Relevant Regulations and Standards
Etoxazole(F05064)
| Common Name | Etoxazole(F05064) |
| FRCD ID | F05064 |
| Formula | C21H23F2NO2 |
| InChI Key | IXSZQYVWNJNRAL-UHFFFAOYSA-N |
| InChI | InChI=1S/C21H23F2NO2/c1-5-25-18-11-13(21(2,3)4)9-10-14(18)17-12-26-20(24-17)19-15(22)7-6-8-16(19)23/h6-11,17H,5,12H2,1-4H3 |
| Canonical SMILES | CCOC1=C(C=CC(=C1)C(C)(C)C)C2COC(=N2)C3=C(C=CC=C3F)F |
| Isomeric SMILES | CCOC1=C(C=CC(=C1)C(C)(C)C)C2COC(=N2)C3=C(C=CC=C3F)F |
| Classifies | Pesticide |
| Update Date | Nov 13, 2018 17:07 |
MRLs
| Food | Product Code | Country | MRLs | Application Date | Notes |
|---|---|---|---|---|---|
| Parsnips | 0213060 | European Union | 0.01* | 19/01/2017 | |
| Others (2) | 0163990 | European Union | 0.01* | 19/01/2017 | |
| Root and tuber vegetables | 0210000 | European Union | 0.01* | 19/01/2017 | |
| (a) potatoes (Andigena,) | 0211000 | European Union | 0.01* | 19/01/2017 | |
| (b) tropical root and tuber vegetables | 0212000 | European Union | 0.01* | 19/01/2017 | |
| Others (2) | 1016990 | European Union | 0.01* | 19/01/2017 | |
| Sweet potatoes | 0212020 | European Union | 0.01* | 19/01/2017 | |
| Yams (Amazonian yam beans/potato beans, American groundnuts tubers, Andean yam beans, Mexican yam beans,) | 0212030 | European Union | 0.01* | 19/01/2017 | |
| Arrowroots (Lotus roots, Chinese water chestnut,) | 0212040 | European Union | 0.01* | 19/01/2017 | |
| Others (2) | 0212990 | European Union | 0.01* | 19/01/2017 | |
| (c) other root and tuber vegetables except sugar beets | 0213000 | European Union | 0.01* | 19/01/2017 | |
| Beetroots | 0213010 | European Union | 0.01* | 19/01/2017 | |
| Carrots (Coloured carrots varieties, Baby carrots,) | 0213020 | European Union | 0.01* | 19/01/2017 | |
| Celeriacs/turnip rooted celeries | 0213030 | European Union | 0.01* | 19/01/2017 | |
| Jerusalem artichokes (Crosnes/Chinese artichokes, Mashua, Oca, Pale-leaf sunflower, Tuberous peas,) | 0213050 | European Union | 0.01* | 19/01/2017 | |
| Parsley roots/Hamburg roots parsley (Angelica roots, Burnet saxifrage roots, Lovage roots, Nettle roots, Other species of the genus Urtica, not elsewhere mentioned, Turnip-rooted chervils,) | 0213070 | European Union | 0.01* | 19/01/2017 | |
| Radishes (Black radishes/winter radishes/ 'Gros noir d'hiver', Daikon/japanese radishes, Maca roots, Small radishes, Tigernuts,) | 0213080 | European Union | 0.01* | 19/01/2017 | |
| Salsifies (Burdocks, Rampion roots, Scorzonera/black salsifies, Skirrets, Spanish salsifies,) | 0213090 | European Union | 0.01* | 19/01/2017 | |
| Swedes/rutabagas | 0213100 | European Union | 0.01* | 19/01/2017 | |
| Turnips (Tuberous-rooted mustards,) | 0213110 | European Union | 0.01* | 19/01/2017 |