| Common Name | Metconazole(F06036) |
| FRCD ID | F06036 |
| Formula | C17H22ClN3O |
| InChI Key | XWPZUHJBOLQNMN-UHFFFAOYSA-N |
| InChI | InChI=1S/C17H22ClN3O/c1-16(2)8-7-14(9-13-3-5-15(18)6-4-13)17(16,22)10-21-12-19-11-20-21/h3-6,11-12,14,22H,7-10H2,1-2H3 |
| Canonical SMILES | CC1(CCC(C1(CN2C=NC=N2)O)CC3=CC=C(C=C3)Cl)C |
| Isomeric SMILES | CC1(CCC(C1(CN2C=NC=N2)O)CC3=CC=C(C=C3)Cl)C |
| Classifies | Pesticide |
| Update Date | Nov 13, 2018 17:07 |
| Food | Product Code | Country | MRLs | Application Date | Notes |
|---|---|---|---|---|---|
| Fat | 1011020 | European Union | 0.02* | 24/11/2016 | |
| (b) bovine (American buffalo, Banteng, Buffalo, European buffalo/wisent, Gayal, Yak (domestic), Zebu, Hybrids of genera Bison, Bos, Bubalus and Poëphagus,) | 1012000 | European Union | 0.02* | 24/11/2016 | |
| (c) sheep (Mouflon (farmed),) | 1013000 | European Union | 0.02* | 24/11/2016 | |
| Edible offals (other than liver and kidney) | 1013050 | European Union | 0.02* | 24/11/2016 | |
| (f) poultry (Bobwhite quail, Chicken (including silkie chicken), Collared Dove, Duck, Geese, Green peafowl, Guinea fowl, Japanese quail, Muskovy duck, Mute swan, Partridge, Peafowl, Pheasant, Pigeon, Quail, Turkey, Turtle dove, Other farmed birds of order Anseriformes, Other farmed birds of order Columbiformes, Other farmed birds of order Galliformes,) | 1016000 | European Union | 0.02* | 24/11/2016 | |
| Macadamias | 0120070 | European Union | 0.05* | 24/11/2016 | |
| Liver | 1011030 | European Union | 0.02* | 24/11/2016 | |
| Kidney | 1011040 | European Union | 0.02* | 24/11/2016 | |
| Edible offals (other than liver and kidney) | 1011050 | European Union | 0.02* | 24/11/2016 | |
| Others (2) | 1011990 | European Union | 0.02* | 24/11/2016 | |
| Muscle | 1012010 | European Union | 0.02* | 24/11/2016 | |
| Fat | 1012020 | European Union | 0.02* | 24/11/2016 | |
| Liver | 1012030 | European Union | 0.02* | 24/11/2016 | |
| Kidney | 1012040 | European Union | 0.02* | 24/11/2016 | |
| Muscle | 1013010 | European Union | 0.02* | 24/11/2016 | |
| Fat | 1013020 | European Union | 0.02* | 24/11/2016 | |
| Liver | 1013030 | European Union | 0.02* | 24/11/2016 | |
| Kidney | 1013040 | European Union | 0.02* | 24/11/2016 | |
| Others (2) | 1013990 | European Union | 0.02* | 24/11/2016 | |
| d) goat | 1014000 | European Union | 0.02* | 24/11/2016 |