Relevant Regulations and Standards
Amidosulfuron(F06049)
| Common Name | Amidosulfuron(F06049) |
| FRCD ID | F06049 |
| Formula | C9H15N5O7S2 |
| InChI Key | CTTHWASMBLQOFR-UHFFFAOYSA-N |
| InChI | InChI=1S/C9H15N5O7S2/c1-14(22(4,16)17)23(18,19)13-9(15)12-8-10-6(20-2)5-7(11-8)21-3/h5H,1-4H3,(H2,10,11,12,13,15) |
| Canonical SMILES | CN(S(=O)(=O)C)S(=O)(=O)NC(=O)NC1=NC(=CC(=N1)OC)OC |
| Isomeric SMILES | CN(S(=O)(=O)C)S(=O)(=O)NC(=O)NC1=NC(=CC(=N1)OC)OC |
| Classifies | Pesticide |
| Update Date | Nov 13, 2018 17:07 |
MRLs
| Food | Product Code | Country | MRLs | Application Date | Notes |
|---|---|---|---|---|---|
| Radishes (Black radishes/winter radishes/ 'Gros noir d'hiver', Daikon/japanese radishes, Maca roots, Small radishes, Tigernuts,) | 0213080 | European Union | 0.01* | 12/02/2016 | |
| Rye | 0500070 | European Union | 0.01* | 12/02/2016 | |
| Others (2) | 0161990 | European Union | 0.01* | 12/02/2016 | |
| (b) inedible peel, small | 0162000 | European Union | 0.01* | 12/02/2016 | |
| Kiwi fruits (green, red, yellow) | 0162010 | European Union | 0.01* | 12/02/2016 | |
| Litchis/lychees (Longans, Marulas, Salaks/snake fruits, Spanish limes/mamoncillos/genips, Baels,) | 0162020 | European Union | 0.01* | 12/02/2016 | |
| Passionfruits/maracujas (Banana passionfruits, Giant granadillas, Granadillas, Monstera fruits, Wingedstem passionflower fruits,) | 0162030 | European Union | 0.01* | 12/02/2016 | |
| Prickly pears/cactus fruits (Pitayas/dragon fruits, Red pitayas, Saguaro fruits, Yellow pitayas,) | 0162040 | European Union | 0.01* | 12/02/2016 | |
| Star apples/cainitos | 0162050 | European Union | 0.01* | 12/02/2016 | |
| American persimmons/Virginia kaki (Black sapotes, Green sapotes, White sapotes, Yellow sapotes/canistels,) | 0162060 | European Union | 0.01* | 12/02/2016 | |
| Others (2) | 0162990 | European Union | 0.01* | 12/02/2016 | |
| (c) inedible peel, large | 0163000 | European Union | 0.01* | 12/02/2016 | |
| Avocados (Avocados for oil production,) | 0163010 | European Union | 0.01* | 12/02/2016 | |
| Bananas (Cavendishes/grand nains, Cavendishes/grand nains, Cavendishes/grand nains, Dwarf bananas/lady fingers bananas, Plantains, Plantains, Plantains,) | 0163020 | European Union | 0.01* | 12/02/2016 | |
| Mangoes | 0163030 | European Union | 0.01* | 12/02/2016 | |
| Others (2) | 0233990 | European Union | 0.01* | 12/02/2016 | |
| Granate apples/pomegranates | 0163050 | European Union | 0.01* | 12/02/2016 | |
| Guavas (Brazilian guavas, Cattley guavas, Costarican guavas, Guayabillos, Parà guavas,) | 0163070 | European Union | 0.01* | 12/02/2016 | |
| Pineapples | 0163080 | European Union | 0.01* | 12/02/2016 | |
| Breadfruits (Jackfruits, Other species of genus Artocarpus, not elsewhere mentioned,) | 0163090 | European Union | 0.01* | 12/02/2016 |