| Common Name | Cyflufenamid(F06055) |
| FRCD ID | F06055 |
| Formula | C20H17F5N2O2 |
| InChI Key | ACMXQHFNODYQAT-UHFFFAOYSA-N |
| InChI | InChI=1S/C20H17F5N2O2/c21-15-9-8-14(20(23,24)25)17(18(15)22)19(27-29-11-13-6-7-13)26-16(28)10-12-4-2-1-3-5-12/h1-5,8-9,13H,6-7,10-11H2,(H,26,27,28) |
| Canonical SMILES | C1CC1CONC(=NC(=O)CC2=CC=CC=C2)C3=C(C=CC(=C3F)F)C(F)(F)F |
| Isomeric SMILES | C1CC1CONC(=NC(=O)CC2=CC=CC=C2)C3=C(C=CC(=C3F)F)C(F)(F)F |
| Classifies | Pesticide |
| Update Date | Nov 13, 2018 17:07 |
| Food | Product Code | Country | MRLs | Application Date | Notes |
|---|---|---|---|---|---|
| Melons (Kiwanos/horned melons,) | 0233010 | European Union | 0.04 | 23/02/2017 | |
| SUGAR PLANTS | 0900000 | European Union | 0.02* | 23/02/2017 | |
| Others (2) | 0220990 | European Union | 0.02* | 23/02/2017 | |
| Sweet peppers/bell peppers (Chili peppers,) | 0231020 | European Union | 0.04 | 23/02/2017 | |
| Aubergines/eggplants (Antroewas/African eggplants/gboma, Ethiopian eggplants/gilo', Pepinos, Thorn apples, Turkey berries/devil's figs/pea eggplants/pea aubergines, Kangaroo apples/poroporo,) | 0231030 | European Union | 0.02* | 23/02/2017 | |
| Okra/lady's fingers | 0231040 | European Union | 0.02* | 23/02/2017 | |
| Others (2) | 0231990 | European Union | 0.02* | 23/02/2017 | |
| Cucumbers (Armenian cucumbers, Dosakayi/Indian curry cucumbers,) | 0232010 | European Union | 0.04 | 23/02/2017 | |
| Gherkins (Bur gherkins,) | 0232020 | European Union | 0.08 | 23/02/2017 | |
| Courgettes (Angled luffas/teroi, Bottle gourds/calabashes/lauki, Chayotes/christophines, Ivy gourds, Pointed gourds/parwals, Snake gourds, Sopropos/bitter melons/balsam pears, Summer squashes/zucchini/pâtissons/pattypan squashes/marrows,) | 0232030 | European Union | 0.05 | 23/02/2017 | |
| Others (2) | 0232990 | European Union | 0.02* | 23/02/2017 | |
| (c) cucurbits with inedible peel | 0233000 | European Union | 0.04 | 23/02/2017 | |
| Pumpkins (Butternut squashes, Winter melons/winter gourds/white gourds, Winter squashes/red kuri squashes/marrows (late varieties),) | 0233020 | European Union | 0.04 | 23/02/2017 | |
| Watermelons | 0233030 | European Union | 0.04 | 23/02/2017 | |
| Others (2) | 0233990 | European Union | 0.04 | 23/02/2017 | |
| (d) sweet corn (Baby corn,) | 0234000 | European Union | 0.02* | 23/02/2017 | |
| (e) other fruiting vegetables | 0239000 | European Union | 0.02* | 23/02/2017 | |
| Brassica vegetables (excluding brassica roots and brassica baby leaf crops) | 0240000 | European Union | 0.02* | 23/02/2017 | |
| (a) flowering brassica | 0241000 | European Union | 0.02* | 23/02/2017 | |
| Broccoli (Calabrese, Chinese broccoli/kai-lan, Choi sum/tsoi sam, Rapini/broccoletti/broccoli raab,) | 0241010 | European Union | 0.02* | 23/02/2017 |