Relevant Regulations and Standards
Chloridazon(F05039)
| Common Name | Chloridazon(F05039) |
| FRCD ID | F05039 |
| Formula | C10H8ClN3O |
| InChI Key | WYKYKTKDBLFHCY-UHFFFAOYSA-N |
| InChI | InChI=1S/C10H8ClN3O/c11-9-8(12)6-13-14(10(9)15)7-4-2-1-3-5-7/h1-6H,12H2 |
| Canonical SMILES | C1=CC=C(C=C1)N2C(=O)C(=C(C=N2)N)Cl |
| Isomeric SMILES | C1=CC=C(C=C1)N2C(=O)C(=C(C=N2)N)Cl |
| Classifies | Pesticide |
| Update Date | Nov 13, 2018 17:07 |
MRLs
| Food | Product Code | Country | MRLs | Application Date | Notes |
|---|---|---|---|---|---|
| (d) any other parts of the plant (Blond psyllium (seeds, husks), Chamomile (seeds), Cherries (sweet) (stems), China/Jesuit's bark (bark), China/Jesuit's bark (bark), Cocoa (husks), Condurango (bark), Dwarf mountain pine (shoots), Fir (shoots), Fleawort (seeds), Fragrant sumac (bark), Guarana (seeds), Hibiscus (seeds), Horse-chestnut (seeds, bark), Juniper (bark, wood, shoots), Lapacho (bark), Lignum vitae (bark, wood), Parsley (fruits), Purging cassia (fruits), Quassia (bark, wood), Red sandalwood (bark, wood), Soap-bark tree (bark), Sour cherry/morello cherry (stems), Sweet corn (stigmas, styles), Wild angelica (fruits), Witch hazel (bark), Other herbal infusions from any other parts of the plant,) | 0639000 | European Union | 0.1* | 19/01/2017 | |
| Edible offals (other than liver and kidney) | 1014050 | European Union | 0.4 | 19/01/2017 | |
| Citrus fruits | 0110000 | European Union | 0.1* | 19/01/2017 | |
| Liver | 1014030 | European Union | 0.3 | 19/01/2017 | |
| Kidney | 1014040 | European Union | 0.4 | 19/01/2017 | |
| FRUITS, FRESH or FROZEN; TREE NUTS | 0100000 | European Union | 0.1* | 19/01/2017 | |
| Grapefruits (Natsudaidais, Shaddocks/pomelos, Sweeties/oroblancos, Tangelolos, Tangelos (except minneolas)/Ugli®, Other hybrids of Citrus paradisi, not elsewhere mentioned,) | 0110010 | European Union | 0.1* | 19/01/2017 | |
| Oranges (Bergamots, Bitter oranges/sour oranges, Blood oranges, Cara caras, Chinottos, Trifoliate oranges, Other hybrids of Citrus sinensis, not elsewhere mentioned,) | 0110020 | European Union | 0.1* | 19/01/2017 | |
| Lemons (Buddha's hands/Buddha's fingers, Citrons,) | 0110030 | European Union | 0.1* | 19/01/2017 | |
| Limes (Indian sweet limes/Palestine sweet limes, Kaffir limes, Sweet limes/mosambis, Tahiti limes, Limequats,) | 0110040 | European Union | 0.1* | 19/01/2017 | |
| Mandarins (Calamondins, Clementines, Cleopatra mandarins, Minneolas, Satsumas/clausellinas, Tangerines/dancy mandarins, Tangors, Other hybrids of Citrus reticulata, not elsewhere mentioned,) | 0110050 | European Union | 0.1* | 19/01/2017 | |
| Others (2) | 0110990 | European Union | 0.1* | 19/01/2017 | |
| Tree nuts | 0120000 | European Union | 0.1* | 19/01/2017 | |
| Almonds (Apricot kernels, Bitter almonds, Canarium nuts/galip nuts, Pili nuts, Okari nuts,) | 0120010 | European Union | 0.1* | 19/01/2017 | |
| Brazil nuts | 0120020 | European Union | 0.1* | 19/01/2017 | |
| Cashew nuts | 0120030 | European Union | 0.1* | 19/01/2017 | |
| Chestnuts | 0120040 | European Union | 0.1* | 19/01/2017 | |
| Coconuts (Areca nuts/betel nuts,) | 0120050 | European Union | 0.1* | 19/01/2017 | |
| Hazelnuts/cobnuts (Acorns, Filberts,) | 0120060 | European Union | 0.1* | 19/01/2017 | |
| Macadamias | 0120070 | European Union | 0.1* | 19/01/2017 |