Relevant Regulations and Standards
Flufenacet(F05072)
| Common Name | Flufenacet(F05072) |
| FRCD ID | F05072 |
| Formula | C14H13F4N3O2S |
| InChI Key | IANUJLZYFUDJIH-UHFFFAOYSA-N |
| InChI | InChI=1S/C14H13F4N3O2S/c1-8(2)21(10-5-3-9(15)4-6-10)11(22)7-23-13-20-19-12(24-13)14(16,17)18/h3-6,8H,7H2,1-2H3 |
| Canonical SMILES | CC(C)N(C1=CC=C(C=C1)F)C(=O)COC2=NN=C(S2)C(F)(F)F |
| Isomeric SMILES | CC(C)N(C1=CC=C(C=C1)F)C(=O)COC2=NN=C(S2)C(F)(F)F |
| Classifies | Pesticide |
| Update Date | Nov 13, 2018 17:07 |
MRLs
| Food | Product Code | Country | MRLs | Application Date | Notes |
|---|---|---|---|---|---|
| Rhubarbs | 0270070 | European Union | 0.05* | 13/05/2015 | |
| Palm hearts | 0270090 | European Union | 0.05* | 13/05/2015 | |
| Brussels sprouts (Flower sprouts,) | 0242010 | European Union | 0.05* | 13/05/2015 | |
| Others (2) | 0242990 | European Union | 0.05* | 13/05/2015 | |
| (c) leafy brassica | 0243000 | European Union | 0.05* | 13/05/2015 | |
| Chinese cabbages/pe-tsai (Chinese flat cabbages/tatsoi/tai goo choi, Indian mustards/mustard greens, Komatsuna/mustard spinaches, Mizuna (4), Pak-choi/paksoi, Turnip greens/turnip tops (5), Seakale,) | 0243010 | European Union | 0.05* | 13/05/2015 | |
| Others (2) | 0243990 | European Union | 0.05* | 13/05/2015 | |
| (d) kohlrabies | 0244000 | European Union | 0.05* | 13/05/2015 | |
| Leaf vegetables, herbs and edible flowers | 0250000 | European Union | 0.05* | 13/05/2015 | |
| (a) lettuces and salad plants | 0251000 | European Union | 0.05* | 13/05/2015 | |
| Lamb's lettuces/corn salads (Italian corn salads,) | 0251010 | European Union | 0.05* | 13/05/2015 | |
| Stem vegetables | 0270000 | European Union | 0.05* | 13/05/2015 | |
| Escaroles/broad-leaved endives (Curly endives/ frisée endives, Dandelions, Puntarelle, Radicchio/red-leaved chicories, Sugar loaf chicories, Wild chicories/common chicories,) | 0251030 | European Union | 0.05* | 13/05/2015 | |
| Land cresses | 0251050 | European Union | 0.05* | 13/05/2015 | |
| Roman rocket/rucola (Wall rocket,) | 0251060 | European Union | 0.05* | 13/05/2015 | |
| Red mustards | 0251070 | European Union | 0.05* | 13/05/2015 | |
| Baby leaf crops (including brassica species) (Chards/beet leaves, Escaroles/broad-leaved endives, Indian mustards/mustard greens, Lettuces, Spinaches, Other species harvested at baby leaf stage,) | 0251080 | European Union | 0.05* | 13/05/2015 | |
| Others (2) | 0251990 | European Union | 0.05* | 13/05/2015 | |
| (b) spinaches and similar leaves | 0252000 | European Union | 0.05* | 13/05/2015 | |
| Spinaches (Amaranths/Chinese spinaches/pak-khom, Amaranths/Chinese spinaches/pak-khom, Amaranths/Chinese spinaches/pak-khom, Amaranths/Chinese spinaches/pak-khom, Amaranths/Chinese spinaches/pak-khom, Bitterblad/bitawiri, Bitterleaves, Black eyed peas/cowpeas leaves, Cassava leaves, Garland chrysanthemums/tong ho, New Zealand spinaches, Oraches, Sweet potato leaves, Tannias/arrowleaf elephant ears/tajer leaves,) | 0252010 | European Union | 0.05* | 13/05/2015 |