Relevant Regulations and Standards
Phosmet(F05777)
| Common Name | Phosmet(F05777) |
| FRCD ID | F05777 |
| Formula | C11H12NO4PS2 |
| InChI Key | LMNZTLDVJIUSHT-UHFFFAOYSA-N |
| InChI | InChI=1S/C11H12NO4PS2/c1-15-17(18,16-2)19-7-12-10(13)8-5-3-4-6-9(8)11(12)14/h3-6H,7H2,1-2H3 |
| Canonical SMILES | COP(=S)(OC)SCN1C(=O)C2=CC=CC=C2C1=O |
| Isomeric SMILES | COP(=S)(OC)SCN1C(=O)C2=CC=CC=C2C1=O |
| Classifies | Pesticide |
| Update Date | Nov 13, 2018 17:07 |
MRLs
| Food | Product Code | Country | MRLs | Application Date | Notes |
|---|---|---|---|---|---|
| Pig,Fat | Japan | 0.2ppm | |||
| Kidney | 1015040 | European Union | 0.1 | 30/07/2014 | |
| (f) poultry (Bobwhite quail, Chicken (including silkie chicken), Collared Dove, Duck, Geese, Green peafowl, Guinea fowl, Japanese quail, Muskovy duck, Mute swan, Partridge, Peafowl, Pheasant, Pigeon, Quail, Turkey, Turtle dove, Other farmed birds of order Anseriformes, Other farmed birds of order Columbiformes, Other farmed birds of order Galliformes,) | 1016000 | European Union | 0.1 | 30/07/2014 | |
| Kidney | 1016040 | European Union | 0.1 | 30/07/2014 | |
| Liver | 1016030 | European Union | 0.1 | 30/07/2014 | |
| Edible offals (other than liver and kidney) | 1015050 | European Union | 0.1 | 30/07/2014 | |
| Others (2) | 1015990 | European Union | 0.1 | 30/07/2014 | |
| Muscle | 1016010 | European Union | 0.1 | 30/07/2014 | |
| Fat | 1016020 | European Union | 0.1 | 30/07/2014 | |
| Edible offals (other than liver and kidney) | 1016050 | European Union | 0.1 | 30/07/2014 | |
| Others (2) | 1016990 | European Union | 0.1 | 30/07/2014 | |
| (g) other farmed terrestrial animals (Alpaca, Bactrian camel, Capybara, Cottontail/American rabbit, Dromedary, Eland, Elk/moose, Emu, Fallow deer, Guinea pig, Hare (farmed), Llama, Nandu/greater rhea, Ostrich, Peccari (collared), Rabbit, Red deer, Reindeer, Roe deer, Other farmed terrestrial animals,) | 1017000 | European Union | 0.1 | 30/07/2014 | |
| Muscle | 1017010 | European Union | 0.1 | 30/07/2014 | |
| Fat | 1017020 | European Union | 0.1 | 30/07/2014 | |
| Liver | 1017030 | European Union | 0.1 | 30/07/2014 | |
| Kidney | 1017040 | European Union | 0.1 | 30/07/2014 | |
| Edible offals (other than liver and kidney) | 1017050 | European Union | 0.1 | 30/07/2014 | |
| Others (2) | 1017990 | European Union | 0.1 | 30/07/2014 | |
| Milk | 1020000 | European Union | 0.05* | 30/07/2014 | |
| Cattle (Species listed with code numbers 1012000-xxx,) | 1020010 | European Union | 0.05* | 30/07/2014 |