| Common Name | 1-(3-Aminopropyl)-4-Methyl-1,4,8,11-Tetraazacyclotetradecane(F06242) |
| FRCD ID | F06242 |
| Formula | C14H33N5 |
| InChI Key | ZBUNFVBLQCSLIF-UHFFFAOYSA-N |
| InChI | InChI=1S/C14H33N5/c1-18-10-3-6-16-8-9-17-7-4-12-19(14-13-18)11-2-5-15/h16-17H,2-15H2,1H3 |
| Canonical SMILES | CN1CCCNCCNCCCN(CC1)CCCN |
| Isomeric SMILES | CN1CCCNCCNCCCN(CC1)CCCN |
| Classifies | Pesticide |
| Update Date | Nov 13, 2018 17:07 |
| Food | Product Code | Country | MRLs | Application Date | Notes |
|---|---|---|---|---|---|
| Pine nut kernels (Pine nut kernels from other species than Pinus pinea, Pine nut kernels from other species than Pinus pinea, Pine nut kernels from other species than Pinus pinea, Pine nut kernels from other species than Pinus pinea, Pine nut kernels from other species than Pinus pinea, Pine nut kernels from other species than Pinus pinea, Pine nut kernels from other species than Pinus pinea, Other species of genus Pinus, not elsewhere mentioned,) | 0120090 | European Union | 0.01* | 14/01/2017 | |
| (a) edible peel | 0161000 | European Union | 0.01* | 14/01/2017 | |
| Dates (Açaí berries, Awara palm fruits, Doum palm fruits,) | 0161010 | European Union | 0.01* | 14/01/2017 | |
| Carambolas (Ambarellas, Aonlas/Indian gooseberries, Babacos, Bilimbis, Cashew apples, Indian jujubes/bers, Jaboticabas, Malay pommarosas/pomeracs, Malayan mombins, Maprangs/marian plums, Natal plums, Nonis, Pommarosas/rose apples, Purple mombins, Santols/sentuls,) | 0161050 | European Union | 0.01* | 14/01/2017 | |
| Bulb vegetables | 0220000 | European Union | 0.01* | 14/01/2017 | |
| Onions ('Cipollotto Nocerino PDO', Pearl onions, Rakkyo/Chinese onions, Silverskin onions/pickled onions,) | 0220020 | European Union | 0.01* | 14/01/2017 | |
| Tomatoes (Alkekengi/Chinese lanterns/ground cherries, Cape gooseberries, Cherry tomatoes, Dwarf Cape gooseberries/strawberry tomatoes, Gojiberries/wolfberries, Gojiberries/wolfberries, Litchi tomatoes/sticky nightshades, Pear-shaped tomatoes, Tomatillos/husk tomatoes,) | 0231010 | European Union | 0.01* | 14/01/2017 | |
| Saffron | 0860010 | European Union | 0.01* | 14/01/2017 | |
| Beetroots | 0213010 | European Union | 0.01* | 14/01/2017 | |
| FRUITS, FRESH or FROZEN; TREE NUTS | 0100000 | European Union | 0.01* | 14/01/2017 | |
| Citrus fruits | 0110000 | European Union | 0.01* | 14/01/2017 | |
| Grapefruits (Natsudaidais, Shaddocks/pomelos, Sweeties/oroblancos, Tangelolos, Tangelos (except minneolas)/Ugli®, Other hybrids of Citrus paradisi, not elsewhere mentioned,) | 0110010 | European Union | 0.01* | 14/01/2017 | |
| Oranges (Bergamots, Bitter oranges/sour oranges, Blood oranges, Cara caras, Chinottos, Trifoliate oranges, Other hybrids of Citrus sinensis, not elsewhere mentioned,) | 0110020 | European Union | 0.01* | 14/01/2017 | |
| Lemons (Buddha's hands/Buddha's fingers, Citrons,) | 0110030 | European Union | 0.01* | 14/01/2017 | |
| Limes (Indian sweet limes/Palestine sweet limes, Kaffir limes, Sweet limes/mosambis, Tahiti limes, Limequats,) | 0110040 | European Union | 0.01* | 14/01/2017 | |
| Others (2) | 0110990 | European Union | 0.01* | 14/01/2017 | |
| Tree nuts | 0120000 | European Union | 0.01* | 14/01/2017 | |
| Almonds (Apricot kernels, Bitter almonds, Canarium nuts/galip nuts, Pili nuts, Okari nuts,) | 0120010 | European Union | 0.01* | 14/01/2017 | |
| Brazil nuts | 0120020 | European Union | 0.01* | 14/01/2017 | |
| Cashew nuts | 0120030 | European Union | 0.01* | 14/01/2017 |