Relevant Regulations and Standards
Chlorothalonil(F04333)
| Common Name | Chlorothalonil(F04333) |
| FRCD ID | F04333 |
| Formula | C8Cl4N2 |
| InChI Key | CRQQGFGUEAVUIL-UHFFFAOYSA-N |
| InChI | InChI=1S/C8Cl4N2/c9-5-3(1-13)6(10)8(12)7(11)4(5)2-14 |
| Canonical SMILES | C(#N)C1=C(C(=C(C(=C1Cl)Cl)Cl)C#N)Cl |
| Isomeric SMILES | C(#N)C1=C(C(=C(C(=C1Cl)Cl)Cl)C#N)Cl |
| Classifies | Pesticide |
| Update Date | Nov 13, 2018 17:07 |
MRLs
| Food | Product Code | Country | MRLs | Application Date | Notes |
|---|---|---|---|---|---|
| Garlic | Japan | 10ppm | |||
| Onion | Japan | 0.5ppm | |||
| Potato | CAC | 0. 2mg/kg | |||
| Squash | CAC | 5mg/kg | |||
| Grapes | CAC | 0. 5mg/kg | |||
| Currants | CAC | 5mg/kg | |||
| Celery | CAC | 10mg/kg | |||
| Liquorice | 0840010 | European Union | 0.05* | 11/02/2016 | |
| Cranberries (Cloudberries, Crowberries, Crowberries, Crowberries, Crowberries, Muntries, Partridge berries, Small cranberries/European cranberries,) | 0154020 | European Union | 5 | 11/02/2016 | |
| Currants (black, red and white) | 0154030 | European Union | 0.01* | 11/02/2016 | |
| Gooseberries (green, red and yellow) | 0154040 | European Union | 15 | 11/02/2016 | |
| Rose hips | 0154050 | European Union | 0.01* | 11/02/2016 | |
| Mulberries (black and white) | 0154060 | European Union | 0.01* | 11/02/2016 | |
| Azaroles/Mediterranean medlars | 0154070 | European Union | 0.01* | 11/02/2016 | |
| Elderberries (Bayberries, Buffalo berries, Che berries, Dwarf elderberries, Guelder rose berries, Hawberries, Midland hawberries, Phalsa fruits, Riberries, Rowan berries, Saskatoons/saskatoons berries/Pacific serviceberries, Silverberries/Russian olives, Sorb berries/sorb apples,) | 0154080 | European Union | 0.01* | 11/02/2016 | |
| Others (2) | 0154990 | European Union | 0.01* | 11/02/2016 | |
| (a) edible peel | 0161000 | European Union | 0.01* | 11/02/2016 | |
| Dates (Açaí berries, Awara palm fruits, Doum palm fruits,) | 0161010 | European Union | 0.01* | 11/02/2016 | |
| Figs | 0161020 | European Union | 0.01* | 11/02/2016 | |
| Table olives (Chinese black olives, Chinese white olives, Desert dates,) | 0161030 | European Union | 0.01* | 11/02/2016 |