Relevant Regulations and Standards
Clethodim(F05865)
| Common Name | Clethodim(F05865) |
| FRCD ID | F05865 |
| Formula | C17H26ClNO3S |
| InChI Key | INNPZTGYZSAJFN-ZTVUPKSFSA-N |
| InChI | InChI=1S/C17H26ClNO3S/c1-4-14(19-22-8-6-7-18)17-15(20)10-13(11-16(17)21)9-12(3)23-5-2/h6-7,12-13,19H,4-5,8-11H2,1-3H3/b7-6+,17-14? |
| Canonical SMILES | CCC(=C1C(=O)CC(CC1=O)CC(C)SCC)NOCC=CCl |
| Isomeric SMILES | CCC(=C1C(=O)CC(CC1=O)CC(C)SCC)NOC/C=C/Cl |
| Classifies | Pesticide |
| Update Date | Nov 13, 2018 17:07 |
MRLs
| Food | Product Code | Country | MRLs | Application Date | Notes |
|---|---|---|---|---|---|
| Pears (Nashi pears/Oriental pears, Wild pears, Ya pears/Chinese white pears,) | 0130020 | European Union | 0.1 | 01/09/2008 | |
| Pistachios | 0120100 | European Union | 0.1 | 01/09/2008 | |
| Prickly pears/cactus fruits (Pitayas/dragon fruits, Red pitayas, Saguaro fruits, Yellow pitayas,) | 0162040 | European Union | 0.1 | 01/09/2008 | |
| Cresses and other sprouts and shoots (Alfalfa/lucerne sprouts, Chinese chives/oriental garlic/garlic chives sprouts, Broccoli sprouts, Daikon/Japanese radish sprouts, Ginger shoots, Mung bean sprouts, Peas shoots and sprouts, Roman rocket/rucola sprouts, Soyabeans sprouts, Sunflower shoots and sprouts, Cereals grasses/cereals shoots, Other species used for the production of sprouts or shoots,) | 0251040 | European Union | 0.5 | 01/09/2008 | |
| Safflower seeds (Milk thistle seeds, Niger seeds,) | 0401110 | European Union | 0.1 | 01/09/2008 | |
| Borage seeds (Corn gromwell seeds, Evening primrose seeds, Honesty seeds, Honesty seeds, Perilla seeds, Purple viper's bugloss seeds,) | 0401120 | European Union | 0.1 | 01/09/2008 | |
| Star apples/cainitos | 0162050 | European Union | 0.1 | 01/09/2008 | |
| Hemp seeds | 0401140 | European Union | 0.1 | 01/09/2008 | |
| Citrus fruits | 0110000 | European Union | 0.1 | 01/09/2008 | |
| Grapefruits (Natsudaidais, Shaddocks/pomelos, Sweeties/oroblancos, Tangelolos, Tangelos (except minneolas)/Ugli®, Other hybrids of Citrus paradisi, not elsewhere mentioned,) | 0110010 | European Union | 0.1 | 01/09/2008 | |
| Oranges (Bergamots, Bitter oranges/sour oranges, Blood oranges, Cara caras, Chinottos, Trifoliate oranges, Other hybrids of Citrus sinensis, not elsewhere mentioned,) | 0110020 | European Union | 0.1 | 01/09/2008 | |
| Lemons (Buddha's hands/Buddha's fingers, Citrons,) | 0110030 | European Union | 0.1 | 01/09/2008 | |
| Limes (Indian sweet limes/Palestine sweet limes, Kaffir limes, Sweet limes/mosambis, Tahiti limes, Limequats,) | 0110040 | European Union | 0.1 | 01/09/2008 | |
| Mandarins (Calamondins, Clementines, Cleopatra mandarins, Minneolas, Satsumas/clausellinas, Tangerines/dancy mandarins, Tangors, Other hybrids of Citrus reticulata, not elsewhere mentioned,) | 0110050 | European Union | 0.1 | 01/09/2008 | |
| Others (2) | 0110990 | European Union | 0.1 | 01/09/2008 | |
| Tree nuts | 0120000 | European Union | 0.1 | 01/09/2008 | |
| Almonds (Apricot kernels, Bitter almonds, Canarium nuts/galip nuts, Pili nuts, Okari nuts,) | 0120010 | European Union | 0.1 | 01/09/2008 | |
| Brazil nuts | 0120020 | European Union | 0.1 | 01/09/2008 | |
| Cashew nuts | 0120030 | European Union | 0.1 | 01/09/2008 | |
| Chestnuts | 0120040 | European Union | 0.1 | 01/09/2008 |