| Common Name | Pyrasulfotole(F05745) |
| FRCD ID | F05745 |
| Formula | C14H13F3N2O4S |
| InChI Key | CZRVDACSCJKRFL-UHFFFAOYSA-N |
| InChI | InChI=1S/C14H13F3N2O4S/c1-7-11(13(21)19(2)18-7)12(20)9-5-4-8(14(15,16)17)6-10(9)24(3,22)23/h4-6,18H,1-3H3 |
| Canonical SMILES | CC1=C(C(=O)N(N1)C)C(=O)C2=C(C=C(C=C2)C(F)(F)F)S(=O)(=O)C |
| Isomeric SMILES | CC1=C(C(=O)N(N1)C)C(=O)C2=C(C=C(C=C2)C(F)(F)F)S(=O)(=O)C |
| Classifies | Pesticide |
| Update Date | Nov 13, 2018 17:07 |
| Food | Product Code | Country | MRLs | Application Date | Notes |
|---|---|---|---|---|---|
| Watermelons | 0233030 | European Union | 0.01* | 01/09/2008 | |
| Others (2) | 0233990 | European Union | 0.01* | 01/09/2008 | |
| (d) sweet corn (Baby corn,) | 0234000 | European Union | 0.01* | 01/09/2008 | |
| (e) other fruiting vegetables | 0239000 | European Union | 0.01* | 01/09/2008 | |
| Brassica vegetables (excluding brassica roots and brassica baby leaf crops) | 0240000 | European Union | 0.01* | 01/09/2008 | |
| (a) flowering brassica | 0241000 | European Union | 0.01* | 01/09/2008 | |
| Broccoli (Calabrese, Chinese broccoli/kai-lan, Choi sum/tsoi sam, Rapini/broccoletti/broccoli raab,) | 0241010 | European Union | 0.01* | 01/09/2008 | |
| Cauliflowers (Romanesco cauliflowers/Romanesco broccoli,) | 0241020 | European Union | 0.01* | 01/09/2008 | |
| Others (2) | 0241990 | European Union | 0.01* | 01/09/2008 | |
| (b) head brassica | 0242000 | European Union | 0.01* | 01/09/2008 | |
| Brussels sprouts (Flower sprouts,) | 0242010 | European Union | 0.01* | 01/09/2008 | |
| Head cabbages (Pointed head cabbages, Red cabbages, Savoy cabbages, White cabbage,) | 0242020 | European Union | 0.01* | 01/09/2008 | |
| Others (2) | 0242990 | European Union | 0.01* | 01/09/2008 | |
| (c) leafy brassica | 0243000 | European Union | 0.01* | 01/09/2008 | |
| Kales (Borecoles/collards greens/curly kales, Cow cabbages/stem kales, Cow cabbages/Jersey kales, Kohlrabies leaves (6), Rape kales/Siberian kales, Portuguese kales/tronchuda kales/Portuguese cabbages, Palm tree kale/lacinato/black kale, Radish leaves,) | 0243020 | European Union | 0.01* | 01/09/2008 | |
| Others (2) | 0243990 | European Union | 0.01* | 01/09/2008 | |
| (d) kohlrabies | 0244000 | European Union | 0.01* | 01/09/2008 | |
| Leaf vegetables, herbs and edible flowers | 0250000 | European Union | 0.01* | 01/09/2008 | |
| (a) lettuces and salad plants | 0251000 | European Union | 0.01* | 01/09/2008 | |
| Lamb's lettuces/corn salads (Italian corn salads,) | 0251010 | European Union | 0.01* | 01/09/2008 |