| Common Name | Metsulfuron-Methyl(F05106) |
| FRCD ID | F05106 |
| Formula | C14H15N5O6S |
| InChI Key | RSMUVYRMZCOLBH-UHFFFAOYSA-N |
| InChI | InChI=1S/C14H15N5O6S/c1-8-15-12(18-14(16-8)25-3)17-13(21)19-26(22,23)10-7-5-4-6-9(10)11(20)24-2/h4-7H,1-3H3,(H2,15,16,17,18,19,21) |
| Canonical SMILES | CC1=NC(=NC(=N1)OC)NC(=O)NS(=O)(=O)C2=CC=CC=C2C(=O)OC |
| Isomeric SMILES | CC1=NC(=NC(=N1)OC)NC(=O)NS(=O)(=O)C2=CC=CC=C2C(=O)OC |
| Classifies | Pesticide |
| Update Date | Nov 13, 2018 17:07 |
| Food | Product Code | Country | MRLs | Application Date | Notes |
|---|---|---|---|---|---|
| Muscle | 1013010 | European Union | 0.01* | 02/01/2015 | |
| Others (2) | 1015990 | European Union | 0.01* | 02/01/2015 | |
| Muscle | 1016010 | European Union | 0.01* | 02/01/2015 | |
| Edible offals (other than liver and kidney) | 1015050 | European Union | 0.01* | 02/01/2015 | |
| FRUITS, FRESH or FROZEN; TREE NUTS | 0100000 | European Union | 0.01* | 02/01/2015 | |
| Citrus fruits | 0110000 | European Union | 0.01* | 02/01/2015 | |
| Grapefruits (Natsudaidais, Shaddocks/pomelos, Sweeties/oroblancos, Tangelolos, Tangelos (except minneolas)/Ugli®, Other hybrids of Citrus paradisi, not elsewhere mentioned,) | 0110010 | European Union | 0.01* | 02/01/2015 | |
| Oranges (Bergamots, Bitter oranges/sour oranges, Blood oranges, Cara caras, Chinottos, Trifoliate oranges, Other hybrids of Citrus sinensis, not elsewhere mentioned,) | 0110020 | European Union | 0.01* | 02/01/2015 | |
| Lemons (Buddha's hands/Buddha's fingers, Citrons,) | 0110030 | European Union | 0.01* | 02/01/2015 | |
| Limes (Indian sweet limes/Palestine sweet limes, Kaffir limes, Sweet limes/mosambis, Tahiti limes, Limequats,) | 0110040 | European Union | 0.01* | 02/01/2015 | |
| Mandarins (Calamondins, Clementines, Cleopatra mandarins, Minneolas, Satsumas/clausellinas, Tangerines/dancy mandarins, Tangors, Other hybrids of Citrus reticulata, not elsewhere mentioned,) | 0110050 | European Union | 0.01* | 02/01/2015 | |
| Others (2) | 0110990 | European Union | 0.01* | 02/01/2015 | |
| Muscle | 1015010 | European Union | 0.01* | 02/01/2015 | |
| Fat | 1015020 | European Union | 0.01* | 02/01/2015 | |
| Liver | 1015030 | European Union | 0.01* | 02/01/2015 | |
| Kidney | 1015040 | European Union | 0.01* | 02/01/2015 | |
| Fat | 1013020 | European Union | 0.01* | 02/01/2015 | |
| Liver | 1013030 | European Union | 0.01* | 02/01/2015 | |
| Kidney | 1013040 | European Union | 0.01* | 02/01/2015 | |
| Others (2) | 1013990 | European Union | 0.01* | 02/01/2015 |