| Common Name | Tricyclazole(F05665) |
| FRCD ID | F05665 |
| Formula | C9H7N3S |
| InChI Key | DQJCHOQLCLEDLL-UHFFFAOYSA-N |
| InChI | InChI=1S/C9H7N3S/c1-6-3-2-4-7-8(6)12-5-10-11-9(12)13-7/h2-5H,1H3 |
| Canonical SMILES | CC1=C2C(=CC=C1)SC3=NN=CN23 |
| Isomeric SMILES | CC1=C2C(=CC=C1)SC3=NN=CN23 |
| Classifies | Pesticide |
| Update Date | Nov 13, 2018 17:07 |
| Food | Product Code | Country | MRLs | Application Date | Notes |
|---|---|---|---|---|---|
| Stem vegetables | 0270000 | European Union | 0.01* | 30/06/2017 | |
| Shallots (French grey shallots, Persian shallots,) | 0220030 | European Union | 0.01* | 30/06/2017 | |
| Spring onions/green onions and Welsh onions (Tree onions/Egyptian walking onions, Green garlic,) | 0220040 | European Union | 0.01* | 30/06/2017 | |
| Others (2) | 0220990 | European Union | 0.01* | 30/06/2017 | |
| Fruiting vegetables | 0230000 | European Union | 0.01* | 30/06/2017 | |
| (a) Solanaceae and Malvaceae | 0231000 | European Union | 0.01* | 30/06/2017 | |
| Sweet peppers/bell peppers (Chili peppers,) | 0231020 | European Union | 0.01* | 30/06/2017 | |
| Aubergines/eggplants (Antroewas/African eggplants/gboma, Ethiopian eggplants/gilo', Pepinos, Thorn apples, Turkey berries/devil's figs/pea eggplants/pea aubergines, Kangaroo apples/poroporo,) | 0231030 | European Union | 0.01* | 30/06/2017 | |
| Okra/lady's fingers | 0231040 | European Union | 0.01* | 30/06/2017 | |
| Others (2) | 0231990 | European Union | 0.01* | 30/06/2017 | |
| (b) cucurbits with edible peel | 0232000 | European Union | 0.01* | 30/06/2017 | |
| Cucumbers (Armenian cucumbers, Dosakayi/Indian curry cucumbers,) | 0232010 | European Union | 0.01* | 30/06/2017 | |
| Gherkins (Bur gherkins,) | 0232020 | European Union | 0.01* | 30/06/2017 | |
| Courgettes (Angled luffas/teroi, Bottle gourds/calabashes/lauki, Chayotes/christophines, Ivy gourds, Pointed gourds/parwals, Snake gourds, Sopropos/bitter melons/balsam pears, Summer squashes/zucchini/pâtissons/pattypan squashes/marrows,) | 0232030 | European Union | 0.01* | 30/06/2017 | |
| Others (2) | 0232990 | European Union | 0.01* | 30/06/2017 | |
| (c) cucurbits with inedible peel | 0233000 | European Union | 0.01* | 30/06/2017 | |
| Melons (Kiwanos/horned melons,) | 0233010 | European Union | 0.01* | 30/06/2017 | |
| Pumpkins (Butternut squashes, Winter melons/winter gourds/white gourds, Winter squashes/red kuri squashes/marrows (late varieties),) | 0233020 | European Union | 0.01* | 30/06/2017 | |
| Watermelons | 0233030 | European Union | 0.01* | 30/06/2017 | |
| (e) other fruiting vegetables | 0239000 | European Union | 0.01* | 30/06/2017 |