |||
| Salsify | Britain | 0.1mg/kg | |||
| Huckleberry | Japan | 0.1ppm | |||
| Other Cucurbitaceous Vegetables | Japan | 0.1ppm | |||
| Other Liliaceous Vegetables | Japan | 0.1ppm | |||
| Other Composite Vegetables | Japan | 0.1ppm | |||
| Brussels Sprouts | Britain | 0.1mg/kg | |||
| Celery Leaves | Britain | 0.1mg/kg | |||
| Parsley | Britain | 0.1mg/kg | |||
| Chives | Britain | 0.1mg/kg | |||
| Milk & Dairy Produce | Britain | 0.1mg/kg | |||
| Meat, Fat & Preparations Of Meat | Britain | 0.1mg/kg | |||
| Other Cereals Do Not Include Rice | Britain | 0.05mg/kg | |||
| Rice | Britain | 0.05mg/kg | |||
| Millet | Britain | 0.05mg/kg | |||
| Buckwheat | Britain | 0.05mg/kg | |||
| Maize | Britain | 0.05mg/kg | |||
| Triticale | Britain | 0.05mg/kg | |||
| Oats | Britain | 0.05mg/kg |