| Common Name | Cyprodinil(F05051) |
| FRCD ID | F05051 |
| Formula | C14H15N3 |
| InChI Key | HAORKNGNJCEJBX-UHFFFAOYSA-N |
| InChI | InChI=1S/C14H15N3/c1-10-9-13(11-7-8-11)17-14(15-10)16-12-5-3-2-4-6-12/h2-6,9,11H,7-8H2,1H3,(H,15,16,17) |
| Canonical SMILES | CC1=NC(=NC(=C1)C2CC2)NC3=CC=CC=C3 |
| Isomeric SMILES | CC1=NC(=NC(=C1)C2CC2)NC3=CC=CC=C3 |
| Classifies | Pesticide |
| Update Date | Nov 13, 2018 17:07 |
| Food | Product Code | Country | MRLs | Application Date | Notes |
|---|---|---|---|---|---|
| Blueberries (Aronia berries/chokeberries (black, purple and red), Aronia berries/chokeberries (black, purple and red), Aronia berries/chokeberries (black, purple and red), Bearberries, Bilberries/European blueberries/whortleberries, Bog bilberries, European barberries, Golden currant/buffalo currant, Haskaps/blue honeysuckles, Huckleberries, Jostaberries, Juneberries, Myrtle berries, Native currant, Red bilberries/cowberries, Red bilberries/lingonberries, Salal/shallon berries, Sea buckthorns/sallow thorns, Serviceberries, Ugniberries/Chilean guavas, Worcesterberries, Other species and hybrids of genera Ribes and Vaccinium, not elsewhere mentioned,) | 0154010 | European Union | 3 | 27/04/2017 | |
| Cultivated fungi (Common mushrooms/button mushrooms/champignons mushrooms, Corn smuts/ Mexican truffles, Enokitake/winter mushrooms, Fusarium venenatum, Horse mushrooms, Jew's ears/hirneola, Nameko, Oyster mushrooms, Paddy straw mushroom, Pom-pom blancs/lion's mane mushrooms/monkeyhead mushrooms, Shiitake, Shimeji/bunashimeji/beach mushrooms, Snow mushrooms/white jelly mushrooms, Wood blewits/pied bleus, Other cultivated fungi, Other species of genus Pleurotus, not elsewhere mentioned,) | 0280010 | European Union | 0.02* | 27/04/2017 | |
| Citrus fruits | 0110000 | European Union | 0.02* | 27/04/2017 | |
| Grapefruits (Natsudaidais, Shaddocks/pomelos, Sweeties/oroblancos, Tangelolos, Tangelos (except minneolas)/Ugli®, Other hybrids of Citrus paradisi, not elsewhere mentioned,) | 0110010 | European Union | 0.02* | 27/04/2017 | |
| Oranges (Bergamots, Bitter oranges/sour oranges, Blood oranges, Cara caras, Chinottos, Trifoliate oranges, Other hybrids of Citrus sinensis, not elsewhere mentioned,) | 0110020 | European Union | 0.02* | 27/04/2017 | |
| Lemons (Buddha's hands/Buddha's fingers, Citrons,) | 0110030 | European Union | 0.02* | 27/04/2017 | |
| Limes (Indian sweet limes/Palestine sweet limes, Kaffir limes, Sweet limes/mosambis, Tahiti limes, Limequats,) | 0110040 | European Union | 0.02* | 27/04/2017 | |
| Mandarins (Calamondins, Clementines, Cleopatra mandarins, Minneolas, Satsumas/clausellinas, Tangerines/dancy mandarins, Tangors, Other hybrids of Citrus reticulata, not elsewhere mentioned,) | 0110050 | European Union | 0.02* | 27/04/2017 | |
| Others (2) | 0110990 | European Union | 0.02* | 27/04/2017 | |
| Tree nuts | 0120000 | European Union | 0.02* | 27/04/2017 | |
| Almonds (Apricot kernels, Bitter almonds, Canarium nuts/galip nuts, Pili nuts, Okari nuts,) | 0120010 | European Union | 0.02* | 27/04/2017 | |
| Brazil nuts | 0120020 | European Union | 0.02* | 27/04/2017 | |
| Cashew nuts | 0120030 | European Union | 0.02* | 27/04/2017 | |
| Chestnuts | 0120040 | European Union | 0.02* | 27/04/2017 | |
| Coconuts (Areca nuts/betel nuts,) | 0120050 | European Union | 0.02* | 27/04/2017 | |
| Hazelnuts/cobnuts (Acorns, Filberts,) | 0120060 | European Union | 0.02* | 27/04/2017 | |
| Macadamias | 0120070 | European Union | 0.02* | 27/04/2017 | |
| Pecans (Hickory nuts,) | 0120080 | European Union | 0.02* | 27/04/2017 | |
| Pistachios | 0120100 | European Union | 0.02* | 27/04/2017 | |
| Walnuts | 0120110 | European Union | 0.02* | 27/04/2017 |