Relevant Regulations and Standards
Nicosulfuron(F05747)
| Common Name | Nicosulfuron(F05747) |
| FRCD ID | F05747 |
| Formula | C15H18N6O6S |
| InChI Key | RTCOGUMHFFWOJV-UHFFFAOYSA-N |
| InChI | InChI=1S/C15H18N6O6S/c1-21(2)13(22)9-6-5-7-16-12(9)28(24,25)20-15(23)19-14-17-10(26-3)8-11(18-14)27-4/h5-8H,1-4H3,(H2,17,18,19,20,23) |
| Canonical SMILES | CN(C)C(=O)C1=C(N=CC=C1)S(=O)(=O)NC(=O)NC2=NC(=CC(=N2)OC)OC |
| Isomeric SMILES | CN(C)C(=O)C1=C(N=CC=C1)S(=O)(=O)NC(=O)NC2=NC(=CC(=N2)OC)OC |
| Classifies | Pesticide |
| Update Date | Nov 13, 2018 17:07 |
MRLs
| Food | Product Code | Country | MRLs | Application Date | Notes |
|---|---|---|---|---|---|
| Coconuts (Areca nuts/betel nuts,) | 0120050 | European Union | 0.02* | 02/01/2015 | |
| (c) grape leaves and similar species (Climbing wattle/acacia shoots, Malabar nightshades,) | 0253000 | European Union | 0.01* | 02/01/2015 | |
| (a) Solanaceae and Malvaceae | 0231000 | European Union | 0.01* | 02/01/2015 | |
| Tomatoes (Alkekengi/Chinese lanterns/ground cherries, Cape gooseberries, Cherry tomatoes, Dwarf Cape gooseberries/strawberry tomatoes, Gojiberries/wolfberries, Gojiberries/wolfberries, Litchi tomatoes/sticky nightshades, Pear-shaped tomatoes, Tomatillos/husk tomatoes,) | 0231010 | European Union | 0.01* | 02/01/2015 | |
| Brazil nuts | 0120020 | European Union | 0.02* | 02/01/2015 | |
| Cashew nuts | 0120030 | European Union | 0.02* | 02/01/2015 | |
| Chestnuts | 0120040 | European Union | 0.02* | 02/01/2015 | |
| Citrus fruits | 0110000 | European Union | 0.01* | 02/01/2015 | |
| Grapefruits (Natsudaidais, Shaddocks/pomelos, Sweeties/oroblancos, Tangelolos, Tangelos (except minneolas)/Ugli®, Other hybrids of Citrus paradisi, not elsewhere mentioned,) | 0110010 | European Union | 0.01* | 02/01/2015 | |
| Oranges (Bergamots, Bitter oranges/sour oranges, Blood oranges, Cara caras, Chinottos, Trifoliate oranges, Other hybrids of Citrus sinensis, not elsewhere mentioned,) | 0110020 | European Union | 0.01* | 02/01/2015 | |
| Lemons (Buddha's hands/Buddha's fingers, Citrons,) | 0110030 | European Union | 0.01* | 02/01/2015 | |
| Limes (Indian sweet limes/Palestine sweet limes, Kaffir limes, Sweet limes/mosambis, Tahiti limes, Limequats,) | 0110040 | European Union | 0.01* | 02/01/2015 | |
| Mandarins (Calamondins, Clementines, Cleopatra mandarins, Minneolas, Satsumas/clausellinas, Tangerines/dancy mandarins, Tangors, Other hybrids of Citrus reticulata, not elsewhere mentioned,) | 0110050 | European Union | 0.01* | 02/01/2015 | |
| Others (2) | 0110990 | European Union | 0.01* | 02/01/2015 | |
| Tree nuts | 0120000 | European Union | 0.02* | 02/01/2015 | |
| Almonds (Apricot kernels, Bitter almonds, Canarium nuts/galip nuts, Pili nuts, Okari nuts,) | 0120010 | European Union | 0.02* | 02/01/2015 | |
| Hazelnuts/cobnuts (Acorns, Filberts,) | 0120060 | European Union | 0.02* | 02/01/2015 | |
| Macadamias | 0120070 | European Union | 0.02* | 02/01/2015 | |
| Pecans (Hickory nuts,) | 0120080 | European Union | 0.02* | 02/01/2015 | |
| Pistachios | 0120100 | European Union | 0.02* | 02/01/2015 |