| Common Name | Indolylbutyric Acid(F06293) |
| FRCD ID | F06293 |
| Formula | C12H13NO2 |
| InChI Key | VYPKFHFVKFKHMK-UHFFFAOYSA-N |
| InChI | InChI=1S/C12H13NO2/c1-2-9(12(14)15)11-7-8-5-3-4-6-10(8)13-11/h3-7,9,13H,2H2,1H3,(H,14,15) |
| Canonical SMILES | CCC(C1=CC2=CC=CC=C2N1)C(=O)O |
| Isomeric SMILES | CCC(C1=CC2=CC=CC=C2N1)C(=O)O |
| Classifies | Pesticide |
| Update Date | Nov 13, 2018 17:07 |
| Food | Product Code | Country | MRLs | Application Date | Notes |
|---|---|---|---|---|---|
| FRUITS, FRESH or FROZEN; TREE NUTS | 0100000 | European Union | 0.1* | 16/08/2016 | |
| Citrus fruits | 0110000 | European Union | 0.1* | 16/08/2016 | |
| Grapefruits (Natsudaidais, Shaddocks/pomelos, Sweeties/oroblancos, Tangelolos, Tangelos (except minneolas)/Ugli®, Other hybrids of Citrus paradisi, not elsewhere mentioned,) | 0110010 | European Union | 0.1* | 16/08/2016 | |
| Roman rocket/rucola (Wall rocket,) | 0251060 | European Union | 0.1* | 16/08/2016 | |
| Lemons (Buddha's hands/Buddha's fingers, Citrons,) | 0110030 | European Union | 0.1* | 16/08/2016 | |
| Limes (Indian sweet limes/Palestine sweet limes, Kaffir limes, Sweet limes/mosambis, Tahiti limes, Limequats,) | 0110040 | European Union | 0.1* | 16/08/2016 | |
| Mandarins (Calamondins, Clementines, Cleopatra mandarins, Minneolas, Satsumas/clausellinas, Tangerines/dancy mandarins, Tangors, Other hybrids of Citrus reticulata, not elsewhere mentioned,) | 0110050 | European Union | 0.1* | 16/08/2016 | |
| Others (2) | 0110990 | European Union | 0.1* | 16/08/2016 | |
| Tree nuts | 0120000 | European Union | 0.1* | 16/08/2016 | |
| Almonds (Apricot kernels, Bitter almonds, Canarium nuts/galip nuts, Pili nuts, Okari nuts,) | 0120010 | European Union | 0.1* | 16/08/2016 | |
| Brazil nuts | 0120020 | European Union | 0.1* | 16/08/2016 | |
| Cashew nuts | 0120030 | European Union | 0.1* | 16/08/2016 | |
| Chestnuts | 0120040 | European Union | 0.1* | 16/08/2016 | |
| Coconuts (Areca nuts/betel nuts,) | 0120050 | European Union | 0.1* | 16/08/2016 | |
| Hazelnuts/cobnuts (Acorns, Filberts,) | 0120060 | European Union | 0.1* | 16/08/2016 | |
| Macadamias | 0120070 | European Union | 0.1* | 16/08/2016 | |
| Pecans (Hickory nuts,) | 0120080 | European Union | 0.1* | 16/08/2016 | |
| Pistachios | 0120100 | European Union | 0.1* | 16/08/2016 | |
| Walnuts | 0120110 | European Union | 0.1* | 16/08/2016 | |
| Others (2) | 0120990 | European Union | 0.1* | 16/08/2016 |