| Common Name | Profenofos(F05434) |
| FRCD ID | F05434 |
| Formula | C11H15BrClO3PS |
| InChI Key | QYMMJNLHFKGANY-UHFFFAOYSA-N |
| InChI | InChI=1S/C11H15BrClO3PS/c1-3-7-18-17(14,15-4-2)16-11-6-5-9(12)8-10(11)13/h5-6,8H,3-4,7H2,1-2H3 |
| Canonical SMILES | CCCSP(=O)(OCC)OC1=C(C=C(C=C1)Br)Cl |
| Isomeric SMILES | CCCSP(=O)(OCC)OC1=C(C=C(C=C1)Br)Cl |
| Classifies | Pesticide |
| Update Date | Nov 13, 2018 17:07 |
| Food | Product Code | Country | MRLs | Application Date | Notes |
|---|---|---|---|---|---|
| Komatsuna(Japanese Mustard Spinach) | Japan | 0.05ppm | |||
| Cherries (sweet) (Black cherries, Capulins, Chokecherries, Cornelian cherries/European corniols, Nanking cherries, Sour cherries/morello cherries,) | 0140020 | European Union | 0.01* | 04/01/2018 | |
| Others (2) (Birches (trunk sap), Manna ashes (trunk sap), Maples (trunk sap), Palms (trunk sap), Palms (trunk sap), Other sugar plants,) | 0900990 | European Union | 0.01* | 04/01/2018 | |
| (g) other farmed terrestrial animals (Alpaca, Bactrian camel, Capybara, Cottontail/American rabbit, Dromedary, Eland, Elk/moose, Emu, Fallow deer, Guinea pig, Hare (farmed), Llama, Nandu/greater rhea, Ostrich, Peccari (collared), Rabbit, Red deer, Reindeer, Roe deer, Other farmed terrestrial animals,) | 1017000 | European Union | 0.05 | 04/01/2018 | |
| Other Poultry Animals,Muscle | Japan | 0.05ppm | |||
| Other Terrestrial Mammals,Fat | Japan | 0.05ppm | |||
| Broccoli | Japan | 0.05ppm | |||
| Other Cereal Grains | Japan | 0.05ppm | |||
| Papaya | Japan | 0.05ppm | |||
| Kiwifruit | Japan | 0.05ppm | |||
| Banana | Japan | 0.05ppm | |||
| Potato | CAC | 0.05mg/kg | |||
| Cotton Seed | CAC | 2mg/kg | |||
| Citrus fruits | 0110000 | European Union | 0.01* | 04/01/2018 | |
| Grapefruits (Natsudaidais, Shaddocks/pomelos, Sweeties/oroblancos, Tangelolos, Tangelos (except minneolas)/Ugli®, Other hybrids of Citrus paradisi, not elsewhere mentioned,) | 0110010 | European Union | 0.01* | 04/01/2018 | |
| Oranges (Bergamots, Bitter oranges/sour oranges, Blood oranges, Cara caras, Chinottos, Trifoliate oranges, Other hybrids of Citrus sinensis, not elsewhere mentioned,) | 0110020 | European Union | 0.01* | 04/01/2018 | |
| Lemons (Buddha's hands/Buddha's fingers, Citrons,) | 0110030 | European Union | 0.01* | 04/01/2018 | |
| Limes (Indian sweet limes/Palestine sweet limes, Kaffir limes, Sweet limes/mosambis, Tahiti limes, Limequats,) | 0110040 | European Union | 0.01* | 04/01/2018 | |
| Mandarins (Calamondins, Clementines, Cleopatra mandarins, Minneolas, Satsumas/clausellinas, Tangerines/dancy mandarins, Tangors, Other hybrids of Citrus reticulata, not elsewhere mentioned,) | 0110050 | European Union | 0.01* | 04/01/2018 | |
| Others (2) | 0110990 | European Union | 0.01* | 04/01/2018 |