Relevant Regulations and Standards
Chromafenozide(F05819)
| Common Name | Chromafenozide(F05819) |
| FRCD ID | F05819 |
| Formula | C24H30N2O3 |
| InChI Key | HPNSNYBUADCFDR-UHFFFAOYSA-N |
| InChI | InChI=1S/C24H30N2O3/c1-15-12-16(2)14-18(13-15)23(28)26(24(4,5)6)25-22(27)20-9-10-21-19(17(20)3)8-7-11-29-21/h9-10,12-14H,7-8,11H2,1-6H3,(H,25,27) |
| Canonical SMILES | CC1=CC(=CC(=C1)C(=O)N(C(C)(C)C)NC(=O)C2=C(C3=C(C=C2)OCCC3)C)C |
| Isomeric SMILES | CC1=CC(=CC(=C1)C(=O)N(C(C)(C)C)NC(=O)C2=C(C3=C(C=C2)OCCC3)C)C |
| Classifies | Pesticide |
| Update Date | Nov 13, 2018 17:07 |
MRLs
| Food | Product Code | Country | MRLs | Application Date | Notes |
|---|---|---|---|---|---|
| Blueberry | Japan | 1ppm | |||
| Others (2) | 0840990 | European Union | 0.02* | 01/11/2014 | |
| Root and tuber vegetables | 0210000 | European Union | 0.01* | 01/11/2014 | |
| (a) potatoes (Andigena,) | 0211000 | European Union | 0.01* | 01/11/2014 | |
| (b) tropical root and tuber vegetables | 0212000 | European Union | 0.01* | 01/11/2014 | |
| Bud spices | 0850000 | European Union | 0.02* | 01/11/2014 | |
| Star apples/cainitos | 0162050 | European Union | 0.01* | 01/11/2014 | |
| American persimmons/Virginia kaki (Black sapotes, Green sapotes, White sapotes, Yellow sapotes/canistels,) | 0162060 | European Union | 0.01* | 01/11/2014 | |
| Others (2) | 0162990 | European Union | 0.01* | 01/11/2014 | |
| (c) inedible peel, large | 0163000 | European Union | 0.01* | 01/11/2014 | |
| Avocados (Avocados for oil production,) | 0163010 | European Union | 0.01* | 01/11/2014 | |
| Bananas (Cavendishes/grand nains, Cavendishes/grand nains, Cavendishes/grand nains, Dwarf bananas/lady fingers bananas, Plantains, Plantains, Plantains,) | 0163020 | European Union | 0.01* | 01/11/2014 | |
| Mangoes | 0163030 | European Union | 0.01* | 01/11/2014 | |
| Papayas (Akee apples, Feijoas/pineapple guavas, Langsats/lanzones/longkongs, Mangosteens, Naranjillas/lulos, Paw paws, Tamarillos,) | 0163040 | European Union | 0.01* | 01/11/2014 | |
| Granate apples/pomegranates | 0163050 | European Union | 0.01* | 01/11/2014 | |
| Cherimoyas (Elephant apples, Ilamas, Mammey sapotes, Marmeladedos, Pulasans, Rambutans/hairy litchis, Sapodillas, Sweetsops/sugar apples, Wild sweetsops/custard apples,) | 0163060 | European Union | 0.01* | 01/11/2014 | |
| Guavas (Brazilian guavas, Cattley guavas, Costarican guavas, Guayabillos, Parà guavas,) | 0163070 | European Union | 0.01* | 01/11/2014 | |
| Pineapples | 0163080 | European Union | 0.01* | 01/11/2014 | |
| Breadfruits (Jackfruits, Other species of genus Artocarpus, not elsewhere mentioned,) | 0163090 | European Union | 0.01* | 01/11/2014 | |
| Durians | 0163100 | European Union | 0.01* | 01/11/2014 |