Relevant Regulations and Standards
Pyraclostrobin(F05130)
| Common Name | Pyraclostrobin(F05130) |
| FRCD ID | F05130 |
| Formula | C19H18ClN3O4 |
| InChI Key | HZRSNVGNWUDEFX-UHFFFAOYSA-N |
| InChI | InChI=1S/C19H18ClN3O4/c1-25-19(24)23(26-2)17-6-4-3-5-14(17)13-27-18-11-12-22(21-18)16-9-7-15(20)8-10-16/h3-12H,13H2,1-2H3 |
| Canonical SMILES | COC(=O)N(C1=CC=CC=C1COC2=NN(C=C2)C3=CC=C(C=C3)Cl)OC |
| Isomeric SMILES | COC(=O)N(C1=CC=CC=C1COC2=NN(C=C2)C3=CC=C(C=C3)Cl)OC |
| Classifies | Pesticide |
| Update Date | Nov 13, 2018 17:07 |
MRLs
| Food | Product Code | Country | MRLs | Application Date | Notes |
|---|---|---|---|---|---|
| Other Terrestrial Mammals,Kidney | Japan | 0.05ppm | |||
| Oats | Britain | 0. 3mg/kg | |||
| Pig,Muscle | Japan | 0.1ppm | |||
| Milk & Dairy Produce | Britain | 0.01mg/kg | |||
| Meat, Fat & Preparations Of Meat | Britain | 0.05mg/kg | |||
| Other Cereals Do Not Include Rice | Britain | 0.02mg/kg | |||
| Rice | Britain | 0.02mg/kg | |||
| Millet | Britain | 0.02mg/kg | |||
| Buckwheat | Britain | 0.02mg/kg | |||
| Maize | Britain | 0.02mg/kg | |||
| Triticale | Britain | 0.1mg/kg | |||
| Sorghum | Britain | 0.02mg/kg | |||
| Barley | Britain | 0. 3mg/kg | |||
| Rye | Britain | 0.1mg/kg | |||
| Wheat | Britain | 0.02mg/kg | |||
| Hop | Britain | 10mg/kg | |||
| Tea | Britain | 0.05mg/kg | |||
| Ware Potatoes | Britain | 0.02mg/kg | |||
| Early Potatoes | Britain | 0.02mg/kg | |||
| Other Oilseeds | Britain | 0.02mg/kg |