Relevant Regulations and Standards
Methabenzthiazuron(F05933)
| Common Name | Methabenzthiazuron(F05933) |
| FRCD ID | F05933 |
| Formula | C10H11N3OS |
| InChI Key | RRVIAQKBTUQODI-UHFFFAOYSA-N |
| InChI | InChI=1S/C10H11N3OS/c1-11-9(14)13(2)10-12-7-5-3-4-6-8(7)15-10/h3-6H,1-2H3,(H,11,14) |
| Canonical SMILES | CNC(=O)N(C)C1=NC2=CC=CC=C2S1 |
| Isomeric SMILES | CNC(=O)N(C)C1=NC2=CC=CC=C2S1 |
| Classifies | Pesticide |
| Update Date | Nov 13, 2018 17:07 |
MRLs
| Food | Product Code | Country | MRLs | Application Date | Notes |
|---|---|---|---|---|---|
| Cashew nuts | 0120030 | European Union | 0.02* | 21/10/2011 | |
| Coconuts (Areca nuts/betel nuts,) | 0120050 | European Union | 0.02* | 21/10/2011 | |
| Pine nut kernels (Pine nut kernels from other species than Pinus pinea, Pine nut kernels from other species than Pinus pinea, Pine nut kernels from other species than Pinus pinea, Pine nut kernels from other species than Pinus pinea, Pine nut kernels from other species than Pinus pinea, Pine nut kernels from other species than Pinus pinea, Pine nut kernels from other species than Pinus pinea, Other species of genus Pinus, not elsewhere mentioned,) | 0120090 | European Union | 0.02* | 21/10/2011 | |
| Carambolas (Ambarellas, Aonlas/Indian gooseberries, Babacos, Bilimbis, Cashew apples, Indian jujubes/bers, Jaboticabas, Malay pommarosas/pomeracs, Malayan mombins, Maprangs/marian plums, Natal plums, Nonis, Pommarosas/rose apples, Purple mombins, Santols/sentuls,) | 0161050 | European Union | 0.01* | 21/10/2011 | |
| Spring onions/green onions and Welsh onions (Tree onions/Egyptian walking onions, Green garlic,) | 0220040 | European Union | 0.02* | 21/10/2011 | |
| Tomatoes (Alkekengi/Chinese lanterns/ground cherries, Cape gooseberries, Cherry tomatoes, Dwarf Cape gooseberries/strawberry tomatoes, Gojiberries/wolfberries, Gojiberries/wolfberries, Litchi tomatoes/sticky nightshades, Pear-shaped tomatoes, Tomatillos/husk tomatoes,) | 0231010 | European Union | 0.01* | 21/10/2011 | |
| Purslanes (Agretti, Glassworts/samphires, Rock samphires, Sea asters, Sea lavenders, Winter purslanes/miner's lettuces, Karkallas/Hottentot figs/Iceplant leaves,) | 0252020 | European Union | 0.01* | 21/10/2011 | |
| Celery leaves (Angelica (leaves and stems), Burnet, Caraway leaves, Coriander leaves, Culantro/false coriander leaves, Dill leaves, Fennel leaves, Fenugreek leaves, Herb of grace/rue, Lovage leaves, Pimpernel/greater burnet-saxifrage, Salad burnet/lady's mantle, Sorrel/dock, Sorrel/dock, Sorrel/dock, Sorrel/dock, Sweet cicely,) | 0256030 | European Union | 0.01* | 21/10/2011 | |
| Basil and edible flowers (Apple mint, Asiatic pennywort, Bergamot mint/eau-de-Cologne mint, Corsican mint, Courgette (edible flowers), Gingermint, Greek bush basil, Hoary basil, Holy basil/tulsi, Lemon balm, Lemon basil, Lesser calamint, Lizard tail/dap ca, Marigold (edible flowers), Marigold (edible flowers), Other species of the genus Tagetes, not elsewhere mentioned, Nasturtium (leaves and edible flowers), Nasturtium (leaves and edible flowers), Pennyroyal, Peppermint, Pot marigold (edible flowers), Rice paddy herb/phak ka yaeng, Spearmint, Thai basil, Vietnamese mint, Water mint, Other edible flowers, Other species and hybrids of genus Mentha, not elsewhere mentioned,) | 0256080 | European Union | 0.01* | 21/10/2011 | |
| Wild fungi (Ceps/porcino mushrooms, Chanterelles, Hedgehog mushrooms, Horns of plenty/black trumpets, Morels, Périgord black truffles, Piemont white truffles, Saint George's mushrooms, Scotch bonnet mushrooms, Summer truffles, Other wild fungi, Other species of genus Tuber, not elsewhere mentioned,) | 0280020 | European Union | 0.01* | 21/10/2011 | |
| Beans (Azuki beans, Black eyed peas/cowpeas, Broad beans/fava beans/horse beans/tic beans, Borlotti beans/cannelini beans/common beans/flageolets/French beans/slicing beans/snap beans, Ervils/lentil vetches, Guar beans, Jack beans, Lablab beans/hyacinth beans, Lima beans/butter beans, Monantha vetches, Mung beans, Rice beans, Runner beans/scarlet runner beans, Stink beans, Vetches, Yardlong beans,) | 0300010 | European Union | 0.01* | 21/10/2011 | |
| Citrus fruits | 0110000 | European Union | 0.01* | 21/10/2011 | |
| Grapefruits (Natsudaidais, Shaddocks/pomelos, Sweeties/oroblancos, Tangelolos, Tangelos (except minneolas)/Ugli®, Other hybrids of Citrus paradisi, not elsewhere mentioned,) | 0110010 | European Union | 0.01* | 21/10/2011 | |
| Table olives (Chinese black olives, Chinese white olives, Desert dates,) | 0161030 | European Union | 0.01* | 21/10/2011 | |
| Oranges (Bergamots, Bitter oranges/sour oranges, Blood oranges, Cara caras, Chinottos, Trifoliate oranges, Other hybrids of Citrus sinensis, not elsewhere mentioned,) | 0110020 | European Union | 0.01* | 21/10/2011 | |
| Lemons (Buddha's hands/Buddha's fingers, Citrons,) | 0110030 | European Union | 0.01* | 21/10/2011 | |
| Limes (Indian sweet limes/Palestine sweet limes, Kaffir limes, Sweet limes/mosambis, Tahiti limes, Limequats,) | 0110040 | European Union | 0.01* | 21/10/2011 | |
| Mandarins (Calamondins, Clementines, Cleopatra mandarins, Minneolas, Satsumas/clausellinas, Tangerines/dancy mandarins, Tangors, Other hybrids of Citrus reticulata, not elsewhere mentioned,) | 0110050 | European Union | 0.01* | 21/10/2011 | |
| Others (2) | 0110990 | European Union | 0.01* | 21/10/2011 | |
| Tree nuts | 0120000 | European Union | 0.02* | 21/10/2011 |