| Common Name | Spinetoram(F05775) |
| FRCD ID | F05775 |
| Formula | C42H69NO10 |
| InChI Key | GOENIMGKWNZVDA-OAMCMWGQSA-N |
| InChI | InChI=1S/C42H69NO10/c1-10-27-13-12-14-35(53-37-18-17-34(43(6)7)24(4)49-37)23(3)38(45)33-21-31-29(32(33)22-36(44)51-27)16-15-26-19-28(20-30(26)31)52-42-41(47-9)40(48-11-2)39(46-8)25(5)50-42/h21,23-32,34-35,37,39-42H,10-20,22H2,1-9H3/t23-,24-,25+,26-,27+,28?,29-,30-,31-,32?,34+,35+,37+,39+,40-,41-,42+/m1/s1 |
| Canonical SMILES | CCC1CCCC(C(C(=O)C2=CC3C(C2CC(=O)O1)CCC4C3CC(C4)OC5C(C(C(C(O5)C)OC)OCC)OC)C)OC6CCC(C(O6)C)N(C)C |
| Isomeric SMILES | CC[C@H]1CCC[C@@H]([C@H](C(=O)C2=C[C@@H]3[C@H](C2CC(=O)O1)CC[C@H]4[C@H]3CC(C4)O[C@H]5[C@@H]([C@@H]([C@H]([C@@H](O5)C)OC)OCC)OC)C)O[C@H]6CC[C@@H]([C@H](O6)C)N(C)C |
| Classifies | Pesticide |
| Update Date | Nov 13, 2018 17:07 |
| Food | Product Code | Country | MRLs | Application Date | Notes |
|---|---|---|---|---|---|
| Liver | 1016030 | European Union | 0.01* | 20/10/2017 | |
| Mosses and lichens (Icelandic mosses, Other mosses and lichens,) | 0280990 | European Union | 0.05* | 20/10/2017 | |
| Kidney | 1016040 | European Union | 0.01* | 20/10/2017 | |
| Sugar canes (Agave leaves, Sweet sorghum canes,) | 0900020 | European Union | 0.05* | 20/10/2017 | |
| Purslanes (Agretti, Glassworts/samphires, Rock samphires, Sea asters, Sea lavenders, Winter purslanes/miner's lettuces, Karkallas/Hottentot figs/Iceplant leaves,) | 0252020 | European Union | 1.5 | 20/10/2017 | |
| Chards/beet leaves (Beetroot leaves, Swiss chards,) | 0252030 | European Union | 1.5 | 20/10/2017 | |
| Others (2) | 0252990 | European Union | 1.5 | 20/10/2017 | |
| (c) grape leaves and similar species (Climbing wattle/acacia shoots, Malabar nightshades,) | 0253000 | European Union | 0.05* | 20/10/2017 | |
| (d) watercresses (Morning glory/Chinese convolvolus/water convolvolus/kangkung, Water clovers, Water mimosas,) | 0254000 | European Union | 0.05* | 20/10/2017 | |
| (e) witloofs/Belgian endives (Dandelion leaves (forced),) | 0255000 | European Union | 0.05* | 20/10/2017 | |
| (f) herbs and edible flowers | 0256000 | European Union | 4 | 20/10/2017 | |
| Chervil | 0256010 | European Union | 4 | 20/10/2017 | |
| Chives (Chinese chives/oriental garlic/garlic chives, Ramson/wild garlic/bear's garlic,) | 0256020 | European Union | 4 | 20/10/2017 | |
| Celery leaves (Angelica (leaves and stems), Burnet, Caraway leaves, Coriander leaves, Culantro/false coriander leaves, Dill leaves, Fennel leaves, Fenugreek leaves, Herb of grace/rue, Lovage leaves, Pimpernel/greater burnet-saxifrage, Salad burnet/lady's mantle, Sorrel/dock, Sorrel/dock, Sorrel/dock, Sorrel/dock, Sweet cicely,) | 0256030 | European Union | 4 | 20/10/2017 | |
| Parsley (Root parsley leaves,) | 0256040 | European Union | 4 | 20/10/2017 | |
| Sage (Borage, Curry herb, Greek sage, Jamé's sage/Mexican sage, Other species and hybrids of genus Salvia, not elsewhere mentioned,) | 0256050 | European Union | 4 | 20/10/2017 | |
| Rosemary (Santolina/green lavander cotton, Green santolina,) | 0256060 | European Union | 4 | 20/10/2017 | |
| Thyme (Creeping thyme, Cretan oregano/Turkish oregano, Lemon savory, Lemon thyme/citrus thyme, Marjoram, Mastic thyme, Oregano, Summer savory, Syrian oregano/bible hyssop/za'atar, Winter savory,) | 0256070 | European Union | 4 | 20/10/2017 | |
| Laurel/bay leaves (Curry leaves, Kaffir lime leaves, Siamese cassia, Wild betel leaves, Pandan leaves,) | 0256090 | European Union | 4 | 20/10/2017 | |
| Tarragon (Aztec sweet herb, Epazote/Mexican tea/wormseed, Hyssop, Lemongrass, Mexican oregano, Nettle, Other species of the genus Urtica, not elsewhere mentioned, Russian tarragon, Stevia,) | 0256100 | European Union | 4 | 20/10/2017 |