Relevant Regulations and Standards
Lenacil(F05723)
| Common Name | Lenacil(F05723) |
| FRCD ID | F05723 |
| Formula | C13H18N2O2 |
| InChI Key | ZTMKADLOSYKWCA-UHFFFAOYSA-N |
| InChI | InChI=1S/C13H18N2O2/c16-12-10-7-4-8-11(10)14-13(17)15(12)9-5-2-1-3-6-9/h9H,1-8H2,(H,14,17) |
| Canonical SMILES | C1CCC(CC1)N2C(=O)C3=C(CCC3)NC2=O |
| Isomeric SMILES | C1CCC(CC1)N2C(=O)C3=C(CCC3)NC2=O |
| Classifies | Pesticide |
| Update Date | Nov 13, 2018 17:07 |
MRLs
| Food | Product Code | Country | MRLs | Application Date | Notes |
|---|---|---|---|---|---|
| (g) other farmed terrestrial animals (Alpaca, Bactrian camel, Capybara, Cottontail/American rabbit, Dromedary, Eland, Elk/moose, Emu, Fallow deer, Guinea pig, Hare (farmed), Llama, Nandu/greater rhea, Ostrich, Peccari (collared), Rabbit, Red deer, Reindeer, Roe deer, Other farmed terrestrial animals,) | 1017000 | European Union | 0.1* | 01/09/2008 | |
| Nira | Japan | 0.3ppm | |||
| Garlic | Japan | 0.3ppm | |||
| FRUITS, FRESH or FROZEN; TREE NUTS | 0100000 | European Union | 0.1* | 01/09/2008 | |
| Citrus fruits | 0110000 | European Union | 0.1* | 01/09/2008 | |
| Grapefruits (Natsudaidais, Shaddocks/pomelos, Sweeties/oroblancos, Tangelolos, Tangelos (except minneolas)/Ugli®, Other hybrids of Citrus paradisi, not elsewhere mentioned,) | 0110010 | European Union | 0.1* | 01/09/2008 | |
| Oranges (Bergamots, Bitter oranges/sour oranges, Blood oranges, Cara caras, Chinottos, Trifoliate oranges, Other hybrids of Citrus sinensis, not elsewhere mentioned,) | 0110020 | European Union | 0.1* | 01/09/2008 | |
| Lemons (Buddha's hands/Buddha's fingers, Citrons,) | 0110030 | European Union | 0.1* | 01/09/2008 | |
| Limes (Indian sweet limes/Palestine sweet limes, Kaffir limes, Sweet limes/mosambis, Tahiti limes, Limequats,) | 0110040 | European Union | 0.1* | 01/09/2008 | |
| Mandarins (Calamondins, Clementines, Cleopatra mandarins, Minneolas, Satsumas/clausellinas, Tangerines/dancy mandarins, Tangors, Other hybrids of Citrus reticulata, not elsewhere mentioned,) | 0110050 | European Union | 0.1* | 01/09/2008 | |
| Others (2) | 0110990 | European Union | 0.1* | 01/09/2008 | |
| Tree nuts | 0120000 | European Union | 0.1* | 01/09/2008 | |
| Almonds (Apricot kernels, Bitter almonds, Canarium nuts/galip nuts, Pili nuts, Okari nuts,) | 0120010 | European Union | 0.1* | 01/09/2008 | |
| Brazil nuts | 0120020 | European Union | 0.1* | 01/09/2008 | |
| Cashew nuts | 0120030 | European Union | 0.1* | 01/09/2008 | |
| Chestnuts | 0120040 | European Union | 0.1* | 01/09/2008 | |
| Coconuts (Areca nuts/betel nuts,) | 0120050 | European Union | 0.1* | 01/09/2008 | |
| Hazelnuts/cobnuts (Acorns, Filberts,) | 0120060 | European Union | 0.1* | 01/09/2008 | |
| Macadamias | 0120070 | European Union | 0.1* | 01/09/2008 | |
| Pecans (Hickory nuts,) | 0120080 | European Union | 0.1* | 01/09/2008 |