Relevant Regulations and Standards
Spiroxamine(F05137)
| Common Name | Spiroxamine(F05137) |
| FRCD ID | F05137 |
| Formula | C18H35NO2 |
| InChI Key | PUYXTUJWRLOUCW-UHFFFAOYSA-N |
| InChI | InChI=1S/C18H35NO2/c1-6-12-19(7-2)13-16-14-20-18(21-16)10-8-15(9-11-18)17(3,4)5/h15-16H,6-14H2,1-5H3 |
| Canonical SMILES | CCCN(CC)CC1COC2(O1)CCC(CC2)C(C)(C)C |
| Isomeric SMILES | CCCN(CC)CC1COC2(O1)CCC(CC2)C(C)(C)C |
| Classifies | Pesticide |
| Update Date | Nov 13, 2018 17:07 |
MRLs
| Food | Product Code | Country | MRLs | Application Date | Notes |
|---|---|---|---|---|---|
| (a) flowering brassica | 0241000 | European Union | 0.01* | 19/10/2016 | |
| Chinese cabbages/pe-tsai (Chinese flat cabbages/tatsoi/tai goo choi, Indian mustards/mustard greens, Komatsuna/mustard spinaches, Mizuna (4), Pak-choi/paksoi, Turnip greens/turnip tops (5), Seakale,) | 0243010 | European Union | 0.01* | 19/10/2016 | |
| Cresses and other sprouts and shoots (Alfalfa/lucerne sprouts, Chinese chives/oriental garlic/garlic chives sprouts, Broccoli sprouts, Daikon/Japanese radish sprouts, Ginger shoots, Mung bean sprouts, Peas shoots and sprouts, Roman rocket/rucola sprouts, Soyabeans sprouts, Sunflower shoots and sprouts, Cereals grasses/cereals shoots, Other species used for the production of sprouts or shoots,) | 0251040 | European Union | 0.01* | 19/10/2016 | |
| Gold of pleasure seeds | 0401130 | European Union | 0.05* | 19/10/2016 | |
| Castor beans (Grape seeds, Sea buckthorn/sallow thorn seeds,) | 0401150 | European Union | 0.05* | 19/10/2016 | |
| Valerian (Blue flag, Calamus, Couch grass, Cowslip/primrose, Echinacea, Echinacea, Echinacea, Elecampane, Fragrant sumac, Golden root, Herb bennet, Marshmallow, Mexican valerian, Pimpernel, Rhatany, Sarsaparilla, Seneca snakeroot, Tormentil, Wild angelica,) | 0633010 | European Union | 0.05* | 19/10/2016 | |
| (d) any other parts of the plant (Blond psyllium (seeds, husks), Chamomile (seeds), Cherries (sweet) (stems), China/Jesuit's bark (bark), China/Jesuit's bark (bark), Cocoa (husks), Condurango (bark), Dwarf mountain pine (shoots), Fir (shoots), Fleawort (seeds), Fragrant sumac (bark), Guarana (seeds), Hibiscus (seeds), Horse-chestnut (seeds, bark), Juniper (bark, wood, shoots), Lapacho (bark), Lignum vitae (bark, wood), Parsley (fruits), Purging cassia (fruits), Quassia (bark, wood), Red sandalwood (bark, wood), Soap-bark tree (bark), Sour cherry/morello cherry (stems), Sweet corn (stigmas, styles), Wild angelica (fruits), Witch hazel (bark), Other herbal infusions from any other parts of the plant,) | 0639000 | European Union | 0.05* | 19/10/2016 | |
| Liver | 1015030 | European Union | 0.3 | 19/10/2016 | |
| Kidney | 1015040 | European Union | 0.15 | 19/10/2016 | |
| Citrus fruits | 0110000 | European Union | 0.01* | 19/10/2016 | |
| Grapefruits (Natsudaidais, Shaddocks/pomelos, Sweeties/oroblancos, Tangelolos, Tangelos (except minneolas)/Ugli®, Other hybrids of Citrus paradisi, not elsewhere mentioned,) | 0110010 | European Union | 0.01* | 19/10/2016 | |
| Oranges (Bergamots, Bitter oranges/sour oranges, Blood oranges, Cara caras, Chinottos, Trifoliate oranges, Other hybrids of Citrus sinensis, not elsewhere mentioned,) | 0110020 | European Union | 0.01* | 19/10/2016 | |
| Lemons (Buddha's hands/Buddha's fingers, Citrons,) | 0110030 | European Union | 0.01* | 19/10/2016 | |
| Limes (Indian sweet limes/Palestine sweet limes, Kaffir limes, Sweet limes/mosambis, Tahiti limes, Limequats,) | 0110040 | European Union | 0.01* | 19/10/2016 | |
| Mandarins (Calamondins, Clementines, Cleopatra mandarins, Minneolas, Satsumas/clausellinas, Tangerines/dancy mandarins, Tangors, Other hybrids of Citrus reticulata, not elsewhere mentioned,) | 0110050 | European Union | 0.01* | 19/10/2016 | |
| Others (2) | 0110990 | European Union | 0.01* | 19/10/2016 | |
| Tree nuts | 0120000 | European Union | 0.05* | 19/10/2016 | |
| Almonds (Apricot kernels, Bitter almonds, Canarium nuts/galip nuts, Pili nuts, Okari nuts,) | 0120010 | European Union | 0.05* | 19/10/2016 | |
| Brazil nuts | 0120020 | European Union | 0.05* | 19/10/2016 | |
| Cashew nuts | 0120030 | European Union | 0.05* | 19/10/2016 |