Relevant Regulations and Standards
Tefluthrin(F06138)
| Common Name | Tefluthrin(F06138) |
| FRCD ID | F06138 |
| Formula | C17H14ClF7O2 |
| InChI Key | ZFHGXWPMULPQSE-SZGBIDFHSA-N |
| InChI | InChI=1S/C17H14ClF7O2/c1-6-11(19)13(21)7(14(22)12(6)20)5-27-15(26)10-8(16(10,2)3)4-9(18)17(23,24)25/h4,8,10H,5H2,1-3H3/b9-4-/t8-,10-/m1/s1 |
| Canonical SMILES | CC1=C(C(=C(C(=C1F)F)COC(=O)C2C(C2(C)C)C=C(C(F)(F)F)Cl)F)F |
| Isomeric SMILES | CC1=C(C(=C(C(=C1F)F)COC(=O)[C@H]2[C@H](C2(C)C)/C=C(/C(F)(F)F)\Cl)F)F |
| Classifies | Pesticide |
| Update Date | Nov 13, 2018 17:07 |
MRLs
| Food | Product Code | Country | MRLs | Application Date | Notes |
|---|---|---|---|---|---|
| Figs | 0161020 | European Union | 0.05 | 05/06/2018 | |
| Table olives (Chinese black olives, Chinese white olives, Desert dates,) | 0161030 | European Union | 0.05 | 05/06/2018 | |
| Carambolas (Ambarellas, Aonlas/Indian gooseberries, Babacos, Bilimbis, Cashew apples, Indian jujubes/bers, Jaboticabas, Malay pommarosas/pomeracs, Malayan mombins, Maprangs/marian plums, Natal plums, Nonis, Pommarosas/rose apples, Purple mombins, Santols/sentuls,) | 0161050 | European Union | 0.05 | 05/06/2018 | |
| Litchis/lychees (Longans, Marulas, Salaks/snake fruits, Spanish limes/mamoncillos/genips, Baels,) | 0162020 | European Union | 0.05 | 05/06/2018 | |
| Bananas (Cavendishes/grand nains, Cavendishes/grand nains, Cavendishes/grand nains, Dwarf bananas/lady fingers bananas, Plantains, Plantains, Plantains,) | 0163020 | European Union | 0.05 | 05/06/2018 | |
| Courgettes (Angled luffas/teroi, Bottle gourds/calabashes/lauki, Chayotes/christophines, Ivy gourds, Pointed gourds/parwals, Snake gourds, Sopropos/bitter melons/balsam pears, Summer squashes/zucchini/pâtissons/pattypan squashes/marrows,) | 0232030 | European Union | 0.05 | 05/06/2018 | |
| Cresses and other sprouts and shoots (Alfalfa/lucerne sprouts, Chinese chives/oriental garlic/garlic chives sprouts, Broccoli sprouts, Daikon/Japanese radish sprouts, Ginger shoots, Mung bean sprouts, Peas shoots and sprouts, Roman rocket/rucola sprouts, Soyabeans sprouts, Sunflower shoots and sprouts, Cereals grasses/cereals shoots, Other species used for the production of sprouts or shoots,) | 0251040 | European Union | 0.05 | 05/06/2018 | |
| Sage (Borage, Curry herb, Greek sage, Jamé's sage/Mexican sage, Other species and hybrids of genus Salvia, not elsewhere mentioned,) | 0256050 | European Union | 0.05 | 05/06/2018 | |
| Thyme (Creeping thyme, Cretan oregano/Turkish oregano, Lemon savory, Lemon thyme/citrus thyme, Marjoram, Mastic thyme, Oregano, Summer savory, Syrian oregano/bible hyssop/za'atar, Winter savory,) | 0256070 | European Union | 0.05 | 05/06/2018 | |
| Basil and edible flowers (Apple mint, Asiatic pennywort, Bergamot mint/eau-de-Cologne mint, Corsican mint, Courgette (edible flowers), Gingermint, Greek bush basil, Hoary basil, Holy basil/tulsi, Lemon balm, Lemon basil, Lesser calamint, Lizard tail/dap ca, Marigold (edible flowers), Marigold (edible flowers), Other species of the genus Tagetes, not elsewhere mentioned, Nasturtium (leaves and edible flowers), Nasturtium (leaves and edible flowers), Pennyroyal, Peppermint, Pot marigold (edible flowers), Rice paddy herb/phak ka yaeng, Spearmint, Thai basil, Vietnamese mint, Water mint, Other edible flowers, Other species and hybrids of genus Mentha, not elsewhere mentioned,) | 0256080 | European Union | 0.05 | 05/06/2018 | |
| Sunflower seeds | 0401050 | European Union | 0.05 | 05/06/2018 | |
| Rapeseeds/canola seeds (Radish seeds, Turnip rape seeds,) | 0401060 | European Union | 0.05 | 05/06/2018 | |
| Rose (Almond, Bee balm, Bitter orange/sour orange, Black locust, Cat’s foot, Chrysanthemum, Cinnamon, Clary sage, Cornflower, Cowslip/primrose, Daisy, Dyer’s broom, Elder, Field poppy, Great mullein, Hawthorn, Heather, Hollyhock, Horse-chestnut, Larkspur, Lavender, Mallow, Meadow sweet, Mullein, Orange, Peony, Red clover, Sacred lotus, Safflower, Sandy everlasting, St. John's wort, Sunflower, Sweet olive/sweet osmanthus, Sweet violet, White deadnettle, Yarrow, Ylang-ylang,) | 0631030 | European Union | 0.05 | 05/06/2018 | |
| Potato | Japan | 0.1ppm | |||
| Sweet peppers/bell peppers (Chili peppers,) | 0231020 | European Union | 0.05 | 05/06/2018 | |
| Laurel/bay leaves (Curry leaves, Kaffir lime leaves, Siamese cassia, Wild betel leaves, Pandan leaves,) | 0256090 | European Union | 0.05 | 05/06/2018 | |
| Kumquats (Marumi kumquats/round kumquats, Nagami kumquats/oval kumquats, Other species and hybrids of genus Fortunella, not elsewhere mentioned,) | 0161040 | European Union | 0.05 | 05/06/2018 | |
| Kaki/Japanese persimmons | 0161060 | European Union | 0.05 | 05/06/2018 | |
| Jambuls/jambolans (Acerolas/Barbados cherries, Arbutus berries, Camu camus, Carandas, Coco plums, Grumichamas/Brazil cherries, Hog plums/yellow mombins, Java apples, Otaheite gooseberries, Sea grapes, Surinam cherries, Water apples, Water berries, Water pears,) | 0161070 | European Union | 0.05 | 05/06/2018 | |
| Others (2) | 0161990 | European Union | 0.05 | 05/06/2018 |