Common Name | 3-Decen-2-One(F06243) |
FRCD ID | F06243 |
Formula | C10H18O |
InChI Key | JRPDANVNRUIUAB-CMDGGOBGSA-N |
InChI | InChI=1S/C10H18O/c1-3-4-5-6-7-8-9-10(2)11/h8-9H,3-7H2,1-2H3/b9-8+ |
Canonical SMILES | CCCCCCC=CC(=O)C |
Isomeric SMILES | CCCCCC/C=C/C(=O)C |
Classifies | Pesticide |
Update Date | Nov 13, 2018 17:07 |
Food | Product Code | Country | MRLs | Application Date | Notes |
---|---|---|---|---|---|
FRUITS, FRESH or FROZEN; TREE NUTS | 0100000 | European Union | 0.1* | 10/05/2017 | |
Citrus fruits | 0110000 | European Union | 0.1* | 10/05/2017 | |
Grapefruits (Natsudaidais, Shaddocks/pomelos, Sweeties/oroblancos, Tangelolos, Tangelos (except minneolas)/Ugli®, Other hybrids of Citrus paradisi, not elsewhere mentioned,) | 0110010 | European Union | 0.1* | 10/05/2017 | |
Oranges (Bergamots, Bitter oranges/sour oranges, Blood oranges, Cara caras, Chinottos, Trifoliate oranges, Other hybrids of Citrus sinensis, not elsewhere mentioned,) | 0110020 | European Union | 0.1* | 10/05/2017 | |
Lemons (Buddha's hands/Buddha's fingers, Citrons,) | 0110030 | European Union | 0.1* | 10/05/2017 | |
Limes (Indian sweet limes/Palestine sweet limes, Kaffir limes, Sweet limes/mosambis, Tahiti limes, Limequats,) | 0110040 | European Union | 0.1* | 10/05/2017 | |
Mandarins (Calamondins, Clementines, Cleopatra mandarins, Minneolas, Satsumas/clausellinas, Tangerines/dancy mandarins, Tangors, Other hybrids of Citrus reticulata, not elsewhere mentioned,) | 0110050 | European Union | 0.1* | 10/05/2017 | |
Others (2) | 0110990 | European Union | 0.1* | 10/05/2017 | |
Tree nuts | 0120000 | European Union | 0.1* | 10/05/2017 | |
Almonds (Apricot kernels, Bitter almonds, Canarium nuts/galip nuts, Pili nuts, Okari nuts,) | 0120010 | European Union | 0.1* | 10/05/2017 | |
Brazil nuts | 0120020 | European Union | 0.1* | 10/05/2017 | |
Cashew nuts | 0120030 | European Union | 0.1* | 10/05/2017 | |
Chestnuts | 0120040 | European Union | 0.1* | 10/05/2017 | |
Coconuts (Areca nuts/betel nuts,) | 0120050 | European Union | 0.1* | 10/05/2017 | |
Hazelnuts/cobnuts (Acorns, Filberts,) | 0120060 | European Union | 0.1* | 10/05/2017 | |
Macadamias | 0120070 | European Union | 0.1* | 10/05/2017 | |
Pecans (Hickory nuts,) | 0120080 | European Union | 0.1* | 10/05/2017 | |
Pine nut kernels (Pine nut kernels from other species than Pinus pinea, Pine nut kernels from other species than Pinus pinea, Pine nut kernels from other species than Pinus pinea, Pine nut kernels from other species than Pinus pinea, Pine nut kernels from other species than Pinus pinea, Pine nut kernels from other species than Pinus pinea, Pine nut kernels from other species than Pinus pinea, Other species of genus Pinus, not elsewhere mentioned,) | 0120090 | European Union | 0.1* | 10/05/2017 | |
Pistachios | 0120100 | European Union | 0.1* | 10/05/2017 | |
Walnuts | 0120110 | European Union | 0.1* | 10/05/2017 |