| Common Name | Tau-Fluvalinate(F04383) | 
| FRCD ID | F04383 | 
| Formula | C26H22ClF3N2O3 | 
| InChI Key | INISTDXBRIBGOC-XMMISQBUSA-N  | 
| InChI | InChI=1S/C26H22ClF3N2O3/c1-16(2)24(32-22-12-11-18(14-21(22)27)26(28,29)30)25(33)35-23(15-31)17-7-6-10-20(13-17)34-19-8-4-3-5-9-19/h3-14,16,23-24,32H,1-2H3/t23?,24-/m1/s1  | 
| Canonical SMILES | CC(C)C(C(=O)OC(C#N)C1=CC(=CC=C1)OC2=CC=CC=C2)NC3=C(C=C(C=C3)C(F)(F)F)Cl  | 
| Isomeric SMILES | CC(C)[C@H](C(=O)OC(C#N)C1=CC(=CC=C1)OC2=CC=CC=C2)NC3=C(C=C(C=C3)C(F)(F)F)Cl  | 
| Classifies | Pesticide | 
| Update Date | Nov 13, 2018 17:07 | 
| Food | Product Code | Country | MRLs | Application Date | Notes | 
|---|---|---|---|---|---|
| Cashew nuts | 0120030 | European Union | 0.01* | 20/10/2017 | |
| Pine nut kernels (Pine nut kernels from other species than Pinus pinea, Pine nut kernels from other species than Pinus pinea, Pine nut kernels from other species than Pinus pinea, Pine nut kernels from other species than Pinus pinea, Pine nut kernels from other species than Pinus pinea, Pine nut kernels from other species than Pinus pinea, Pine nut kernels from other species than Pinus pinea, Other species of genus Pinus, not elsewhere mentioned,) | 0120090 | European Union | 0.01* | 20/10/2017 | |
| Blueberries (Aronia berries/chokeberries (black, purple and red), Aronia berries/chokeberries (black, purple and red), Aronia berries/chokeberries (black, purple and red), Bearberries, Bilberries/European blueberries/whortleberries, Bog bilberries, European barberries, Golden currant/buffalo currant, Haskaps/blue honeysuckles, Huckleberries, Jostaberries, Juneberries, Myrtle berries, Native currant, Red bilberries/cowberries, Red bilberries/lingonberries, Salal/shallon berries, Sea buckthorns/sallow thorns, Serviceberries, Ugniberries/Chilean guavas, Worcesterberries, Other species and hybrids of genera Ribes and Vaccinium, not elsewhere mentioned,) | 0154010 | European Union | 0.5 | 20/10/2017 | |
| Kaki/Japanese persimmons | 0161060 | European Union | 0.01* | 20/10/2017 | |
| Jambuls/jambolans (Acerolas/Barbados cherries, Arbutus berries, Camu camus, Carandas, Coco plums, Grumichamas/Brazil cherries, Hog plums/yellow mombins, Java apples, Otaheite gooseberries, Sea grapes, Surinam cherries, Water apples, Water berries, Water pears,) | 0161070 | European Union | 0.01* | 20/10/2017 | |
| Sweet peppers/bell peppers (Chili peppers,) | 0231020 | European Union | 0.01* | 20/10/2017 | |
| Aubergines/eggplants (Antroewas/African eggplants/gboma, Ethiopian eggplants/gilo', Pepinos, Thorn apples, Turkey berries/devil's figs/pea eggplants/pea aubergines, Kangaroo apples/poroporo,) | 0231030 | European Union | 0.15 | 20/10/2017 | |
| Celery leaves (Angelica (leaves and stems), Burnet, Caraway leaves, Coriander leaves, Culantro/false coriander leaves, Dill leaves, Fennel leaves, Fenugreek leaves, Herb of grace/rue, Lovage leaves, Pimpernel/greater burnet-saxifrage, Salad burnet/lady's mantle, Sorrel/dock, Sorrel/dock, Sorrel/dock, Sorrel/dock, Sweet cicely,) | 0256030 | European Union | 0.01* | 20/10/2017 | |
| Basil and edible flowers (Apple mint, Asiatic pennywort, Bergamot mint/eau-de-Cologne mint, Corsican mint, Courgette (edible flowers), Gingermint, Greek bush basil, Hoary basil, Holy basil/tulsi, Lemon balm, Lemon basil, Lesser calamint, Lizard tail/dap ca, Marigold (edible flowers), Marigold (edible flowers), Other species of the genus Tagetes, not elsewhere mentioned, Nasturtium (leaves and edible flowers), Nasturtium (leaves and edible flowers), Pennyroyal, Peppermint, Pot marigold (edible flowers), Rice paddy herb/phak ka yaeng, Spearmint, Thai basil, Vietnamese mint, Water mint, Other edible flowers, Other species and hybrids of genus Mentha, not elsewhere mentioned,) | 0256080 | European Union | 0.01* | 20/10/2017 | |
| Brazil nuts | 0120020 | European Union | 0.01* | 20/10/2017 | |
| Citrus fruits | 0110000 | European Union | 0.4 | 20/10/2017 | |
| Grapefruits (Natsudaidais, Shaddocks/pomelos, Sweeties/oroblancos, Tangelolos, Tangelos (except minneolas)/Ugli®, Other hybrids of Citrus paradisi, not elsewhere mentioned,) | 0110010 | European Union | 0.4 | 20/10/2017 | |
| Oranges (Bergamots, Bitter oranges/sour oranges, Blood oranges, Cara caras, Chinottos, Trifoliate oranges, Other hybrids of Citrus sinensis, not elsewhere mentioned,) | 0110020 | European Union | 0.4 | 20/10/2017 | |
| Lemons (Buddha's hands/Buddha's fingers, Citrons,) | 0110030 | European Union | 0.4 | 20/10/2017 | |
| Limes (Indian sweet limes/Palestine sweet limes, Kaffir limes, Sweet limes/mosambis, Tahiti limes, Limequats,) | 0110040 | European Union | 0.4 | 20/10/2017 | |
| Mandarins (Calamondins, Clementines, Cleopatra mandarins, Minneolas, Satsumas/clausellinas, Tangerines/dancy mandarins, Tangors, Other hybrids of Citrus reticulata, not elsewhere mentioned,) | 0110050 | European Union | 0.4 | 20/10/2017 | |
| Others (2) | 0110990 | European Union | 0.4 | 20/10/2017 | |
| Tree nuts | 0120000 | European Union | 0.01* | 20/10/2017 | |
| Almonds (Apricot kernels, Bitter almonds, Canarium nuts/galip nuts, Pili nuts, Okari nuts,) | 0120010 | European Union | 0.01* | 20/10/2017 | |
| Chestnuts | 0120040 | European Union | 0.01* | 20/10/2017 |