Relevant Regulations and Standards
Novaluron(F05428)
| Common Name | Novaluron(F05428) |
| FRCD ID | F05428 |
| Formula | C17H9ClF8N2O4 |
| InChI Key | NJPPVKZQTLUDBO-UHFFFAOYSA-N |
| InChI | InChI=1S/C17H9ClF8N2O4/c18-8-6-7(4-5-11(8)31-16(22,23)14(21)32-17(24,25)26)27-15(30)28-13(29)12-9(19)2-1-3-10(12)20/h1-6,14H,(H2,27,28,29,30) |
| Canonical SMILES | C1=CC(=C(C(=C1)F)C(=O)NC(=O)NC2=CC(=C(C=C2)OC(C(OC(F)(F)F)F)(F)F)Cl)F |
| Isomeric SMILES | C1=CC(=C(C(=C1)F)C(=O)NC(=O)NC2=CC(=C(C=C2)OC(C(OC(F)(F)F)F)(F)F)Cl)F |
| Classifies | Pesticide |
| Update Date | Nov 13, 2018 17:07 |
MRLs
| Food | Product Code | Country | MRLs | Application Date | Notes |
|---|---|---|---|---|---|
| Quinces (Chinese quinces, Japanese quinces,) | 0130030 | European Union | 0.01* | 14/06/2012 | |
| Cherries (sweet) (Black cherries, Capulins, Chokecherries, Cornelian cherries/European corniols, Nanking cherries, Sour cherries/morello cherries,) | 0140020 | European Union | 7 | 14/06/2012 | |
| Avocados (Avocados for oil production,) | 0163010 | European Union | 0.01* | 14/06/2012 | |
| Others (2) | 0233990 | European Union | 0.2 | 14/06/2012 | |
| (e) other fruiting vegetables | 0239000 | European Union | 0.01* | 14/06/2012 | |
| Tarragon (Aztec sweet herb, Epazote/Mexican tea/wormseed, Hyssop, Lemongrass, Mexican oregano, Nettle, Other species of the genus Urtica, not elsewhere mentioned, Russian tarragon, Stevia,) | 0256100 | European Union | 0.01* | 14/06/2012 | |
| Beans (with pods) (Azuki beans, Black eyed peas/cowpeas, Broad beans/fava beans/horse beans/tic beans, Borlotti beans/cannelini beans/common beans/flageolets/French beans/slicing beans/snap beans, Ervils/lentil vetches, Guar beans, Jack beans, Lablab beans/hyacinth beans, Lima beans/butter beans, Monantha vetches, Mung beans, Rice beans, Runner beans/scarlet runner beans, Soyabeans/edamame, Stink beans, Vetches, Yardlong beans,) | 0260010 | European Union | 0.7 | 14/06/2012 | |
| Olives for oil production | 0402010 | European Union | 0.01* | 14/06/2012 | |
| Oil palms kernels (Argan nuts, Babassu palm nuts, Jojoba nuts, Shea nuts,) | 0402020 | European Union | 0.01* | 14/06/2012 | |
| Black caraway/black cumin (Nigella,) | 0810020 | European Union | 0.01* | 14/06/2012 | |
| Nutmeg (Annatto, Candlenut, Wattleseeds, Calabash nutmeg,) | 0810090 | European Union | 0.01* | 14/06/2012 | |
| Kidney | 1016040 | European Union | 0.1 | 14/06/2012 | |
| Others (2) (Bactrian camel, Dromedary, Elk/moose, Reindeer, Other milk producer animals,) | 1020990 | European Union | 0.4 | 14/06/2012 | |
| Mayhaws | Canada | 2mg/kg | |||
| Citrus fruits | 0110000 | European Union | 0.01* | 14/06/2012 | |
| Grapefruits (Natsudaidais, Shaddocks/pomelos, Sweeties/oroblancos, Tangelolos, Tangelos (except minneolas)/Ugli®, Other hybrids of Citrus paradisi, not elsewhere mentioned,) | 0110010 | European Union | 0.01* | 14/06/2012 | |
| Oranges (Bergamots, Bitter oranges/sour oranges, Blood oranges, Cara caras, Chinottos, Trifoliate oranges, Other hybrids of Citrus sinensis, not elsewhere mentioned,) | 0110020 | European Union | 0.01* | 14/06/2012 | |
| Lemons (Buddha's hands/Buddha's fingers, Citrons,) | 0110030 | European Union | 0.01* | 14/06/2012 | |
| Limes (Indian sweet limes/Palestine sweet limes, Kaffir limes, Sweet limes/mosambis, Tahiti limes, Limequats,) | 0110040 | European Union | 0.01* | 14/06/2012 | |
| Mandarins (Calamondins, Clementines, Cleopatra mandarins, Minneolas, Satsumas/clausellinas, Tangerines/dancy mandarins, Tangors, Other hybrids of Citrus reticulata, not elsewhere mentioned,) | 0110050 | European Union | 0.01* | 14/06/2012 |