Relevant Regulations and Standards
Triflumizole(F06003)
| Common Name | Triflumizole(F06003) |
| FRCD ID | F06003 |
| Formula | C15H15ClF3N3O |
| InChI Key | HSMVPDGQOIQYSR-UHFFFAOYSA-N |
| InChI | InChI=1S/C15H15ClF3N3O/c1-2-7-23-9-14(22-6-5-20-10-22)21-13-4-3-11(16)8-12(13)15(17,18)19/h3-6,8,10H,2,7,9H2,1H3 |
| Canonical SMILES | CCCOCC(=NC1=C(C=C(C=C1)Cl)C(F)(F)F)N2C=CN=C2 |
| Isomeric SMILES | CCCOCC(=NC1=C(C=C(C=C1)Cl)C(F)(F)F)N2C=CN=C2 |
| Classifies | Pesticide |
| Update Date | Nov 13, 2018 17:07 |
MRLs
| Food | Product Code | Country | MRLs | Application Date | Notes |
|---|---|---|---|---|---|
| Citrus fruits | 0110000 | European Union | 0.1* | 01/09/2008 | |
| Grapefruits (Natsudaidais, Shaddocks/pomelos, Sweeties/oroblancos, Tangelolos, Tangelos (except minneolas)/Ugli®, Other hybrids of Citrus paradisi, not elsewhere mentioned,) | 0110010 | European Union | 0.1* | 01/09/2008 | |
| Oranges (Bergamots, Bitter oranges/sour oranges, Blood oranges, Cara caras, Chinottos, Trifoliate oranges, Other hybrids of Citrus sinensis, not elsewhere mentioned,) | 0110020 | European Union | 0.1* | 01/09/2008 | |
| Lemons (Buddha's hands/Buddha's fingers, Citrons,) | 0110030 | European Union | 0.1* | 01/09/2008 | |
| Limes (Indian sweet limes/Palestine sweet limes, Kaffir limes, Sweet limes/mosambis, Tahiti limes, Limequats,) | 0110040 | European Union | 0.1* | 01/09/2008 | |
| Mandarins (Calamondins, Clementines, Cleopatra mandarins, Minneolas, Satsumas/clausellinas, Tangerines/dancy mandarins, Tangors, Other hybrids of Citrus reticulata, not elsewhere mentioned,) | 0110050 | European Union | 0.1* | 01/09/2008 | |
| Others (2) | 0110990 | European Union | 0.1* | 01/09/2008 | |
| Tree nuts | 0120000 | European Union | 0.1* | 01/09/2008 | |
| Almonds (Apricot kernels, Bitter almonds, Canarium nuts/galip nuts, Pili nuts, Okari nuts,) | 0120010 | European Union | 0.1* | 01/09/2008 | |
| Brazil nuts | 0120020 | European Union | 0.1* | 01/09/2008 | |
| Cashew nuts | 0120030 | European Union | 0.1* | 01/09/2008 | |
| Chestnuts | 0120040 | European Union | 0.1* | 01/09/2008 | |
| Pistachios | 0120100 | European Union | 0.1* | 01/09/2008 | |
| Walnuts | 0120110 | European Union | 0.1* | 01/09/2008 | |
| Others (2) | 0120990 | European Union | 0.1* | 01/09/2008 | |
| Quinces (Chinese quinces, Japanese quinces,) | 0130030 | European Union | 0.5 | 01/09/2008 | |
| Medlars | 0130040 | European Union | 0.1* | 01/09/2008 | |
| Loquats/Japanese medlars | 0130050 | European Union | 0.1* | 01/09/2008 | |
| Others (2) | 0130990 | European Union | 0.1* | 01/09/2008 | |
| Apricots (Japanese apricots/Umes, Nectacots,) | 0140010 | European Union | 0.1* | 01/09/2008 |