Relevant Regulations and Standards
Spirotetramat(F06031)
| Common Name | Spirotetramat(F06031) |
| FRCD ID | F06031 |
| Formula | C21H27NO5 |
| InChI Key | CLSVJBIHYWPGQY-UHFFFAOYSA-N |
| InChI | InChI=1S/C21H27NO5/c1-5-26-20(24)27-18-17(16-12-13(2)6-7-14(16)3)19(23)22-21(18)10-8-15(25-4)9-11-21/h6-7,12,15H,5,8-11H2,1-4H3,(H,22,23) |
| Canonical SMILES | CCOC(=O)OC1=C(C(=O)NC12CCC(CC2)OC)C3=C(C=CC(=C3)C)C |
| Isomeric SMILES | CCOC(=O)OC1=C(C(=O)NC12CCC(CC2)OC)C3=C(C=CC(=C3)C)C |
| Classifies | Pesticide |
| Update Date | Nov 13, 2018 17:07 |
MRLs
| Food | Product Code | Country | MRLs | Application Date | Notes |
|---|---|---|---|---|---|
| Pine nut kernels (Pine nut kernels from other species than Pinus pinea, Pine nut kernels from other species than Pinus pinea, Pine nut kernels from other species than Pinus pinea, Pine nut kernels from other species than Pinus pinea, Pine nut kernels from other species than Pinus pinea, Pine nut kernels from other species than Pinus pinea, Pine nut kernels from other species than Pinus pinea, Other species of genus Pinus, not elsewhere mentioned,) | 0120090 | European Union | 0.5 | 11/07/2017 | |
| Prickly pears/cactus fruits (Pitayas/dragon fruits, Red pitayas, Saguaro fruits, Yellow pitayas,) | 0162040 | European Union | 0.1* | 11/07/2017 | |
| Horseradishes (Dandelion roots, Gentiana roots, East Indian galangal/aromatic ginger/sand galangal, Fingerroot, Galangal roots, Galangal roots, Galangal roots, Galangal roots, Ginger roots, Greater galangal, Lesser galangal/smaller galangal, Orris roots, Orris roots, Wasabi roots,) | 0213040 | European Union | 0.1 | 11/07/2017 | |
| Cresses and other sprouts and shoots (Alfalfa/lucerne sprouts, Chinese chives/oriental garlic/garlic chives sprouts, Broccoli sprouts, Daikon/Japanese radish sprouts, Ginger shoots, Mung bean sprouts, Peas shoots and sprouts, Roman rocket/rucola sprouts, Soyabeans sprouts, Sunflower shoots and sprouts, Cereals grasses/cereals shoots, Other species used for the production of sprouts or shoots,) | 0251040 | European Union | 7 | 11/07/2017 | |
| Beans (with pods) (Azuki beans, Black eyed peas/cowpeas, Broad beans/fava beans/horse beans/tic beans, Borlotti beans/cannelini beans/common beans/flageolets/French beans/slicing beans/snap beans, Ervils/lentil vetches, Guar beans, Jack beans, Lablab beans/hyacinth beans, Lima beans/butter beans, Monantha vetches, Mung beans, Rice beans, Runner beans/scarlet runner beans, Soyabeans/edamame, Stink beans, Vetches, Yardlong beans,) | 0260010 | European Union | 1.5 | 11/07/2017 | |
| Edible offals (other than liver and kidney) | 1016050 | European Union | 0.01* | 11/07/2017 | |
| Amphibians and Reptiles (Crocodiles, Frog legs, Snakes, Turtles, Other Amphibians and Reptiles, Other frog legs from frogs not belonging to the genus Rana,) | 1050000 | European Union | 0.01* | 11/07/2017 | |
| Macadamias | 0120070 | European Union | 0.5 | 11/07/2017 | |
| Citrus fruits | 0110000 | European Union | 1 | 11/07/2017 | |
| Grapefruits (Natsudaidais, Shaddocks/pomelos, Sweeties/oroblancos, Tangelolos, Tangelos (except minneolas)/Ugli®, Other hybrids of Citrus paradisi, not elsewhere mentioned,) | 0110010 | European Union | 1 | 11/07/2017 | |
| Oranges (Bergamots, Bitter oranges/sour oranges, Blood oranges, Cara caras, Chinottos, Trifoliate oranges, Other hybrids of Citrus sinensis, not elsewhere mentioned,) | 0110020 | European Union | 1 | 11/07/2017 | |
| Lemons (Buddha's hands/Buddha's fingers, Citrons,) | 0110030 | European Union | 1 | 11/07/2017 | |
| Limes (Indian sweet limes/Palestine sweet limes, Kaffir limes, Sweet limes/mosambis, Tahiti limes, Limequats,) | 0110040 | European Union | 1 | 11/07/2017 | |
| Mandarins (Calamondins, Clementines, Cleopatra mandarins, Minneolas, Satsumas/clausellinas, Tangerines/dancy mandarins, Tangors, Other hybrids of Citrus reticulata, not elsewhere mentioned,) | 0110050 | European Union | 1 | 11/07/2017 | |
| Others (2) | 0110990 | European Union | 1 | 11/07/2017 | |
| Tree nuts | 0120000 | European Union | 0.5 | 11/07/2017 | |
| Almonds (Apricot kernels, Bitter almonds, Canarium nuts/galip nuts, Pili nuts, Okari nuts,) | 0120010 | European Union | 0.5 | 11/07/2017 | |
| Brazil nuts | 0120020 | European Union | 0.5 | 11/07/2017 | |
| Cashew nuts | 0120030 | European Union | 0.5 | 11/07/2017 | |
| Chestnuts | 0120040 | European Union | 0.5 | 11/07/2017 |