Relevant Regulations and Standards
Fludioxonil(F05418)
| Common Name | Fludioxonil(F05418) |
| FRCD ID | F05418 |
| Formula | C12H6F2N2O2 |
| InChI Key | MUJOIMFVNIBMKC-UHFFFAOYSA-N |
| InChI | InChI=1S/C12H6F2N2O2/c13-12(14)17-10-3-1-2-8(11(10)18-12)9-6-16-5-7(9)4-15/h1-3,5-6,16H |
| Canonical SMILES | C1=CC(=C2C(=C1)OC(O2)(F)F)C3=CNC=C3C#N |
| Isomeric SMILES | C1=CC(=C2C(=C1)OC(O2)(F)F)C3=CNC=C3C#N |
| Classifies | Pesticide |
| Update Date | Nov 13, 2018 17:07 |
MRLs
| Food | Product Code | Country | MRLs | Application Date | Notes |
|---|---|---|---|---|---|
| Pine nut kernels (Pine nut kernels from other species than Pinus pinea, Pine nut kernels from other species than Pinus pinea, Pine nut kernels from other species than Pinus pinea, Pine nut kernels from other species than Pinus pinea, Pine nut kernels from other species than Pinus pinea, Pine nut kernels from other species than Pinus pinea, Pine nut kernels from other species than Pinus pinea, Other species of genus Pinus, not elsewhere mentioned,) | 0120090 | European Union | 0.01* | 24/11/2016 | |
| Others (2) | 0140990 | European Union | 0.01* | 24/11/2016 | |
| Dewberries (Boysenberries, Loganberries, Olallieberries, Salmonberries, Tayberries, Thimbleberries, Youngberries, Other species and hybrids of genus Rubus, not elsewhere mentioned,) | 0153020 | European Union | 5 | 24/11/2016 | |
| Blueberries (Aronia berries/chokeberries (black, purple and red), Aronia berries/chokeberries (black, purple and red), Aronia berries/chokeberries (black, purple and red), Bearberries, Bilberries/European blueberries/whortleberries, Bog bilberries, European barberries, Golden currant/buffalo currant, Haskaps/blue honeysuckles, Huckleberries, Jostaberries, Juneberries, Myrtle berries, Native currant, Red bilberries/cowberries, Red bilberries/lingonberries, Salal/shallon berries, Sea buckthorns/sallow thorns, Serviceberries, Ugniberries/Chilean guavas, Worcesterberries, Other species and hybrids of genera Ribes and Vaccinium, not elsewhere mentioned,) | 0154010 | European Union | 2 | 24/11/2016 | |
| Cassava roots/manioc (Blue taros/blue tannias, Canna, Chayotes/christophines roots, Dasheen taros, Eddoe taros, Konjac roots, Tannias/arrowleaf elephant ears/tajer,) | 0212010 | European Union | 0.01* | 24/11/2016 | |
| Horseradishes (Dandelion roots, Gentiana roots, East Indian galangal/aromatic ginger/sand galangal, Fingerroot, Galangal roots, Galangal roots, Galangal roots, Galangal roots, Ginger roots, Greater galangal, Lesser galangal/smaller galangal, Orris roots, Orris roots, Wasabi roots,) | 0213040 | European Union | 1 | 24/11/2016 | |
| Lettuces (Crisp lettuces/iceberg lettuces, Cutting lettuces, Head lettuces/cabbage lettuces, Romaines/cos lettuces/lollo bionda/lollo rosso,) | 0251020 | European Union | 40 | 24/11/2016 | |
| Cresses and other sprouts and shoots (Alfalfa/lucerne sprouts, Chinese chives/oriental garlic/garlic chives sprouts, Broccoli sprouts, Daikon/Japanese radish sprouts, Ginger shoots, Mung bean sprouts, Peas shoots and sprouts, Roman rocket/rucola sprouts, Soyabeans sprouts, Sunflower shoots and sprouts, Cereals grasses/cereals shoots, Other species used for the production of sprouts or shoots,) | 0251040 | European Union | 20 | 24/11/2016 | |
| Celeries | 0270030 | European Union | 1.5 | 24/11/2016 | |
| Cultivated fungi (Common mushrooms/button mushrooms/champignons mushrooms, Corn smuts/ Mexican truffles, Enokitake/winter mushrooms, Fusarium venenatum, Horse mushrooms, Jew's ears/hirneola, Nameko, Oyster mushrooms, Paddy straw mushroom, Pom-pom blancs/lion's mane mushrooms/monkeyhead mushrooms, Shiitake, Shimeji/bunashimeji/beach mushrooms, Snow mushrooms/white jelly mushrooms, Wood blewits/pied bleus, Other cultivated fungi, Other species of genus Pleurotus, not elsewhere mentioned,) | 0280010 | European Union | 0.01* | 24/11/2016 | |
| Coffee beans | 0620000 | European Union | 0.05* | 24/11/2016 | |
| Rose (Almond, Bee balm, Bitter orange/sour orange, Black locust, Cat’s foot, Chrysanthemum, Cinnamon, Clary sage, Cornflower, Cowslip/primrose, Daisy, Dyer’s broom, Elder, Field poppy, Great mullein, Hawthorn, Heather, Hollyhock, Horse-chestnut, Larkspur, Lavender, Mallow, Meadow sweet, Mullein, Orange, Peony, Red clover, Sacred lotus, Safflower, Sandy everlasting, St. John's wort, Sunflower, Sweet olive/sweet osmanthus, Sweet violet, White deadnettle, Yarrow, Ylang-ylang,) | 0631030 | European Union | 0.05* | 24/11/2016 | |
| Brazil nuts | 0120020 | European Union | 0.01* | 24/11/2016 | |
| Cashew nuts | 0120030 | European Union | 0.01* | 24/11/2016 | |
| Chestnuts | 0120040 | European Union | 0.01* | 24/11/2016 | |
| Coconuts (Areca nuts/betel nuts,) | 0120050 | European Union | 0.01* | 24/11/2016 | |
| Hazelnuts/cobnuts (Acorns, Filberts,) | 0120060 | European Union | 0.01* | 24/11/2016 | |
| Macadamias | 0120070 | European Union | 0.01* | 24/11/2016 | |
| Pecans (Hickory nuts,) | 0120080 | European Union | 0.01* | 24/11/2016 | |
| Pistachios | 0120100 | European Union | 0.2 | 24/11/2016 |