Relevant Regulations and Standards
2,6-Dichlorobenzonitrile(F04334)
| Common Name | 2,6-Dichlorobenzonitrile(F04334) |
| FRCD ID | F04334 |
| Formula | C7H3Cl2N |
| InChI Key | YOYAIZYFCNQIRF-UHFFFAOYSA-N |
| InChI | InChI=1S/C7H3Cl2N/c8-6-2-1-3-7(9)5(6)4-10/h1-3H |
| Canonical SMILES | C1=CC(=C(C(=C1)Cl)C#N)Cl |
| Isomeric SMILES | C1=CC(=C(C(=C1)Cl)C#N)Cl |
| Classifies | Pesticide |
| Update Date | Nov 13, 2018 17:07 |
MRLs
| Food | Product Code | Country | MRLs | Application Date | Notes |
|---|---|---|---|---|---|
| Spinaches (Amaranths/Chinese spinaches/pak-khom, Amaranths/Chinese spinaches/pak-khom, Amaranths/Chinese spinaches/pak-khom, Amaranths/Chinese spinaches/pak-khom, Amaranths/Chinese spinaches/pak-khom, Bitterblad/bitawiri, Bitterleaves, Black eyed peas/cowpeas leaves, Cassava leaves, Garland chrysanthemums/tong ho, New Zealand spinaches, Oraches, Sweet potato leaves, Tannias/arrowleaf elephant ears/tajer leaves,) | 0252010 | European Union | 0.01* | 26/04/2013 | |
| Red mustards | 0251070 | European Union | 0.01* | 26/04/2013 | |
| Citrus fruits | 0110000 | European Union | 0.01* | 26/04/2013 | |
| Mulberries (black and white) | 0154060 | European Union | 0.01* | 26/04/2013 | |
| Limes (Indian sweet limes/Palestine sweet limes, Kaffir limes, Sweet limes/mosambis, Tahiti limes, Limequats,) | 0110040 | European Union | 0.01* | 26/04/2013 | |
| Mandarins (Calamondins, Clementines, Cleopatra mandarins, Minneolas, Satsumas/clausellinas, Tangerines/dancy mandarins, Tangors, Other hybrids of Citrus reticulata, not elsewhere mentioned,) | 0110050 | European Union | 0.01* | 26/04/2013 | |
| Others (2) | 0110990 | European Union | 0.01* | 26/04/2013 | |
| Tree nuts | 0120000 | European Union | 0.02* | 26/04/2013 | |
| Almonds (Apricot kernels, Bitter almonds, Canarium nuts/galip nuts, Pili nuts, Okari nuts,) | 0120010 | European Union | 0.02* | 26/04/2013 | |
| Brazil nuts | 0120020 | European Union | 0.02* | 26/04/2013 | |
| Cashew nuts | 0120030 | European Union | 0.02* | 26/04/2013 | |
| Chestnuts | 0120040 | European Union | 0.02* | 26/04/2013 | |
| Coconuts (Areca nuts/betel nuts,) | 0120050 | European Union | 0.02* | 26/04/2013 | |
| Hazelnuts/cobnuts (Acorns, Filberts,) | 0120060 | European Union | 0.02* | 26/04/2013 | |
| Macadamias | 0120070 | European Union | 0.02* | 26/04/2013 | |
| Pecans (Hickory nuts,) | 0120080 | European Union | 0.02* | 26/04/2013 | |
| Pistachios | 0120100 | European Union | 0.02* | 26/04/2013 | |
| Walnuts | 0120110 | European Union | 0.02* | 26/04/2013 | |
| Others (2) | 0120990 | European Union | 0.02* | 26/04/2013 | |
| Pome fruits | 0130000 | European Union | 0.01* | 26/04/2013 |