Relevant Regulations and Standards
Diflufenican(F06182)
| Common Name | Diflufenican(F06182) |
| FRCD ID | F06182 |
| Formula | C19H11F5N2O2 |
| InChI Key | WYEHFWKAOXOVJD-UHFFFAOYSA-N |
| InChI | InChI=1S/C19H11F5N2O2/c20-12-6-7-16(15(21)10-12)26-17(27)14-5-2-8-25-18(14)28-13-4-1-3-11(9-13)19(22,23)24/h1-10H,(H,26,27) |
| Canonical SMILES | C1=CC(=CC(=C1)OC2=C(C=CC=N2)C(=O)NC3=C(C=C(C=C3)F)F)C(F)(F)F |
| Isomeric SMILES | C1=CC(=CC(=C1)OC2=C(C=CC=N2)C(=O)NC3=C(C=C(C=C3)F)F)C(F)(F)F |
| Classifies | Pesticide |
| Update Date | Nov 13, 2018 17:07 |
MRLs
| Food | Product Code | Country | MRLs | Application Date | Notes |
|---|---|---|---|---|---|
| Pine nut kernels (Pine nut kernels from other species than Pinus pinea, Pine nut kernels from other species than Pinus pinea, Pine nut kernels from other species than Pinus pinea, Pine nut kernels from other species than Pinus pinea, Pine nut kernels from other species than Pinus pinea, Pine nut kernels from other species than Pinus pinea, Pine nut kernels from other species than Pinus pinea, Other species of genus Pinus, not elsewhere mentioned,) | 0120090 | European Union | 0.01* | 26/04/2017 | |
| Strawberry (Absinth/common wormwood, Agrimony, Alfalfa/lucerne, Aloe (leaf gel), Alpine ladies mantle, Bearberry, Bilberry/European blueberry/whortleberry, Birch, Bitter orange/sour orange, Blackberry, Boldo, Buchu, Buckwheat, Catmint, Centaury, Chiretta, Clary sage, Clubmoss, Common speedwell, Common vervain/common verbena, Cornflower, Cowberry, Currant (black, red and white), Currant (black, red and white), Damiana, Downy hemp nettle, Echinacea, Echinacea, Echinacea, Elder, Eucalyptus, Eyebright, Field horsetail, Fumitory, Goat´s rue, Golden root, Goldenrod, Ground ivy, Gymnema, Hairy rupturewort, Hawthorn, Hazelnut/cobnut, Hearts ease, Heather, Hemp, Hemp, Herb bennet, Holy thistle, Horehound, Horse-chestnut, Ironwort/Greek mountain tea, Jiaogulan, Knotgrass, Ladies mantle, Lemon myrtle, Lemon verbena, Lime/linden, Lime/linden, Lime/linden, Mallow, Marshmallow, Meadowsweet, Mistletoe, Moldavian dragonhead, Mugwort, Mulberry (black and white), Mulberry (black and white), Mullein, Norway spruce, Oat, Olive, Papaya, Passion flower, Plantain, Raspberry (red and yellow), Red clover, Ribwort plantain, Rock rose, Roman wormwood, Shepherd’s purse, Silverweed, Smooth rupturewort, Southernwood, St. John´s Wort, Sweet blackberry, Sweet orange, Sweet trefoil, Sweet woodruff, Tansy, Tea tree, Toadflax, Walnut, Walnut, White deadnettle, Wild angelica, Wild strawberry, Willow herb, Witch hazel, Wood betony, Yarrow, Yellow bedstraw, Yellow sweet clover, Muña,) | 0632010 | European Union | 0.05* | 26/04/2017 | |
| FRUITS, FRESH or FROZEN; TREE NUTS | 0100000 | European Union | 0.01* | 26/04/2017 | |
| Citrus fruits | 0110000 | European Union | 0.01* | 26/04/2017 | |
| Grapefruits (Natsudaidais, Shaddocks/pomelos, Sweeties/oroblancos, Tangelolos, Tangelos (except minneolas)/Ugli®, Other hybrids of Citrus paradisi, not elsewhere mentioned,) | 0110010 | European Union | 0.01* | 26/04/2017 | |
| Oranges (Bergamots, Bitter oranges/sour oranges, Blood oranges, Cara caras, Chinottos, Trifoliate oranges, Other hybrids of Citrus sinensis, not elsewhere mentioned,) | 0110020 | European Union | 0.01* | 26/04/2017 | |
| Lemons (Buddha's hands/Buddha's fingers, Citrons,) | 0110030 | European Union | 0.01* | 26/04/2017 | |
| Limes (Indian sweet limes/Palestine sweet limes, Kaffir limes, Sweet limes/mosambis, Tahiti limes, Limequats,) | 0110040 | European Union | 0.01* | 26/04/2017 | |
| Mandarins (Calamondins, Clementines, Cleopatra mandarins, Minneolas, Satsumas/clausellinas, Tangerines/dancy mandarins, Tangors, Other hybrids of Citrus reticulata, not elsewhere mentioned,) | 0110050 | European Union | 0.01* | 26/04/2017 | |
| Others (2) | 0110990 | European Union | 0.01* | 26/04/2017 | |
| Tree nuts | 0120000 | European Union | 0.01* | 26/04/2017 | |
| Almonds (Apricot kernels, Bitter almonds, Canarium nuts/galip nuts, Pili nuts, Okari nuts,) | 0120010 | European Union | 0.01* | 26/04/2017 | |
| Brazil nuts | 0120020 | European Union | 0.01* | 26/04/2017 | |
| Cashew nuts | 0120030 | European Union | 0.01* | 26/04/2017 | |
| Chestnuts | 0120040 | European Union | 0.01* | 26/04/2017 | |
| Coconuts (Areca nuts/betel nuts,) | 0120050 | European Union | 0.01* | 26/04/2017 | |
| Hazelnuts/cobnuts (Acorns, Filberts,) | 0120060 | European Union | 0.01* | 26/04/2017 | |
| Macadamias | 0120070 | European Union | 0.01* | 26/04/2017 | |
| Pecans (Hickory nuts,) | 0120080 | European Union | 0.01* | 26/04/2017 | |
| Pistachios | 0120100 | European Union | 0.01* | 26/04/2017 |