Relevant Regulations and Standards
Nicotine(F06032)
| Common Name | Nicotine(F06032) |
| FRCD ID | F06032 |
| Formula | C10H14N2 |
| InChI Key | SNICXCGAKADSCV-JTQLQIEISA-N |
| InChI | InChI=1S/C10H14N2/c1-12-7-3-5-10(12)9-4-2-6-11-8-9/h2,4,6,8,10H,3,5,7H2,1H3/t10-/m0/s1 |
| Canonical SMILES | CN1CCCC1C2=CN=CC=C2 |
| Isomeric SMILES | CN1CCC[C@H]1C2=CN=CC=C2 |
| Classifies | Pesticide |
| Update Date | Nov 13, 2018 17:07 |
MRLs
| Food | Product Code | Country | MRLs | Application Date | Notes |
|---|---|---|---|---|---|
| Thyme (Creeping thyme, Cretan oregano/Turkish oregano, Lemon savory, Lemon thyme/citrus thyme, Marjoram, Mastic thyme, Oregano, Summer savory, Syrian oregano/bible hyssop/za'atar, Winter savory,) | 0256070 | European Union | 0.4 | 04/01/2018 | |
| Basil and edible flowers (Apple mint, Asiatic pennywort, Bergamot mint/eau-de-Cologne mint, Corsican mint, Courgette (edible flowers), Gingermint, Greek bush basil, Hoary basil, Holy basil/tulsi, Lemon balm, Lemon basil, Lesser calamint, Lizard tail/dap ca, Marigold (edible flowers), Marigold (edible flowers), Other species of the genus Tagetes, not elsewhere mentioned, Nasturtium (leaves and edible flowers), Nasturtium (leaves and edible flowers), Pennyroyal, Peppermint, Pot marigold (edible flowers), Rice paddy herb/phak ka yaeng, Spearmint, Thai basil, Vietnamese mint, Water mint, Other edible flowers, Other species and hybrids of genus Mentha, not elsewhere mentioned,) | 0256080 | European Union | 0.4 | 04/01/2018 | |
| Pear | Japan | 2ppm | |||
| Allspice/pimento | 0820010 | European Union | 0.3 | 04/01/2018 | |
| Rose hips | 0154050 | European Union | 0.3 | 04/01/2018 | |
| (f) herbs and edible flowers | 0256000 | European Union | 0.4 | 04/01/2018 | |
| Chervil | 0256010 | European Union | 0.4 | 04/01/2018 | |
| Chives (Chinese chives/oriental garlic/garlic chives, Ramson/wild garlic/bear's garlic,) | 0256020 | European Union | 0.4 | 04/01/2018 | |
| Parsley (Root parsley leaves,) | 0256040 | European Union | 0.4 | 04/01/2018 | |
| Sage (Borage, Curry herb, Greek sage, Jamé's sage/Mexican sage, Other species and hybrids of genus Salvia, not elsewhere mentioned,) | 0256050 | European Union | 0.4 | 04/01/2018 | |
| Rosemary (Santolina/green lavander cotton, Green santolina,) | 0256060 | European Union | 0.4 | 04/01/2018 | |
| Fruit spices | 0820000 | European Union | 0.3 | 04/01/2018 | |
| Laurel/bay leaves (Curry leaves, Kaffir lime leaves, Siamese cassia, Wild betel leaves, Pandan leaves,) | 0256090 | European Union | 0.4 | 04/01/2018 | |
| Tarragon (Aztec sweet herb, Epazote/Mexican tea/wormseed, Hyssop, Lemongrass, Mexican oregano, Nettle, Other species of the genus Urtica, not elsewhere mentioned, Russian tarragon, Stevia,) | 0256100 | European Union | 0.4 | 04/01/2018 | |
| Others (2) | 0256990 | European Union | 0.4 | 04/01/2018 | |
| Wild fungi (Ceps/porcino mushrooms, Chanterelles, Hedgehog mushrooms, Horns of plenty/black trumpets, Morels, Périgord black truffles, Piemont white truffles, Saint George's mushrooms, Scotch bonnet mushrooms, Summer truffles, Other wild fungi, Other species of genus Tuber, not elsewhere mentioned,) | 0280020 | European Union | 0.04 | 04/01/2018 | |
| Teas | 0610000 | European Union | 0.6 | 04/01/2018 | |
| Herbal infusions from | 0630000 | European Union | 0.5 | 04/01/2018 | |
| (a) flowers | 0631000 | European Union | 0.5 | 04/01/2018 | |
| Chamomile | 0631010 | European Union | 0.5 | 04/01/2018 |