Relevant Regulations and Standards
Fenthion(F04846)
| Common Name | Fenthion(F04846) |
| FRCD ID | F04846 |
| Formula | C10H15O3PS2 |
| InChI Key | PNVJTZOFSHSLTO-UHFFFAOYSA-N |
| InChI | InChI=1S/C10H15O3PS2/c1-8-7-9(5-6-10(8)16-4)13-14(15,11-2)12-3/h5-7H,1-4H3 |
| Canonical SMILES | CC1=C(C=CC(=C1)OP(=S)(OC)OC)SC |
| Isomeric SMILES | CC1=C(C=CC(=C1)OP(=S)(OC)OC)SC |
| Classifies | Pesticide |
| Update Date | Nov 13, 2018 17:07 |
MRLs
| Food | Product Code | Country | MRLs | Application Date | Notes |
|---|---|---|---|---|---|
| Chinese Cabbage | Britain | 0.01mg/kg | |||
| Other Small Fruit & Berries (Other Than Wild) | Britain | 0.01mg/kg | |||
| Edible Olive Oil(Limited To Virgin Oil) | Japan | １ppm | |||
| Other Terrestrial Mammals,Edible Offal | Japan | 0.2ppm | |||
| Pig,Muscle | Japan | 0.5ppm | |||
| Pine nut kernels (Pine nut kernels from other species than Pinus pinea, Pine nut kernels from other species than Pinus pinea, Pine nut kernels from other species than Pinus pinea, Pine nut kernels from other species than Pinus pinea, Pine nut kernels from other species than Pinus pinea, Pine nut kernels from other species than Pinus pinea, Pine nut kernels from other species than Pinus pinea, Other species of genus Pinus, not elsewhere mentioned,) | 0120090 | European Union | 0.02* | 21/10/2011 | |
| Cherries (sweet) (Black cherries, Capulins, Chokecherries, Cornelian cherries/European corniols, Nanking cherries, Sour cherries/morello cherries,) | 0140020 | European Union | 0.01* | 21/10/2011 | |
| Plums (American plums, Beach plums, Cherry plums /myrabolans, Chickasaw plums, Chinese jujubes/red dates/Chinese dates, Damsons/ bullaces, Gages/greengages/Reine Claudes, Japanese plums, Klamath plums, Mirabelles, Plumcots, Prunus Nadia®, Sloes/blackthorne berries,) | 0140040 | European Union | 0.01* | 21/10/2011 | |
| Blueberries (Aronia berries/chokeberries (black, purple and red), Aronia berries/chokeberries (black, purple and red), Aronia berries/chokeberries (black, purple and red), Bearberries, Bilberries/European blueberries/whortleberries, Bog bilberries, European barberries, Golden currant/buffalo currant, Haskaps/blue honeysuckles, Huckleberries, Jostaberries, Juneberries, Myrtle berries, Native currant, Red bilberries/cowberries, Red bilberries/lingonberries, Salal/shallon berries, Sea buckthorns/sallow thorns, Serviceberries, Ugniberries/Chilean guavas, Worcesterberries, Other species and hybrids of genera Ribes and Vaccinium, not elsewhere mentioned,) | 0154010 | European Union | 0.01* | 21/10/2011 | |
| Papayas (Akee apples, Feijoas/pineapple guavas, Langsats/lanzones/longkongs, Mangosteens, Naranjillas/lulos, Paw paws, Tamarillos,) | 0163040 | European Union | 0.01* | 21/10/2011 | |
| Cherimoyas (Elephant apples, Ilamas, Mammey sapotes, Marmeladedos, Pulasans, Rambutans/hairy litchis, Sapodillas, Sweetsops/sugar apples, Wild sweetsops/custard apples,) | 0163060 | European Union | 0.01* | 21/10/2011 | |
| Others (2) | 0233990 | European Union | 0.01* | 21/10/2011 | |
| Brassica vegetables (excluding brassica roots and brassica baby leaf crops) | 0240000 | European Union | 0.01* | 21/10/2011 | |
| Kales (Borecoles/collards greens/curly kales, Cow cabbages/stem kales, Cow cabbages/Jersey kales, Kohlrabies leaves (6), Rape kales/Siberian kales, Portuguese kales/tronchuda kales/Portuguese cabbages, Palm tree kale/lacinato/black kale, Radish leaves,) | 0243020 | European Union | 0.01* | 21/10/2011 | |
| Basil and edible flowers (Apple mint, Asiatic pennywort, Bergamot mint/eau-de-Cologne mint, Corsican mint, Courgette (edible flowers), Gingermint, Greek bush basil, Hoary basil, Holy basil/tulsi, Lemon balm, Lemon basil, Lesser calamint, Lizard tail/dap ca, Marigold (edible flowers), Marigold (edible flowers), Other species of the genus Tagetes, not elsewhere mentioned, Nasturtium (leaves and edible flowers), Nasturtium (leaves and edible flowers), Pennyroyal, Peppermint, Pot marigold (edible flowers), Rice paddy herb/phak ka yaeng, Spearmint, Thai basil, Vietnamese mint, Water mint, Other edible flowers, Other species and hybrids of genus Mentha, not elsewhere mentioned,) | 0256080 | European Union | 0.01* | 21/10/2011 | |
| Pumpkin seeds (Watermelon seeds, Other seeds of species of familia Cucurbitaceae, not elsewhere mentioned,) | 0401100 | European Union | 0.02* | 21/10/2011 | |
| Apricots (Japanese apricots/Umes, Nectacots,) | 0140010 | European Union | 0.01* | 21/10/2011 | |
| Citrus fruits | 0110000 | European Union | 0.01* | 21/10/2011 | |
| Grapefruits (Natsudaidais, Shaddocks/pomelos, Sweeties/oroblancos, Tangelolos, Tangelos (except minneolas)/Ugli®, Other hybrids of Citrus paradisi, not elsewhere mentioned,) | 0110010 | European Union | 0.01* | 21/10/2011 | |
| Oranges (Bergamots, Bitter oranges/sour oranges, Blood oranges, Cara caras, Chinottos, Trifoliate oranges, Other hybrids of Citrus sinensis, not elsewhere mentioned,) | 0110020 | European Union | 0.01* | 21/10/2011 |