| Common Name | Bixafen(F06254) |
| FRCD ID | F06254 |
| Formula | C18H12Cl2F3N3O |
| InChI Key | LDLMOOXUCMHBMZ-UHFFFAOYSA-N |
| InChI | InChI=1S/C18H12Cl2F3N3O/c1-26-8-12(16(25-26)17(22)23)18(27)24-15-5-3-10(21)7-11(15)9-2-4-13(19)14(20)6-9/h2-8,17H,1H3,(H,24,27) |
| Canonical SMILES | CN1C=C(C(=N1)C(F)F)C(=O)NC2=C(C=C(C=C2)F)C3=CC(=C(C=C3)Cl)Cl |
| Isomeric SMILES | CN1C=C(C(=N1)C(F)F)C(=O)NC2=C(C=C(C=C2)F)C3=CC(=C(C=C3)Cl)Cl |
| Classifies | Pesticide |
| Update Date | Nov 13, 2018 17:07 |
| Food | Product Code | Country | MRLs | Application Date | Notes |
|---|---|---|---|---|---|
| Others (2) | 0260990 | European Union | 0.01* | 05/06/2018 | |
| Stem vegetables | 0270000 | European Union | 0.01* | 05/06/2018 | |
| Asparagus (Hop sprouts,) | 0270010 | European Union | 0.01* | 05/06/2018 | |
| Cardoons (Borage stems,) | 0270020 | European Union | 0.01* | 05/06/2018 | |
| Celeries | 0270030 | European Union | 0.01* | 05/06/2018 | |
| Florence fennels | 0270040 | European Union | 0.01* | 05/06/2018 | |
| Globe artichokes (Banana flowers,) | 0270050 | European Union | 0.01* | 05/06/2018 | |
| Leeks (Kurrat/Egyptian leek,) | 0270060 | European Union | 0.01* | 05/06/2018 | |
| Rhubarbs | 0270070 | European Union | 0.01* | 05/06/2018 | |
| Bamboo shoots (European bamboo /Japanese knotweed,) | 0270080 | European Union | 0.01* | 05/06/2018 | |
| Palm hearts | 0270090 | European Union | 0.01* | 05/06/2018 | |
| Others (2) | 0270990 | European Union | 0.01* | 05/06/2018 | |
| Fungi, mosses and lichens | 0280000 | European Union | 0.01* | 05/06/2018 | |
| (b) leaves and herbs | 0632000 | European Union | 0.01* | 05/06/2018 | |
| SUGAR PLANTS | 0900000 | European Union | 0.01* | 05/06/2018 | |
| Sugar beet roots | 0900010 | European Union | 0.01* | 05/06/2018 | |
| Wild fungi (Ceps/porcino mushrooms, Chanterelles, Hedgehog mushrooms, Horns of plenty/black trumpets, Morels, Périgord black truffles, Piemont white truffles, Saint George's mushrooms, Scotch bonnet mushrooms, Summer truffles, Other wild fungi, Other species of genus Tuber, not elsewhere mentioned,) | 0280020 | European Union | 0.01* | 05/06/2018 | |
| Mosses and lichens (Icelandic mosses, Other mosses and lichens,) | 0280990 | European Union | 0.01* | 05/06/2018 | |
| Algae and prokaryotes organisms (Carrageen mosses/Irish mosses, Kombu, Spirulina, Spirulina, Other algae, Other procaryotes organisms, Rockweed /knotted kelp,) | 0290000 | European Union | 0.01* | 05/06/2018 | |
| PULSES | 0300000 | European Union | 0.01* | 05/06/2018 |