Relevant Regulations and Standards
Ethalfluralin(F05062)
| Common Name | Ethalfluralin(F05062) |
| FRCD ID | F05062 |
| Formula | C13H14F3N3O4 |
| InChI Key | PTFJIKYUEPWBMS-UHFFFAOYSA-N |
| InChI | InChI=1S/C13H14F3N3O4/c1-4-17(7-8(2)3)12-10(18(20)21)5-9(13(14,15)16)6-11(12)19(22)23/h5-6H,2,4,7H2,1,3H3 |
| Canonical SMILES | CCN(CC(=C)C)C1=C(C=C(C=C1[N+](=O)[O-])C(F)(F)F)[N+](=O)[O-] |
| Isomeric SMILES | CCN(CC(=C)C)C1=C(C=C(C=C1[N+](=O)[O-])C(F)(F)F)[N+](=O)[O-] |
| Classifies | Pesticide |
| Update Date | Nov 13, 2018 17:07 |
MRLs
| Food | Product Code | Country | MRLs | Application Date | Notes |
|---|---|---|---|---|---|
| Loquats/Japanese medlars | 0130050 | European Union | 0.01* | 06/03/2014 | |
| Others (2) | 0130990 | European Union | 0.01* | 06/03/2014 | |
| Medlars | 0130040 | European Union | 0.01* | 06/03/2014 | |
| Stone fruits | 0140000 | European Union | 0.01* | 06/03/2014 | |
| Apricots (Japanese apricots/Umes, Nectacots,) | 0140010 | European Union | 0.01* | 06/03/2014 | |
| Others (2) | 0140990 | European Union | 0.01* | 06/03/2014 | |
| Berries and small fruits | 0150000 | European Union | 0.01* | 06/03/2014 | |
| (a) grapes | 0151000 | European Union | 0.01* | 06/03/2014 | |
| Table grapes (Kiwiberries/dwarf kiwi (2), Schisandra berries,) | 0151010 | European Union | 0.01* | 06/03/2014 | |
| Wine grapes (Amur river grapes, Muscadine grapes,) | 0151020 | European Union | 0.01* | 06/03/2014 | |
| (b) strawberries (Musky strawberries, Wild strawberries,) | 0152000 | European Union | 0.01* | 06/03/2014 | |
| (c) cane fruits | 0153000 | European Union | 0.01* | 06/03/2014 | |
| Blackberries | 0153010 | European Union | 0.01* | 06/03/2014 | |
| Dewberries (Boysenberries, Loganberries, Olallieberries, Salmonberries, Tayberries, Thimbleberries, Youngberries, Other species and hybrids of genus Rubus, not elsewhere mentioned,) | 0153020 | European Union | 0.01* | 06/03/2014 | |
| Raspberries (red and yellow) (Arctic brambles/arctic raspberries/nectar berries, Black raspberries, Korean black raspberries, Korean raspberries, Nectar raspberries, Wineberries/Japanese wineberries,) | 0153030 | European Union | 0.01* | 06/03/2014 | |
| Others (2) | 0153990 | European Union | 0.01* | 06/03/2014 | |
| (d) other small fruits and berries | 0154000 | European Union | 0.01* | 06/03/2014 | |
| Cranberries (Cloudberries, Crowberries, Crowberries, Crowberries, Crowberries, Muntries, Partridge berries, Small cranberries/European cranberries,) | 0154020 | European Union | 0.01* | 06/03/2014 | |
| Currants (black, red and white) | 0154030 | European Union | 0.01* | 06/03/2014 | |
| Gooseberries (green, red and yellow) | 0154040 | European Union | 0.01* | 06/03/2014 |