| Common Name | Camphechlor(F05727) |
| FRCD ID | F05727 |
| Formula | C10H10Cl8 |
| InChI Key | YNEKMCSWRMRXIR-UHFFFAOYSA-N |
| InChI | InChI=1S/C10H10Cl8/c11-2-8(7(15)16)4-1-10(17,18)9(8,3-12)6(14)5(4)13/h4-7H,1-3H2 |
| Canonical SMILES | C1C2C(C(C(C1(Cl)Cl)(C2(CCl)C(Cl)Cl)CCl)Cl)Cl |
| Isomeric SMILES | C1C2C(C(C(C1(Cl)Cl)(C2(CCl)C(Cl)Cl)CCl)Cl)Cl |
| Classifies | Pesticide |
| Update Date | Nov 13, 2018 17:07 |
| Food | Product Code | Country | MRLs | Application Date | Notes |
|---|---|---|---|---|---|
| Chicory roots (Common polypody roots, Yacon roots,) | 0900030 | European Union | 0.01* | 30/12/2015 | |
| Others (2) (Birches (trunk sap), Manna ashes (trunk sap), Maples (trunk sap), Palms (trunk sap), Palms (trunk sap), Other sugar plants,) | 0900990 | European Union | 0.01* | 30/12/2015 | |
| Commodities from | 1010000 | European Union | 0.01* | 30/12/2015 | |
| (a) swine (Wild boar (farmed),) | 1011000 | European Union | 0.01* | 30/12/2015 | |
| Muscle | 1011010 | European Union | 0.01* | 30/12/2015 | |
| Fat | 1011020 | European Union | 0.01* | 30/12/2015 | |
| Liver | 1011030 | European Union | 0.01* | 30/12/2015 | |
| Kidney | 1011040 | European Union | 0.01* | 30/12/2015 | |
| Edible offals (other than liver and kidney) | 1011050 | European Union | 0.01* | 30/12/2015 | |
| Others (2) | 1011990 | European Union | 0.01* | 30/12/2015 | |
| Muscle | 1012010 | European Union | 0.01* | 30/12/2015 | |
| Fat | 1012020 | European Union | 0.01* | 30/12/2015 | |
| Liver | 1012030 | European Union | 0.01* | 30/12/2015 | |
| Kidney | 1012040 | European Union | 0.01* | 30/12/2015 | |
| Edible offals (other than liver and kidney) | 1012050 | European Union | 0.01* | 30/12/2015 | |
| Others (2) | 1012990 | European Union | 0.01* | 30/12/2015 | |
| (c) sheep (Mouflon (farmed),) | 1013000 | European Union | 0.01* | 30/12/2015 | |
| Muscle | 1013010 | European Union | 0.01* | 30/12/2015 | |
| Fat | 1013020 | European Union | 0.01* | 30/12/2015 | |
| Liver | 1013030 | European Union | 0.01* | 30/12/2015 |