Relevant Regulations and Standards
Flumioxazin(F05076)
| Common Name | Flumioxazin(F05076) |
| FRCD ID | F05076 |
| Formula | C19H15FN2O4 |
| InChI Key | FOUWCSDKDDHKQP-UHFFFAOYSA-N |
| InChI | InChI=1S/C19H15FN2O4/c1-2-7-21-15-9-14(13(20)8-16(15)26-10-17(21)23)22-18(24)11-5-3-4-6-12(11)19(22)25/h1,8-9H,3-7,10H2 |
| Canonical SMILES | C#CCN1C(=O)COC2=CC(=C(C=C21)N3C(=O)C4=C(C3=O)CCCC4)F |
| Isomeric SMILES | C#CCN1C(=O)COC2=CC(=C(C=C21)N3C(=O)C4=C(C3=O)CCCC4)F |
| Classifies | Pesticide |
| Update Date | Nov 13, 2018 17:07 |
MRLs
| Food | Product Code | Country | MRLs | Application Date | Notes |
|---|---|---|---|---|---|
| Cultivated fungi (Common mushrooms/button mushrooms/champignons mushrooms, Corn smuts/ Mexican truffles, Enokitake/winter mushrooms, Fusarium venenatum, Horse mushrooms, Jew's ears/hirneola, Nameko, Oyster mushrooms, Paddy straw mushroom, Pom-pom blancs/lion's mane mushrooms/monkeyhead mushrooms, Shiitake, Shimeji/bunashimeji/beach mushrooms, Snow mushrooms/white jelly mushrooms, Wood blewits/pied bleus, Other cultivated fungi, Other species of genus Pleurotus, not elsewhere mentioned,) | 0280010 | European Union | 0.02* | 13/05/2015 | |
| TEAS, COFFEE, HERBAL INFUSIONS, COCOA AND CAROBS | 0600000 | European Union | 0.1* | 13/05/2015 | |
| Rose (Almond, Bee balm, Bitter orange/sour orange, Black locust, Cat’s foot, Chrysanthemum, Cinnamon, Clary sage, Cornflower, Cowslip/primrose, Daisy, Dyer’s broom, Elder, Field poppy, Great mullein, Hawthorn, Heather, Hollyhock, Horse-chestnut, Larkspur, Lavender, Mallow, Meadow sweet, Mullein, Orange, Peony, Red clover, Sacred lotus, Safflower, Sandy everlasting, St. John's wort, Sunflower, Sweet olive/sweet osmanthus, Sweet violet, White deadnettle, Yarrow, Ylang-ylang,) | 0631030 | European Union | 0.1* | 13/05/2015 | |
| Seed spices | 0810000 | European Union | 0.1* | 13/05/2015 | |
| Cocoa beans (Kola nuts/Cola nuts, Cupuaçu,) | 0640000 | European Union | 0.1* | 13/05/2015 | |
| Celeries | 0270030 | European Union | 0.02* | 13/05/2015 | |
| Florence fennels | 0270040 | European Union | 0.02* | 13/05/2015 | |
| Globe artichokes (Banana flowers,) | 0270050 | European Union | 0.02* | 13/05/2015 | |
| Leeks (Kurrat/Egyptian leek,) | 0270060 | European Union | 0.02* | 13/05/2015 | |
| Rhubarbs | 0270070 | European Union | 0.02* | 13/05/2015 | |
| Bamboo shoots (European bamboo /Japanese knotweed,) | 0270080 | European Union | 0.02* | 13/05/2015 | |
| Palm hearts | 0270090 | European Union | 0.02* | 13/05/2015 | |
| Others (2) | 0270990 | European Union | 0.02* | 13/05/2015 | |
| Fungi, mosses and lichens | 0280000 | European Union | 0.02* | 13/05/2015 | |
| Wild fungi (Ceps/porcino mushrooms, Chanterelles, Hedgehog mushrooms, Horns of plenty/black trumpets, Morels, Périgord black truffles, Piemont white truffles, Saint George's mushrooms, Scotch bonnet mushrooms, Summer truffles, Other wild fungi, Other species of genus Tuber, not elsewhere mentioned,) | 0280020 | European Union | 0.02* | 13/05/2015 | |
| Mosses and lichens (Icelandic mosses, Other mosses and lichens,) | 0280990 | European Union | 0.02* | 13/05/2015 | |
| Algae and prokaryotes organisms (Carrageen mosses/Irish mosses, Kombu, Spirulina, Spirulina, Other algae, Other procaryotes organisms, Rockweed /knotted kelp,) | 0290000 | European Union | 0.02* | 13/05/2015 | |
| PULSES | 0300000 | European Union | 0.02* | 13/05/2015 | |
| Carobs/Saint John's breads (Jengkols/Luk neangs,) | 0650000 | European Union | 0.1* | 13/05/2015 | |
| HOPS | 0700000 | European Union | 0.1* | 13/05/2015 |