Relevant Regulations and Standards
Malathion(F05095)
| Common Name | Malathion(F05095) |
| FRCD ID | F05095 |
| Formula | C10H19O6PS2 |
| InChI Key | JXSJBGJIGXNWCI-UHFFFAOYSA-N |
| InChI | InChI=1S/C10H19O6PS2/c1-5-15-9(11)7-8(10(12)16-6-2)19-17(18,13-3)14-4/h8H,5-7H2,1-4H3 |
| Canonical SMILES | CCOC(=O)CC(C(=O)OCC)SP(=S)(OC)OC |
| Isomeric SMILES | CCOC(=O)CC(C(=O)OCC)SP(=S)(OC)OC |
| Classifies | Pesticide |
| Update Date | Nov 13, 2018 17:07 |
MRLs
| Food | Product Code | Country | MRLs | Application Date | Notes |
|---|---|---|---|---|---|
| Pine nut kernels (Pine nut kernels from other species than Pinus pinea, Pine nut kernels from other species than Pinus pinea, Pine nut kernels from other species than Pinus pinea, Pine nut kernels from other species than Pinus pinea, Pine nut kernels from other species than Pinus pinea, Pine nut kernels from other species than Pinus pinea, Pine nut kernels from other species than Pinus pinea, Other species of genus Pinus, not elsewhere mentioned,) | 0120090 | European Union | 0.02* | 03/04/2015 | |
| Blueberries (Aronia berries/chokeberries (black, purple and red), Aronia berries/chokeberries (black, purple and red), Aronia berries/chokeberries (black, purple and red), Bearberries, Bilberries/European blueberries/whortleberries, Bog bilberries, European barberries, Golden currant/buffalo currant, Haskaps/blue honeysuckles, Huckleberries, Jostaberries, Juneberries, Myrtle berries, Native currant, Red bilberries/cowberries, Red bilberries/lingonberries, Salal/shallon berries, Sea buckthorns/sallow thorns, Serviceberries, Ugniberries/Chilean guavas, Worcesterberries, Other species and hybrids of genera Ribes and Vaccinium, not elsewhere mentioned,) | 0154010 | European Union | 0.02* | 03/04/2015 | |
| Jambuls/jambolans (Acerolas/Barbados cherries, Arbutus berries, Camu camus, Carandas, Coco plums, Grumichamas/Brazil cherries, Hog plums/yellow mombins, Java apples, Otaheite gooseberries, Sea grapes, Surinam cherries, Water apples, Water berries, Water pears,) | 0161070 | European Union | 0.02* | 03/04/2015 | |
| Date | Japan | $_oppm | |||
| Grapes | Canada | 8mg/kg | |||
| Fruits,Dried | Australia | 8mg/kg | |||
| Green Onions | Canada | 3mg/kg | |||
| Lettuces (Crisp lettuces/iceberg lettuces, Cutting lettuces, Head lettuces/cabbage lettuces, Romaines/cos lettuces/lollo bionda/lollo rosso,) | 0251020 | European Union | 0.5 | 03/04/2015 | |
| Escaroles/broad-leaved endives (Curly endives/ frisée endives, Dandelions, Puntarelle, Radicchio/red-leaved chicories, Sugar loaf chicories, Wild chicories/common chicories,) | 0251030 | European Union | 0.02* | 03/04/2015 | |
| Roman rocket/rucola (Wall rocket,) | 0251060 | European Union | 0.02* | 03/04/2015 | |
| Red mustards | 0251070 | European Union | 0.02* | 03/04/2015 | |
| Baby leaf crops (including brassica species) (Chards/beet leaves, Escaroles/broad-leaved endives, Indian mustards/mustard greens, Lettuces, Spinaches, Other species harvested at baby leaf stage,) | 0251080 | European Union | 0.02* | 03/04/2015 | |
| Others (2) | 0251990 | European Union | 0.02* | 03/04/2015 | |
| (b) spinaches and similar leaves | 0252000 | European Union | 0.02* | 03/04/2015 | |
| Spinaches (Amaranths/Chinese spinaches/pak-khom, Amaranths/Chinese spinaches/pak-khom, Amaranths/Chinese spinaches/pak-khom, Amaranths/Chinese spinaches/pak-khom, Amaranths/Chinese spinaches/pak-khom, Bitterblad/bitawiri, Bitterleaves, Black eyed peas/cowpeas leaves, Cassava leaves, Garland chrysanthemums/tong ho, New Zealand spinaches, Oraches, Sweet potato leaves, Tannias/arrowleaf elephant ears/tajer leaves,) | 0252010 | European Union | 0.02* | 03/04/2015 | |
| Purslanes (Agretti, Glassworts/samphires, Rock samphires, Sea asters, Sea lavenders, Winter purslanes/miner's lettuces, Karkallas/Hottentot figs/Iceplant leaves,) | 0252020 | European Union | 0.02* | 03/04/2015 | |
| Chards/beet leaves (Beetroot leaves, Swiss chards,) | 0252030 | European Union | 0.02* | 03/04/2015 | |
| Others (2) | 0252990 | European Union | 0.02* | 03/04/2015 | |
| (c) grape leaves and similar species (Climbing wattle/acacia shoots, Malabar nightshades,) | 0253000 | European Union | 0.02* | 03/04/2015 | |
| Sugar beet roots | 0900010 | European Union | 0.02* | 03/04/2015 |