Relevant Regulations and Standards
Tri-Allate(F06202)
| Common Name | Tri-Allate(F06202) |
| FRCD ID | F06202 |
| Formula | C10H16Cl3NOS |
| InChI Key | MWBPRDONLNQCFV-UHFFFAOYSA-N |
| InChI | InChI=1S/C10H16Cl3NOS/c1-6(2)14(7(3)4)10(15)16-5-8(11)9(12)13/h6-7H,5H2,1-4H3 |
| Canonical SMILES | CC(C)N(C(C)C)C(=O)SCC(=C(Cl)Cl)Cl |
| Isomeric SMILES | CC(C)N(C(C)C)C(=O)SCC(=C(Cl)Cl)Cl |
| Classifies | Pesticide |
| Update Date | Nov 13, 2018 17:07 |
MRLs
| Food | Product Code | Country | MRLs | Application Date | Notes |
|---|---|---|---|---|---|
| Green Soybeans | Japan | 0.08ppm | |||
| Lettuce(Including Cos Lettuce And Leaf Lettuce) | Japan | 0.1ppm | |||
| Welsh(Including Leek) | Japan | 0.1ppm | |||
| Japanese Radish,Leaves(Including Radish) | Japan | 0.1ppm | |||
| (c) inedible peel, large | 0163000 | European Union | 0.1* | 01/09/2008 | |
| Bananas (Cavendishes/grand nains, Cavendishes/grand nains, Cavendishes/grand nains, Dwarf bananas/lady fingers bananas, Plantains, Plantains, Plantains,) | 0163020 | European Union | 0.1* | 01/09/2008 | |
| Radishes (Black radishes/winter radishes/ 'Gros noir d'hiver', Daikon/japanese radishes, Maca roots, Small radishes, Tigernuts,) | 0213080 | European Union | 0.1* | 01/09/2008 | |
| Tomatoes (Alkekengi/Chinese lanterns/ground cherries, Cape gooseberries, Cherry tomatoes, Dwarf Cape gooseberries/strawberry tomatoes, Gojiberries/wolfberries, Gojiberries/wolfberries, Litchi tomatoes/sticky nightshades, Pear-shaped tomatoes, Tomatillos/husk tomatoes,) | 0231010 | European Union | 0.1* | 01/09/2008 | |
| Baby leaf crops (including brassica species) (Chards/beet leaves, Escaroles/broad-leaved endives, Indian mustards/mustard greens, Lettuces, Spinaches, Other species harvested at baby leaf stage,) | 0251080 | European Union | 0.1* | 01/09/2008 | |
| Fungi, mosses and lichens | 0280000 | European Union | 0.1* | 01/09/2008 | |
| Bud spices | 0850000 | European Union | 0.1* | 01/09/2008 | |
| Cloves (Cassia buds, Cassia buds, Cassia buds,) | 0850010 | European Union | 0.1* | 01/09/2008 | |
| Goat | 1020030 | European Union | 0.05* | 01/09/2008 | |
| Horse (Species listed with code numbers 1015000-xxx,) | 1020040 | European Union | 0.05* | 01/09/2008 | |
| Lemon | Japan | 0.1ppm | |||
| FRUITS, FRESH or FROZEN; TREE NUTS | 0100000 | European Union | 0.1* | 01/09/2008 | |
| Citrus fruits | 0110000 | European Union | 0.1* | 01/09/2008 | |
| Grapefruits (Natsudaidais, Shaddocks/pomelos, Sweeties/oroblancos, Tangelolos, Tangelos (except minneolas)/Ugli®, Other hybrids of Citrus paradisi, not elsewhere mentioned,) | 0110010 | European Union | 0.1* | 01/09/2008 | |
| Roman rocket/rucola (Wall rocket,) | 0251060 | European Union | 0.1* | 01/09/2008 | |
| Lemons (Buddha's hands/Buddha's fingers, Citrons,) | 0110030 | European Union | 0.1* | 01/09/2008 |