Relevant Regulations and Standards
Isoproturon(F05649)
| Common Name | Isoproturon(F05649) |
| FRCD ID | F05649 |
| Formula | C12H18N2O |
| InChI Key | PUIYMUZLKQOUOZ-UHFFFAOYSA-N |
| InChI | InChI=1S/C12H18N2O/c1-9(2)10-5-7-11(8-6-10)13-12(15)14(3)4/h5-9H,1-4H3,(H,13,15) |
| Canonical SMILES | CC(C)C1=CC=C(C=C1)NC(=O)N(C)C |
| Isomeric SMILES | CC(C)C1=CC=C(C=C1)NC(=O)N(C)C |
| Classifies | Pesticide |
| Update Date | Nov 13, 2018 17:07 |
MRLs
| Food | Product Code | Country | MRLs | Application Date | Notes |
|---|---|---|---|---|---|
| Lentils | Britain | 0.05mg/kg | |||
| Other Miscellaneous Fruit | Britain | 0.05mg/kg | |||
| Other Cane Fruit (Other Than Wild) | Britain | 0.05mg/kg | |||
| Celery leaves (Angelica (leaves and stems), Burnet, Caraway leaves, Coriander leaves, Culantro/false coriander leaves, Dill leaves, Fennel leaves, Fenugreek leaves, Herb of grace/rue, Lovage leaves, Pimpernel/greater burnet-saxifrage, Salad burnet/lady's mantle, Sorrel/dock, Sorrel/dock, Sorrel/dock, Sorrel/dock, Sweet cicely,) | 0256030 | European Union | 0.02* | 25/08/2014 | |
| Basil and edible flowers (Apple mint, Asiatic pennywort, Bergamot mint/eau-de-Cologne mint, Corsican mint, Courgette (edible flowers), Gingermint, Greek bush basil, Hoary basil, Holy basil/tulsi, Lemon balm, Lemon basil, Lesser calamint, Lizard tail/dap ca, Marigold (edible flowers), Marigold (edible flowers), Other species of the genus Tagetes, not elsewhere mentioned, Nasturtium (leaves and edible flowers), Nasturtium (leaves and edible flowers), Pennyroyal, Peppermint, Pot marigold (edible flowers), Rice paddy herb/phak ka yaeng, Spearmint, Thai basil, Vietnamese mint, Water mint, Other edible flowers, Other species and hybrids of genus Mentha, not elsewhere mentioned,) | 0256080 | European Union | 0.02* | 25/08/2014 | |
| SUGAR PLANTS | 0900000 | European Union | 0.01* | 25/08/2014 | |
| FRUITS, FRESH or FROZEN; TREE NUTS | 0100000 | European Union | 0.01* | 25/08/2014 | |
| Citrus fruits | 0110000 | European Union | 0.01* | 25/08/2014 | |
| Grapefruits (Natsudaidais, Shaddocks/pomelos, Sweeties/oroblancos, Tangelolos, Tangelos (except minneolas)/Ugli®, Other hybrids of Citrus paradisi, not elsewhere mentioned,) | 0110010 | European Union | 0.01* | 25/08/2014 | |
| Oranges (Bergamots, Bitter oranges/sour oranges, Blood oranges, Cara caras, Chinottos, Trifoliate oranges, Other hybrids of Citrus sinensis, not elsewhere mentioned,) | 0110020 | European Union | 0.01* | 25/08/2014 | |
| Lemons (Buddha's hands/Buddha's fingers, Citrons,) | 0110030 | European Union | 0.01* | 25/08/2014 | |
| Limes (Indian sweet limes/Palestine sweet limes, Kaffir limes, Sweet limes/mosambis, Tahiti limes, Limequats,) | 0110040 | European Union | 0.01* | 25/08/2014 | |
| Mandarins (Calamondins, Clementines, Cleopatra mandarins, Minneolas, Satsumas/clausellinas, Tangerines/dancy mandarins, Tangors, Other hybrids of Citrus reticulata, not elsewhere mentioned,) | 0110050 | European Union | 0.01* | 25/08/2014 | |
| Others (2) | 0110990 | European Union | 0.01* | 25/08/2014 | |
| Brazil nuts | 0120020 | European Union | 0.01* | 25/08/2014 | |
| Cashew nuts | 0120030 | European Union | 0.01* | 25/08/2014 | |
| Chestnuts | 0120040 | European Union | 0.01* | 25/08/2014 | |
| Coconuts (Areca nuts/betel nuts,) | 0120050 | European Union | 0.01* | 25/08/2014 | |
| Hazelnuts/cobnuts (Acorns, Filberts,) | 0120060 | European Union | 0.01* | 25/08/2014 | |
| Macadamias | 0120070 | European Union | 0.01* | 25/08/2014 |