Relevant Regulations and Standards
Cyproconazole(F05403)
| Common Name | Cyproconazole(F05403) |
| FRCD ID | F05403 |
| Formula | C15H18ClN3O |
| InChI Key | UFNOUKDBUJZYDE-UHFFFAOYSA-N |
| InChI | InChI=1S/C15H18ClN3O/c1-11(12-2-3-12)15(20,8-19-10-17-9-18-19)13-4-6-14(16)7-5-13/h4-7,9-12,20H,2-3,8H2,1H3 |
| Canonical SMILES | CC(C1CC1)C(CN2C=NC=N2)(C3=CC=C(C=C3)Cl)O |
| Isomeric SMILES | CC(C1CC1)C(CN2C=NC=N2)(C3=CC=C(C=C3)Cl)O |
| Classifies | Pesticide |
| Update Date | Nov 13, 2018 17:07 |
MRLs
| Food | Product Code | Country | MRLs | Application Date | Notes |
|---|---|---|---|---|---|
| Wild terrestrial vertebrate animals (Feathered wild game, Furred wild game, Kangaroos,) | 1070000 | European Union | 0.05* | 06/02/2018 | |
| Peas | Japan | 0.05ppm | |||
| Terrestrial invertebrate animals (Earthworms, Insects, Snails, Other terrestrial invertebrate animals, Other edible snails not belonging to the genus Helix,) | 1060000 | European Union | 0.05* | 06/02/2018 | |
| Other Poultry,Eggs | Japan | 0.01ppm | |||
| Chicken,Eggs | Japan | 0.01ppm | |||
| Other Poultry Animals,Edible Offal | Japan | 0.01ppm | |||
| Chicken,Edible Offal | Japan | 0.01ppm | |||
| Other Poultry Animals,Kidney | Japan | 0.01ppm | |||
| Chicken,Kidney | Japan | 0.01ppm | |||
| Other Poultry Animals,Liver | Japan | 0.01ppm | |||
| Chicken,Liver | Japan | 0.01ppm | |||
| Other Poultry Animals,Fat | Japan | 0.01ppm | |||
| Chicken,Fat | Japan | 0.01ppm | |||
| Other Poultry Animals,Muscle | Japan | 0.01ppm | |||
| Chicken,Muscle | Japan | 0.01ppm | |||
| Milk | Japan | 0.01ppm | |||
| Pig,Edible Offal | Japan | 1ppm | |||
| Cattle,Edible Offal | Japan | 1ppm | |||
| Other Terrestrial Mammals,Kidney | Japan | 1ppm | |||
| Pig,Kidney | Japan | 1ppm |