| Common Name | Chlorfenson(F06048) |
| FRCD ID | F06048 |
| Formula | C12H8Cl2O3S |
| InChI Key | RZXLPPRPEOUENN-UHFFFAOYSA-N |
| InChI | InChI=1S/C12H8Cl2O3S/c13-9-1-5-11(6-2-9)17-18(15,16)12-7-3-10(14)4-8-12/h1-8H |
| Canonical SMILES | C1=CC(=CC=C1OS(=O)(=O)C2=CC=C(C=C2)Cl)Cl |
| Isomeric SMILES | C1=CC(=CC=C1OS(=O)(=O)C2=CC=C(C=C2)Cl)Cl |
| Classifies | Pesticide |
| Update Date | Nov 13, 2018 17:07 |
| Food | Product Code | Country | MRLs | Application Date | Notes |
|---|---|---|---|---|---|
| Granate apples/pomegranates | 0163050 | European Union | 0.01* | 01/09/2008 | |
| Cherimoyas (Elephant apples, Ilamas, Mammey sapotes, Marmeladedos, Pulasans, Rambutans/hairy litchis, Sapodillas, Sweetsops/sugar apples, Wild sweetsops/custard apples,) | 0163060 | European Union | 0.01* | 01/09/2008 | |
| Guavas (Brazilian guavas, Cattley guavas, Costarican guavas, Guayabillos, Parà guavas,) | 0163070 | European Union | 0.01* | 01/09/2008 | |
| Pineapples | 0163080 | European Union | 0.01* | 01/09/2008 | |
| Breadfruits (Jackfruits, Other species of genus Artocarpus, not elsewhere mentioned,) | 0163090 | European Union | 0.01* | 01/09/2008 | |
| Durians | 0163100 | European Union | 0.01* | 01/09/2008 | |
| Soursops/guanabanas | 0163110 | European Union | 0.01* | 01/09/2008 | |
| Others (2) | 0163990 | European Union | 0.01* | 01/09/2008 | |
| VEGETABLES, FRESH or FROZEN | 0200000 | European Union | 0.01* | 01/09/2008 | |
| Root and tuber vegetables | 0210000 | European Union | 0.01* | 01/09/2008 | |
| (a) potatoes (Andigena,) | 0211000 | European Union | 0.01* | 01/09/2008 | |
| (b) tropical root and tuber vegetables | 0212000 | European Union | 0.01* | 01/09/2008 | |
| Cassava roots/manioc (Blue taros/blue tannias, Canna, Chayotes/christophines roots, Dasheen taros, Eddoe taros, Konjac roots, Tannias/arrowleaf elephant ears/tajer,) | 0212010 | European Union | 0.01* | 01/09/2008 | |
| Sweet potatoes | 0212020 | European Union | 0.01* | 01/09/2008 | |
| Yams (Amazonian yam beans/potato beans, American groundnuts tubers, Andean yam beans, Mexican yam beans,) | 0212030 | European Union | 0.01* | 01/09/2008 | |
| Oat | 0500050 | European Union | 0.01* | 01/09/2008 | |
| Beetroots | 0213010 | European Union | 0.01* | 01/09/2008 | |
| Carrots (Coloured carrots varieties, Baby carrots,) | 0213020 | European Union | 0.01* | 01/09/2008 | |
| Celeriacs/turnip rooted celeries | 0213030 | European Union | 0.01* | 01/09/2008 | |
| Jerusalem artichokes (Crosnes/Chinese artichokes, Mashua, Oca, Pale-leaf sunflower, Tuberous peas,) | 0213050 | European Union | 0.01* | 01/09/2008 |