Relevant Regulations and Standards
Isopyrazam(F06297)
| Common Name | Isopyrazam(F06297) |
| FRCD ID | F06297 |
| Formula | C20H23F2N3O |
| InChI Key | XTDZGXBTXBEZDN-UHFFFAOYSA-N |
| InChI | InChI=1S/C20H23F2N3O/c1-10(2)16-12-7-8-13(16)17-11(12)5-4-6-15(17)23-20(26)14-9-25(3)24-18(14)19(21)22/h4-6,9-10,12-13,16,19H,7-8H2,1-3H3,(H,23,26) |
| Canonical SMILES | CC(C)C1C2CCC1C3=C2C=CC=C3NC(=O)C4=CN(N=C4C(F)F)C |
| Isomeric SMILES | CC(C)C1C2CCC1C3=C2C=CC=C3NC(=O)C4=CN(N=C4C(F)F)C |
| Classifies | Pesticide |
| Update Date | Nov 13, 2018 17:07 |
MRLs
| Food | Product Code | Country | MRLs | Application Date | Notes |
|---|---|---|---|---|---|
| Citrus fruits | 0110000 | European Union | 0.01* | 29/07/2015 | |
| Grapefruits (Natsudaidais, Shaddocks/pomelos, Sweeties/oroblancos, Tangelolos, Tangelos (except minneolas)/Ugli®, Other hybrids of Citrus paradisi, not elsewhere mentioned,) | 0110010 | European Union | 0.01* | 29/07/2015 | |
| Oranges (Bergamots, Bitter oranges/sour oranges, Blood oranges, Cara caras, Chinottos, Trifoliate oranges, Other hybrids of Citrus sinensis, not elsewhere mentioned,) | 0110020 | European Union | 0.01* | 29/07/2015 | |
| Lemons (Buddha's hands/Buddha's fingers, Citrons,) | 0110030 | European Union | 0.01* | 29/07/2015 | |
| Limes (Indian sweet limes/Palestine sweet limes, Kaffir limes, Sweet limes/mosambis, Tahiti limes, Limequats,) | 0110040 | European Union | 0.01* | 29/07/2015 | |
| Mandarins (Calamondins, Clementines, Cleopatra mandarins, Minneolas, Satsumas/clausellinas, Tangerines/dancy mandarins, Tangors, Other hybrids of Citrus reticulata, not elsewhere mentioned,) | 0110050 | European Union | 0.01* | 29/07/2015 | |
| Others (2) | 0110990 | European Union | 0.01* | 29/07/2015 | |
| Tree nuts | 0120000 | European Union | 0.01* | 29/07/2015 | |
| Brazil nuts | 0120020 | European Union | 0.01* | 29/07/2015 | |
| Cashew nuts | 0120030 | European Union | 0.01* | 29/07/2015 | |
| Chestnuts | 0120040 | European Union | 0.01* | 29/07/2015 | |
| Coconuts (Areca nuts/betel nuts,) | 0120050 | European Union | 0.01* | 29/07/2015 | |
| Hazelnuts/cobnuts (Acorns, Filberts,) | 0120060 | European Union | 0.01* | 29/07/2015 | |
| Macadamias | 0120070 | European Union | 0.01* | 29/07/2015 | |
| Pecans (Hickory nuts,) | 0120080 | European Union | 0.01* | 29/07/2015 | |
| Pistachios | 0120100 | European Union | 0.01* | 29/07/2015 | |
| Walnuts | 0120110 | European Union | 0.01* | 29/07/2015 | |
| Others (2) | 0120990 | European Union | 0.01* | 29/07/2015 | |
| Pome fruits | 0130000 | European Union | 0.7 | 29/07/2015 | |
| Apples (Crab apples/wild apples, Tejocotes,) | 0130010 | European Union | 0.7 | 29/07/2015 |