Relevant Regulations and Standards
Metalaxyl-M(F06125)
| Common Name | Metalaxyl-M(F06125) |
| FRCD ID | F06125 |
| Formula | C15H21NO4 |
| InChI Key | ZQEIXNIJLIKNTD-GFCCVEGCSA-N |
| InChI | InChI=1S/C15H21NO4/c1-10-7-6-8-11(2)14(10)16(13(17)9-19-4)12(3)15(18)20-5/h6-8,12H,9H2,1-5H3/t12-/m1/s1 |
| Canonical SMILES | CC1=C(C(=CC=C1)C)N(C(C)C(=O)OC)C(=O)COC |
| Isomeric SMILES | CC1=C(C(=CC=C1)C)N([C@H](C)C(=O)OC)C(=O)COC |
| Classifies | Pesticide |
| Update Date | Nov 13, 2018 17:07 |
MRLs
| Food | Product Code | Country | MRLs | Application Date | Notes |
|---|---|---|---|---|---|
| Rhubarbs | 0270070 | European Union | 0.01* | 21/01/2018 | |
| Palm hearts | 0270090 | European Union | 0.01* | 21/01/2018 | |
| Others (2) | 0270990 | European Union | 0.01* | 21/01/2018 | |
| Fungi, mosses and lichens | 0280000 | European Union | 0.01* | 21/01/2018 | |
| Wild fungi (Ceps/porcino mushrooms, Chanterelles, Hedgehog mushrooms, Horns of plenty/black trumpets, Morels, Périgord black truffles, Piemont white truffles, Saint George's mushrooms, Scotch bonnet mushrooms, Summer truffles, Other wild fungi, Other species of genus Tuber, not elsewhere mentioned,) | 0280020 | European Union | 0.01* | 21/01/2018 | |
| Mosses and lichens (Icelandic mosses, Other mosses and lichens,) | 0280990 | European Union | 0.01* | 21/01/2018 | |
| Algae and prokaryotes organisms (Carrageen mosses/Irish mosses, Kombu, Spirulina, Spirulina, Other algae, Other procaryotes organisms, Rockweed /knotted kelp,) | 0290000 | European Union | 0.01* | 21/01/2018 | |
| Beans (Azuki beans, Black eyed peas/cowpeas, Broad beans/fava beans/horse beans/tic beans, Borlotti beans/cannelini beans/common beans/flageolets/French beans/slicing beans/snap beans, Ervils/lentil vetches, Guar beans, Jack beans, Lablab beans/hyacinth beans, Lima beans/butter beans, Monantha vetches, Mung beans, Rice beans, Runner beans/scarlet runner beans, Stink beans, Vetches, Yardlong beans,) | 0300010 | European Union | 0.02* | 21/01/2018 | |
| Lentils | 0300020 | European Union | 0.01* | 21/01/2018 | |
| Peas (Asparagus peas, Chickling vetches, Chickpeas/Bengal gram, Garden peas/green peas/mangetout/snow peas/split peas/sugar peas, Pigeon peas,) | 0300030 | European Union | 0.02* | 21/01/2018 | |
| Lupins/lupini beans | 0300040 | European Union | 0.02* | 21/01/2018 | |
| Others (2) | 0300990 | European Union | 0.01* | 21/01/2018 | |
| Linseeds | 0401010 | European Union | 0.02* | 21/01/2018 | |
| Peanuts/groundnuts | 0401020 | European Union | 0.01* | 21/01/2018 | |
| Poppy seeds | 0401030 | European Union | 0.02* | 21/01/2018 | |
| Sesame seeds | 0401040 | European Union | 0.01* | 21/01/2018 | |
| Sunflower seeds | 0401050 | European Union | 0.02* | 21/01/2018 | |
| Cocoa beans (Kola nuts/Cola nuts, Cupuaçu,) | 0640000 | European Union | 0.1 | 21/01/2018 | |
| Soyabeans (Moringa/drumstick tree seeds,) | 0401070 | European Union | 0.1* | 21/01/2018 | |
| Mustard seeds | 0401080 | European Union | 0.02* | 21/01/2018 |