Relevant Regulations and Standards
Bupirimate(F05916)
| Common Name | Bupirimate(F05916) |
| FRCD ID | F05916 |
| Formula | C13H24N4O3S |
| InChI Key | DSKJPMWIHSOYEA-UHFFFAOYSA-N |
| InChI | InChI=1S/C13H24N4O3S/c1-6-8-9-11-10(3)15-13(14-7-2)16-12(11)20-21(18,19)17(4)5/h6-9H2,1-5H3,(H,14,15,16) |
| Canonical SMILES | CCCCC1=C(N=C(N=C1OS(=O)(=O)N(C)C)NCC)C |
| Isomeric SMILES | CCCCC1=C(N=C(N=C1OS(=O)(=O)N(C)C)NCC)C |
| Classifies | Pesticide |
| Update Date | Nov 13, 2018 17:07 |
MRLs
| Food | Product Code | Country | MRLs | Application Date | Notes |
|---|---|---|---|---|---|
| Palm hearts | 0270090 | European Union | 0.05* | 25/06/2015 | |
| Others (2) | 0270990 | European Union | 0.05* | 25/06/2015 | |
| Celeriacs/turnip rooted celeries | 0213030 | European Union | 0.05* | 25/06/2015 | |
| Jerusalem artichokes (Crosnes/Chinese artichokes, Mashua, Oca, Pale-leaf sunflower, Tuberous peas,) | 0213050 | European Union | 0.05* | 25/06/2015 | |
| Parsnips | 0213060 | European Union | 0.05* | 25/06/2015 | |
| Parsley roots/Hamburg roots parsley (Angelica roots, Burnet saxifrage roots, Lovage roots, Nettle roots, Other species of the genus Urtica, not elsewhere mentioned, Turnip-rooted chervils,) | 0213070 | European Union | 0.05* | 25/06/2015 | |
| Radishes (Black radishes/winter radishes/ 'Gros noir d'hiver', Daikon/japanese radishes, Maca roots, Small radishes, Tigernuts,) | 0213080 | European Union | 0.05* | 25/06/2015 | |
| Salsifies (Burdocks, Rampion roots, Scorzonera/black salsifies, Skirrets, Spanish salsifies,) | 0213090 | European Union | 0.05* | 25/06/2015 | |
| Swedes/rutabagas | 0213100 | European Union | 0.05* | 25/06/2015 | |
| Turnips (Tuberous-rooted mustards,) | 0213110 | European Union | 0.05* | 25/06/2015 | |
| Others (2) | 0213990 | European Union | 0.05* | 25/06/2015 | |
| Bulb vegetables | 0220000 | European Union | 0.05* | 25/06/2015 | |
| Garlic (Twistedleaf garlic,) | 0220010 | European Union | 0.05* | 25/06/2015 | |
| Onions ('Cipollotto Nocerino PDO', Pearl onions, Rakkyo/Chinese onions, Silverskin onions/pickled onions,) | 0220020 | European Union | 0.05* | 25/06/2015 | |
| Shallots (French grey shallots, Persian shallots,) | 0220030 | European Union | 0.05* | 25/06/2015 | |
| Spring onions/green onions and Welsh onions (Tree onions/Egyptian walking onions, Green garlic,) | 0220040 | European Union | 0.05* | 25/06/2015 | |
| Others (2) | 0220990 | European Union | 0.05* | 25/06/2015 | |
| Tomatoes (Alkekengi/Chinese lanterns/ground cherries, Cape gooseberries, Cherry tomatoes, Dwarf Cape gooseberries/strawberry tomatoes, Gojiberries/wolfberries, Gojiberries/wolfberries, Litchi tomatoes/sticky nightshades, Pear-shaped tomatoes, Tomatillos/husk tomatoes,) | 0231010 | European Union | 2 | 25/06/2015 | |
| Sweet peppers/bell peppers (Chili peppers,) | 0231020 | European Union | 2 | 25/06/2015 | |
| Aubergines/eggplants (Antroewas/African eggplants/gboma, Ethiopian eggplants/gilo', Pepinos, Thorn apples, Turkey berries/devil's figs/pea eggplants/pea aubergines, Kangaroo apples/poroporo,) | 0231030 | European Union | 2 | 25/06/2015 |