| Common Name | Isoxaflutole(F05093) |
| FRCD ID | F05093 |
| Formula | C15H12F3NO4S |
| InChI Key | OYIKARCXOQLFHF-UHFFFAOYSA-N |
| InChI | InChI=1S/C15H12F3NO4S/c1-24(21,22)12-6-9(15(16,17)18)4-5-10(12)13(20)11-7-19-23-14(11)8-2-3-8/h4-8H,2-3H2,1H3 |
| Canonical SMILES | CS(=O)(=O)C1=C(C=CC(=C1)C(F)(F)F)C(=O)C2=C(ON=C2)C3CC3 |
| Isomeric SMILES | CS(=O)(=O)C1=C(C=CC(=C1)C(F)(F)F)C(=O)C2=C(ON=C2)C3CC3 |
| Classifies | Pesticide |
| Update Date | Nov 13, 2018 17:07 |
| Food | Product Code | Country | MRLs | Application Date | Notes |
|---|---|---|---|---|---|
| Fruit spices | 0820000 | European Union | 0.1* | 24/06/2015 | |
| Allspice/pimento | 0820010 | European Union | 0.1* | 24/06/2015 | |
| (a) lettuces and salad plants | 0251000 | European Union | 0.02* | 24/06/2015 | |
| Lamb's lettuces/corn salads (Italian corn salads,) | 0251010 | European Union | 0.02* | 24/06/2015 | |
| Escaroles/broad-leaved endives (Curly endives/ frisée endives, Dandelions, Puntarelle, Radicchio/red-leaved chicories, Sugar loaf chicories, Wild chicories/common chicories,) | 0251030 | European Union | 0.02* | 24/06/2015 | |
| Florence fennels | 0270040 | European Union | 0.02* | 24/06/2015 | |
| Land cresses | 0251050 | European Union | 0.02* | 24/06/2015 | |
| Roman rocket/rucola (Wall rocket,) | 0251060 | European Union | 0.02* | 24/06/2015 | |
| Red mustards | 0251070 | European Union | 0.02* | 24/06/2015 | |
| Baby leaf crops (including brassica species) (Chards/beet leaves, Escaroles/broad-leaved endives, Indian mustards/mustard greens, Lettuces, Spinaches, Other species harvested at baby leaf stage,) | 0251080 | European Union | 0.02* | 24/06/2015 | |
| Others (2) | 0251990 | European Union | 0.02* | 24/06/2015 | |
| (b) spinaches and similar leaves | 0252000 | European Union | 0.02* | 24/06/2015 | |
| Spinaches (Amaranths/Chinese spinaches/pak-khom, Amaranths/Chinese spinaches/pak-khom, Amaranths/Chinese spinaches/pak-khom, Amaranths/Chinese spinaches/pak-khom, Amaranths/Chinese spinaches/pak-khom, Bitterblad/bitawiri, Bitterleaves, Black eyed peas/cowpeas leaves, Cassava leaves, Garland chrysanthemums/tong ho, New Zealand spinaches, Oraches, Sweet potato leaves, Tannias/arrowleaf elephant ears/tajer leaves,) | 0252010 | European Union | 0.02* | 24/06/2015 | |
| Purslanes (Agretti, Glassworts/samphires, Rock samphires, Sea asters, Sea lavenders, Winter purslanes/miner's lettuces, Karkallas/Hottentot figs/Iceplant leaves,) | 0252020 | European Union | 0.02* | 24/06/2015 | |
| Chards/beet leaves (Beetroot leaves, Swiss chards,) | 0252030 | European Union | 0.02* | 24/06/2015 | |
| Others (2) | 0252990 | European Union | 0.02* | 24/06/2015 | |
| (c) grape leaves and similar species (Climbing wattle/acacia shoots, Malabar nightshades,) | 0253000 | European Union | 0.02* | 24/06/2015 | |
| (d) watercresses (Morning glory/Chinese convolvolus/water convolvolus/kangkung, Water clovers, Water mimosas,) | 0254000 | European Union | 0.02* | 24/06/2015 | |
| (e) witloofs/Belgian endives (Dandelion leaves (forced),) | 0255000 | European Union | 0.02* | 24/06/2015 | |
| (f) herbs and edible flowers | 0256000 | European Union | 0.05* | 24/06/2015 |