Relevant Regulations and Standards
Flubendiamide(F05973)
| Common Name | Flubendiamide(F05973) |
| FRCD ID | F05973 |
| Formula | C23H22F7IN2O4S |
| InChI Key | ZGNITFSDLCMLGI-UHFFFAOYSA-N |
| InChI | InChI=1S/C23H22F7IN2O4S/c1-12-10-13(21(24,22(25,26)27)23(28,29)30)8-9-16(12)32-18(34)14-6-5-7-15(31)17(14)19(35)33-20(2,3)11-38(4,36)37/h5-10H,11H2,1-4H3,(H,32,34)(H,33,35) |
| Canonical SMILES | CC1=C(C=CC(=C1)C(C(F)(F)F)(C(F)(F)F)F)NC(=O)C2=C(C(=CC=C2)I)C(=O)NC(C)(C)CS(=O)(=O)C |
| Isomeric SMILES | CC1=C(C=CC(=C1)C(C(F)(F)F)(C(F)(F)F)F)NC(=O)C2=C(C(=CC=C2)I)C(=O)NC(C)(C)CS(=O)(=O)C |
| Classifies | Pesticide |
| Update Date | Nov 13, 2018 17:07 |
MRLs
| Food | Product Code | Country | MRLs | Application Date | Notes |
|---|---|---|---|---|---|
| Celery leaves (Angelica (leaves and stems), Burnet, Caraway leaves, Coriander leaves, Culantro/false coriander leaves, Dill leaves, Fennel leaves, Fenugreek leaves, Herb of grace/rue, Lovage leaves, Pimpernel/greater burnet-saxifrage, Salad burnet/lady's mantle, Sorrel/dock, Sorrel/dock, Sorrel/dock, Sorrel/dock, Sweet cicely,) | 0256030 | European Union | 0.01* | 26/06/2018 | |
| (d) any other parts of the plant (Blond psyllium (seeds, husks), Chamomile (seeds), Cherries (sweet) (stems), China/Jesuit's bark (bark), China/Jesuit's bark (bark), Cocoa (husks), Condurango (bark), Dwarf mountain pine (shoots), Fir (shoots), Fleawort (seeds), Fragrant sumac (bark), Guarana (seeds), Hibiscus (seeds), Horse-chestnut (seeds, bark), Juniper (bark, wood, shoots), Lapacho (bark), Lignum vitae (bark, wood), Parsley (fruits), Purging cassia (fruits), Quassia (bark, wood), Red sandalwood (bark, wood), Soap-bark tree (bark), Sour cherry/morello cherry (stems), Sweet corn (stigmas, styles), Wild angelica (fruits), Witch hazel (bark), Other herbal infusions from any other parts of the plant,) | 0639000 | European Union | 0.02* | 26/06/2018 | |
| SUGAR PLANTS | 0900000 | European Union | 0.01* | 26/06/2018 | |
| Red mustards | 0251070 | European Union | 0.01* | 26/06/2018 | |
| Citrus fruits | 0110000 | European Union | 0.01* | 26/06/2018 | |
| Grapefruits (Natsudaidais, Shaddocks/pomelos, Sweeties/oroblancos, Tangelolos, Tangelos (except minneolas)/Ugli®, Other hybrids of Citrus paradisi, not elsewhere mentioned,) | 0110010 | European Union | 0.01* | 26/06/2018 | |
| Oranges (Bergamots, Bitter oranges/sour oranges, Blood oranges, Cara caras, Chinottos, Trifoliate oranges, Other hybrids of Citrus sinensis, not elsewhere mentioned,) | 0110020 | European Union | 0.01* | 26/06/2018 | |
| Lemons (Buddha's hands/Buddha's fingers, Citrons,) | 0110030 | European Union | 0.01* | 26/06/2018 | |
| Limes (Indian sweet limes/Palestine sweet limes, Kaffir limes, Sweet limes/mosambis, Tahiti limes, Limequats,) | 0110040 | European Union | 0.01* | 26/06/2018 | |
| Mandarins (Calamondins, Clementines, Cleopatra mandarins, Minneolas, Satsumas/clausellinas, Tangerines/dancy mandarins, Tangors, Other hybrids of Citrus reticulata, not elsewhere mentioned,) | 0110050 | European Union | 0.01* | 26/06/2018 | |
| Others (2) | 0110990 | European Union | 0.01* | 26/06/2018 | |
| Tree nuts | 0120000 | European Union | 0.1 | 26/06/2018 | |
| Almonds (Apricot kernels, Bitter almonds, Canarium nuts/galip nuts, Pili nuts, Okari nuts,) | 0120010 | European Union | 0.1 | 26/06/2018 | |
| Brazil nuts | 0120020 | European Union | 0.1 | 26/06/2018 | |
| Cashew nuts | 0120030 | European Union | 0.1 | 26/06/2018 | |
| Chestnuts | 0120040 | European Union | 0.1 | 26/06/2018 | |
| Coconuts (Areca nuts/betel nuts,) | 0120050 | European Union | 0.1 | 26/06/2018 | |
| Hazelnuts/cobnuts (Acorns, Filberts,) | 0120060 | European Union | 0.1 | 26/06/2018 | |
| Macadamias | 0120070 | European Union | 0.1 | 26/06/2018 | |
| Pecans (Hickory nuts,) | 0120080 | European Union | 0.1 | 26/06/2018 |