Relevant Regulations and Standards
Tetraconazole(F05143)
| Common Name | Tetraconazole(F05143) |
| FRCD ID | F05143 |
| Formula | C13H11Cl2F4N3O |
| InChI Key | LQDARGUHUSPFNL-UHFFFAOYSA-N |
| InChI | InChI=1S/C13H11Cl2F4N3O/c14-9-1-2-10(11(15)3-9)8(4-22-7-20-6-21-22)5-23-13(18,19)12(16)17/h1-3,6-8,12H,4-5H2 |
| Canonical SMILES | C1=CC(=C(C=C1Cl)Cl)C(CN2C=NC=N2)COC(C(F)F)(F)F |
| Isomeric SMILES | C1=CC(=C(C=C1Cl)Cl)C(CN2C=NC=N2)COC(C(F)F)(F)F |
| Classifies | Pesticide |
| Update Date | Nov 13, 2018 17:07 |
MRLs
| Food | Product Code | Country | MRLs | Application Date | Notes |
|---|---|---|---|---|---|
| Cranberry | Japan | 2ppm | |||
| Blueberry | Japan | 2ppm | |||
| Beans (with pods) (Azuki beans, Black eyed peas/cowpeas, Broad beans/fava beans/horse beans/tic beans, Borlotti beans/cannelini beans/common beans/flageolets/French beans/slicing beans/snap beans, Ervils/lentil vetches, Guar beans, Jack beans, Lablab beans/hyacinth beans, Lima beans/butter beans, Monantha vetches, Mung beans, Rice beans, Runner beans/scarlet runner beans, Soyabeans/edamame, Stink beans, Vetches, Yardlong beans,) | 0260010 | European Union | 0.02* | 27/01/2013 | |
| Citrus fruits | 0110000 | European Union | 0.02* | 27/01/2013 | |
| Grapefruits (Natsudaidais, Shaddocks/pomelos, Sweeties/oroblancos, Tangelolos, Tangelos (except minneolas)/Ugli®, Other hybrids of Citrus paradisi, not elsewhere mentioned,) | 0110010 | European Union | 0.02* | 27/01/2013 | |
| Oranges (Bergamots, Bitter oranges/sour oranges, Blood oranges, Cara caras, Chinottos, Trifoliate oranges, Other hybrids of Citrus sinensis, not elsewhere mentioned,) | 0110020 | European Union | 0.02* | 27/01/2013 | |
| Lemons (Buddha's hands/Buddha's fingers, Citrons,) | 0110030 | European Union | 0.02* | 27/01/2013 | |
| Limes (Indian sweet limes/Palestine sweet limes, Kaffir limes, Sweet limes/mosambis, Tahiti limes, Limequats,) | 0110040 | European Union | 0.02* | 27/01/2013 | |
| Mandarins (Calamondins, Clementines, Cleopatra mandarins, Minneolas, Satsumas/clausellinas, Tangerines/dancy mandarins, Tangors, Other hybrids of Citrus reticulata, not elsewhere mentioned,) | 0110050 | European Union | 0.02* | 27/01/2013 | |
| Others (2) | 0110990 | European Union | 0.02* | 27/01/2013 | |
| Tree nuts | 0120000 | European Union | 0.02* | 27/01/2013 | |
| Almonds (Apricot kernels, Bitter almonds, Canarium nuts/galip nuts, Pili nuts, Okari nuts,) | 0120010 | European Union | 0.02* | 27/01/2013 | |
| Brazil nuts | 0120020 | European Union | 0.02* | 27/01/2013 | |
| Cashew nuts | 0120030 | European Union | 0.02* | 27/01/2013 | |
| Chestnuts | 0120040 | European Union | 0.02* | 27/01/2013 | |
| Coconuts (Areca nuts/betel nuts,) | 0120050 | European Union | 0.02* | 27/01/2013 | |
| Hazelnuts/cobnuts (Acorns, Filberts,) | 0120060 | European Union | 0.02* | 27/01/2013 | |
| Macadamias | 0120070 | European Union | 0.02* | 27/01/2013 | |
| Pecans (Hickory nuts,) | 0120080 | European Union | 0.02* | 27/01/2013 | |
| Sichuan pepper (Japanese pepper, Uzazi,) | 0820020 | European Union | 0.02* | 27/01/2013 |